Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
C3a receptor agonist | 770 | None | 35 | Human | Binding | pIC50 | = | - | 6.10 | - | 1 | IC50 determined in a radioligand displacement assay; displacing [125I]C3a from hC3a receptor expressed in HMC1 cells co-expressing aequorin. | Guide to Pharmacology | 433.3 | 7 | 1 | 3 | 4.49 | O=C(NC1CCN(C(=O)CCc2cccnc2)CC1)C(c1ccccc1)C1CCCCC1 | https://pubmed.ncbi.nlm.nih.gov/17459702 | |
C3a receptor agonist | 770 | None | 35 | Human | Binding | IC50 | = | 794.33 | 6.10 | - | 1 | Displacement of [125I]C3a from human C3a receptor expressed in HMC1 cells co-expressing aequorin | ChEMBL | 433.3 | 7 | 1 | 3 | 4.49 | O=C(NC1CCN(C(=O)CCc2cccnc2)CC1)C(c1ccccc1)C1CCCCC1 | https://dx.doi.org/10.1016/j.bmcl.2007.04.023 | |
C3a receptor agonist | 770 | None | 35 | Human | Binding | IC50 | = | 5011.87 | 5.30 | - | 1 | Displacement of [125I]C3a from human C3a receptor expressed in HMC1 cells co-expressing aequorin | ChEMBL | 433.3 | 7 | 1 | 3 | 4.49 | O=C(NC1CCN(C(=O)CCc2cccnc2)CC1)C(c1ccccc1)C1CCCCC1 | https://dx.doi.org/10.1016/j.bmcl.2007.04.023 | |
C3a receptor agonist | 770 | None | 35 | Human | Binding | IC50 | = | 316.23 | 6.50 | - | 1 | Displacement of [125I]C3a from human C3a receptor expressed in HMC1 cells co-expressing aequorin | ChEMBL | 433.3 | 7 | 1 | 3 | 4.49 | O=C(NC1CCN(C(=O)CCc2cccnc2)CC1)C(c1ccccc1)C1CCCCC1 | https://dx.doi.org/10.1016/j.bmcl.2007.04.023 | |
CHEMBL1169838 | 210996 | None | 0 | Human | Binding | IC50 | = | 1600.00 | 5.80 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1169838 | 210996 | None | 0 | Human | Binding | IC50 | = | 1584.89 | 5.80 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170025 | 210997 | None | 0 | Human | Binding | IC50 | = | 250.00 | 6.60 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170025 | 210997 | None | 0 | Human | Binding | IC50 | = | 251.19 | 6.60 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170026 | 210998 | None | 0 | Human | Binding | IC50 | = | 13.00 | 7.89 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N(C)[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170026 | 210998 | None | 0 | Human | Binding | IC50 | = | 12.59 | 7.90 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N(C)[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170027 | 210999 | None | 0 | Human | Binding | IC50 | = | 740.00 | 6.13 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(=O)O)N(C)C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170027 | 210999 | None | 0 | Human | Binding | IC50 | = | 794.33 | 6.10 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(=O)O)N(C)C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170029 | 211001 | None | 0 | Human | Binding | IC50 | = | 140.00 | 6.85 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170029 | 211001 | None | 0 | Human | Binding | IC50 | = | 125.89 | 6.90 | - | 2 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170030 | 211002 | None | 9 | Human | Binding | IC50 | = | 5900.00 | 5.23 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170030 | 211002 | None | 9 | Human | Binding | IC50 | = | 6309.57 | 5.20 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170031 | 211003 | None | 0 | Human | Binding | IC50 | = | 6300.00 | 5.20 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170031 | 211003 | None | 0 | Human | Binding | IC50 | = | 6309.57 | 5.20 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170033 | 211004 | None | 0 | Human | Binding | IC50 | = | 27000.00 | 4.57 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 | |
CHEMBL1170033 | 211004 | None | 0 | Human | Binding | IC50 | = | 31622.78 | 4.50 | - | 1 | Displacement of [125I-C3a] from C3a receptor in human PBMC by scintillation counting | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm1003705 |
Showing 1 to 20 of 199 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |