Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL2391254 | 90703 | None | 0 | Human | Binding | EC50 | = | 14600.00 | 4.84 | - | 3 | Agonist activity at FPR3 (unknown origin) transfected in human HL60 cells assessed as induction of Ca2+ mobilization | ChEMBL | 427.1 | 6 | 1 | 5 | 3.24 | COc1cccc(Cc2ccnn(CC(=O)Nc3ccc(Br)cc3)c2=O)c1 | https://dx.doi.org/10.1016/j.ejmech.2013.03.066 | |
CHEMBL2391256 | 90705 | None | 0 | Human | Binding | EC50 | = | 17400.00 | 4.76 | - | 3 | Agonist activity at FPR3 (unknown origin) transfected in human HL60 cells assessed as induction of Ca2+ mobilization | ChEMBL | 469.1 | 7 | 1 | 5 | 4.37 | COc1cccc(Cc2cc(C(C)C)nn(CC(=O)Nc3ccc(Br)cc3)c2=O)c1 | https://dx.doi.org/10.1016/j.ejmech.2013.03.066 | |
CHEMBL2391437 | 90730 | None | 0 | Human | Binding | EC50 | = | 10200.00 | 4.99 | - | 3 | Agonist activity at FPR3 (unknown origin) transfected in human HL60 cells assessed as induction of Ca2+ mobilization | ChEMBL | 417.0 | 5 | 1 | 5 | 3.60 | Cc1cc(Cc2cccs2)c(=O)n(CC(=O)Nc2ccc(Br)cc2)n1 | https://dx.doi.org/10.1016/j.ejmech.2013.03.066 |
Showing 1 to 3 of 3 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
A77636 | 208 | None | 8 | Human | Functional | IC50 | = | 3055.44 | 5.51 | -1023 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: FPR3 | ChEMBL | 329.2 | 2 | 3 | 4 | 3.25 | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
annexin I-(2-26) | 425 | None | 0 | Human | Functional | pEC50 | None | - | 6.00 | 1 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15187149 | |
BX 471 | 758 | None | 42 | Human | Functional | IC50 | = | 3835.13 | 5.42 | -562 | 5 | GPCR PRESTO-Tango dose-response in antagonist mode with target: FPR3 | ChEMBL | 434.2 | 6 | 2 | 4 | 3.08 | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1NC(N)=O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
CHEMBL3727378 | 135364 | None | 0 | Human | Functional | EC50 | = | 2640.00 | 5.58 | -34 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 431.1 | 7 | 3 | 3 | 2.36 | NCCCNC(=O)[C@H]1[C@H](C(=O)NCc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727408 | 135366 | None | 0 | Human | Functional | EC50 | = | 214.00 | 6.67 | -125 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 442.2 | 8 | 2 | 4 | 3.49 | O=C(Nc1ccc(Cl)nc1)[C@@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)NCCCCN1CCCC1)C21CC1 | - | |
CHEMBL3727408 | 135366 | None | 0 | Human | Functional | EC50 | = | 891.00 | 6.05 | -125 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 442.2 | 8 | 2 | 4 | 3.49 | O=C(Nc1ccc(Cl)nc1)[C@@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)NCCCCN1CCCC1)C21CC1 | - | |
CHEMBL3727417 | 135368 | None | 0 | Human | Functional | EC50 | = | 2370.00 | 5.62 | -186 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 496.1 | 7 | 2 | 4 | 4.24 | Cc1cc(C)n(CCC(=O)NC[C@H]2[C@H](C(=O)Nc3ccc(Br)cc3)[C@@H]3C=C[C@H]2C32CC2)n1 | - | |
CHEMBL3727426 | 135369 | None | 0 | Human | Functional | EC50 | = | 1870.00 | 5.73 | -223 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 476.1 | 9 | 1 | 4 | 3.34 | COCCN(CCOC)C(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727426 | 135369 | None | 0 | Human | Functional | EC50 | = | 3950.00 | 5.40 | -223 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 476.1 | 9 | 1 | 4 | 3.34 | COCCN(CCOC)C(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727442 | 135374 | None | 0 | Human | Functional | EC50 | = | 11500.00 | 4.94 | -1698 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 399.1 | 4 | 2 | 3 | 2.86 | N#CCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727450 | 135377 | None | 0 | Human | Functional | EC50 | = | 91.00 | 7.04 | - | 1 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 502.3 | 11 | 2 | 4 | 4.28 | Cc1cc2ccccc2n1CCCNC(=O)[C@@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)NCCCCN1CCCC1)C21CC1 | - | |
CHEMBL3727453 | 135378 | None | 0 | Human | Functional | EC50 | = | 1170.00 | 5.93 | -4 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 445.1 | 7 | 2 | 3 | 2.57 | CN(C)CCNC(=O)[C@H]1[C@H](C(=O)NCc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727461 | 135379 | None | 0 | Human | Functional | EC50 | = | 1860.00 | 5.73 | -1 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 470.2 | 10 | 2 | 6 | 2.78 | CC(=O)c1ncc(CNC(=O)[C@@H]2[C@@H]3C=C[C@H]([C@H]2C(=O)NCCCCN2CCCC2)C32CC2)s1 | - | |
CHEMBL3727528 | 135390 | None | 0 | Human | Functional | EC50 | = | 1310.00 | 5.88 | -1 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 415.3 | 11 | 2 | 4 | 2.29 | CC(=O)CCCNC(=O)[C@@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)NCCCCN1CCCC1)C21CC1 | - | |
CHEMBL3727532 | 135392 | None | 0 | Human | Functional | EC50 | = | 359.00 | 6.45 | 23 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 463.3 | 10 | 2 | 4 | 3.33 | CC(=O)c1cccc(CNC(=O)[C@@H]2[C@@H]3C=C[C@H]([C@H]2C(=O)NCCCCN2CCCC2)C32CC2)c1 | - | |
CHEMBL3727544 | 135394 | None | 0 | Human | Functional | EC50 | = | 1080.00 | 5.97 | -83 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 440.1 | 5 | 2 | 3 | 4.13 | O=C(Nc1ccc(Br)cc1)[C@@H]1[C@@H]2C=C[C@H]([C@H]1C(=O)NCc1ccoc1)C21CC1 | - | |
CHEMBL3727588 | 135395 | None | 0 | Human | Functional | EC50 | = | 355.00 | 6.45 | 1 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 428.2 | 8 | 2 | 5 | 3.21 | Cc1cnc(NC(=O)[C@@H]2[C@@H]3C=C[C@H]([C@H]2C(=O)NCCCCN2CCCC2)C32CC2)s1 | - | |
CHEMBL3727591 | 135396 | None | 0 | Human | Functional | EC50 | = | 7210.00 | 5.14 | -46 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 446.1 | 7 | 1 | 3 | 3.71 | COCCC(=O)N(C)C[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - | |
CHEMBL3727601 | 135398 | None | 0 | Human | Functional | EC50 | = | 1300.00 | 5.89 | -2570 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 440.1 | 7 | 3 | 5 | 2.75 | NCCCCNC(=O)[C@H]1[C@H](C(=O)Nc2ncc(Br)s2)[C@@H]2CC[C@H]1C21CC1 | - | |
CHEMBL3727613 | 135399 | None | 0 | Human | Functional | EC50 | = | 571.00 | 6.24 | -3630 | 2 | Agonist activity at human recombinant FPRL2 receptor expressed in HEK293 cells co-expressing G-protein Galpha16 assessed as effect on calcium response by Fluo-4-AM dye based FLIPR assay | ChEMBL | 445.1 | 8 | 3 | 3 | 3.46 | NCCCCCNC(=O)[C@H]1[C@H](C(=O)Nc2ccc(Br)cc2)[C@@H]2C=C[C@H]1C21CC1 | - |
Showing 1 to 20 of 432 entries