Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 4157793 | 47286 | None | 6 | Human | Functional | pIC50 | = | 5 | 5.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 417 | 5 | 2 | 8 | 2.7 | COc1ccc(C2=NN(c3nc(C(=O)O)cs3)C(O)(C(F)(F)F)C2)c(OC)c1 | nan | ||
| CHEMBL1543980 | 47286 | None | 6 | Human | Functional | pIC50 | = | 5 | 5.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 417 | 5 | 2 | 8 | 2.7 | COc1ccc(C2=NN(c3nc(C(=O)O)cs3)C(O)(C(F)(F)F)C2)c(OC)c1 | nan | ||
| 2368939 | 55515 | None | 6 | Human | Functional | pIC50 | = | 5 | 5.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 427 | 2 | 0 | 2 | 6.0 | CC(C)(C)c1ccc(-c2c[n+](-c3ccc(Br)cc3)c3n2CCCS3)cc1 | nan | ||
| CHEMBL1416660 | 55515 | None | 6 | Human | Functional | pIC50 | = | 5 | 5.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 427 | 2 | 0 | 2 | 6.0 | CC(C)(C)c1ccc(-c2c[n+](-c3ccc(Br)cc3)c3n2CCCS3)cc1 | nan | ||
| CHEMBL1620142 | 55515 | None | 6 | Human | Functional | pIC50 | = | 5 | 5.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 427 | 2 | 0 | 2 | 6.0 | CC(C)(C)c1ccc(-c2c[n+](-c3ccc(Br)cc3)c3n2CCCS3)cc1 | nan | ||
| 842058 | 28684 | None | 19 | Human | Functional | pIC50 | = | 6 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 343 | 4 | 0 | 4 | 3.0 | Cc1nn(C)c(C)c1CN(C)S(=O)(=O)c1ccc2ccccc2c1 | nan | ||
| CHEMBL1377607 | 28684 | None | 19 | Human | Functional | pIC50 | = | 6 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 343 | 4 | 0 | 4 | 3.0 | Cc1nn(C)c(C)c1CN(C)S(=O)(=O)c1ccc2ccccc2c1 | nan | ||
| 3006170 | 59567 | None | 5 | Human | Functional | pIC50 | = | 6 | 6.0 | -2 | 3 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 325 | 3 | 5 | 9 | -1.7 | NC(=S)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 | nan | ||
| CHEMBL171699 | 59567 | None | 5 | Human | Functional | pIC50 | = | 6 | 6.0 | -2 | 3 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 325 | 3 | 5 | 9 | -1.7 | NC(=S)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c2ncnc(N)c12 | nan | ||
| 2323706 | 39147 | None | 3 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 314 | 8 | 1 | 4 | 3.5 | CC(C)CCOc1cccc(OCC(=O)Nc2ccncc2)c1 | nan | ||
| CHEMBL1469379 | 39147 | None | 3 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 314 | 8 | 1 | 4 | 3.5 | CC(C)CCOc1cccc(OCC(=O)Nc2ccncc2)c1 | nan | ||
| 53385430 | 88798 | None | 0 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 396 | 5 | 0 | 4 | 4.2 | Fc1ccc(CN2CCN(c3ncc(Cc4ccccc4)cn3)CC2)c(Cl)c1 | nan | ||
| CHEMBL2362703 | 88798 | None | 0 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 396 | 5 | 0 | 4 | 4.2 | Fc1ccc(CN2CCN(c3ncc(Cc4ccccc4)cn3)CC2)c(Cl)c1 | nan | ||
| 4544702 | 47535 | None | 1 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 448 | 6 | 1 | 5 | 5.9 | O=C(Nc1nc(-c2ccc(Cl)cc2Cl)cs1)c1ccc(OCC2CCCO2)cc1 | nan | ||
| CHEMBL1545848 | 47535 | None | 1 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 448 | 6 | 1 | 5 | 5.9 | O=C(Nc1nc(-c2ccc(Cl)cc2Cl)cs1)c1ccc(OCC2CCCO2)cc1 | nan | ||
| 3932658 | 59425 | None | 4 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 396 | 5 | 1 | 7 | 1.3 | NC(=O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2)c([N+](=O)[O-])c1 | nan | ||
| CHEMBL1709973 | 59425 | None | 4 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 396 | 5 | 1 | 7 | 1.3 | NC(=O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2)c([N+](=O)[O-])c1 | nan | ||
| 44825951 | 67595 | None | 0 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 376 | 13 | 1 | 4 | 4.6 | CCCCC[C@@H](/C=C/C1C(=O)C=C[C@H]1C/C=C\CCCC(=O)O)OC(C)=O | nan | ||
| CHEMBL1899895 | 67595 | None | 0 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 376 | 13 | 1 | 4 | 4.6 | CCCCC[C@@H](/C=C/C1C(=O)C=C[C@H]1C/C=C\CCCC(=O)O)OC(C)=O | nan | ||
| 729558 | 200154 | None | 6 | Human | Functional | pIC50 | = | 6.0 | 6.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 233 | 3 | 0 | 6 | 1.1 | CCOc1nc(C#N)nc(N2CCCCC2)n1 | nan | ||
| CHEMBL571295 | 200154 | None | 6 | Human | Functional | pIC50 | = | 6.0 | 6.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 233 | 3 | 0 | 6 | 1.1 | CCOc1nc(C#N)nc(N2CCCCC2)n1 | nan | ||
| 10662 | 127585 | None | 20 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 398 | 3 | 2 | 4 | 3.7 | O=C(C(=O)c1cc(Br)ccc1O)c1cc(Br)ccc1O | nan | ||
| CHEMBL366205 | 127585 | None | 20 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 398 | 3 | 2 | 4 | 3.7 | O=C(C(=O)c1cc(Br)ccc1O)c1cc(Br)ccc1O | nan | ||
| 1155337 | 42216 | None | 2 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 490 | 8 | 0 | 8 | 4.8 | O=C(CSc1nnc(Cn2nnc3ccccc32)o1)N(Cc1ccc(Cl)cc1)c1ccccc1 | nan | ||
| CHEMBL1497024 | 42216 | None | 2 | Human | Functional | pIC50 | = | 6.0 | 6.0 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 490 | 8 | 0 | 8 | 4.8 | O=C(CSc1nnc(Cn2nnc3ccccc32)o1)N(Cc1ccc(Cl)cc1)c1ccccc1 | nan | ||
| 648690 | 31513 | None | 3 | Human | Functional | pIC50 | = | 6.0 | 6.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 354 | 4 | 1 | 4 | 2.8 | Cn1nc(C(C)(C)C)cc1C(=O)NCc1ccc(N2CCCC2=O)cc1 | nan | ||
| CHEMBL1403484 | 31513 | None | 3 | Human | Functional | pIC50 | = | 6.0 | 6.0 | 1 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 354 | 4 | 1 | 4 | 2.8 | Cn1nc(C(C)(C)C)cc1C(=O)NCc1ccc(N2CCCC2=O)cc1 | nan | ||
| 24791438 | 60018 | None | 5 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 399 | 6 | 0 | 5 | 3.8 | CSc1ccc(C(=O)C2CCCN(C(=O)CCc3c(C)nn(C)c3C)C2)cc1 | nan | ||
| CHEMBL1734666 | 60018 | None | 5 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 399 | 6 | 0 | 5 | 3.8 | CSc1ccc(C(=O)C2CCCN(C(=O)CCc3c(C)nn(C)c3C)C2)cc1 | nan | ||
| 1952659 | 40468 | None | 8 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 379 | 5 | 1 | 7 | 3.9 | O=C(CSc1nnc(-c2cccnc2)s1)Nc1ccnc2ccccc12 | nan | ||
| CHEMBL1482468 | 40468 | None | 8 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 379 | 5 | 1 | 7 | 3.9 | O=C(CSc1nnc(-c2cccnc2)s1)Nc1ccnc2ccccc12 | nan | ||
| 16235315 | 28126 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 422 | 6 | 1 | 4 | 3.5 | CC(CC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1ccccc1 | nan | ||
| CHEMBL1373162 | 28126 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 422 | 6 | 1 | 4 | 3.5 | CC(CC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)c1ccccc1 | nan | ||
| 992688 | 34988 | None | 9 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 10 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 372 | 7 | 0 | 8 | 3.3 | COc1cc(CSc2nnnn2-c2ccc(C)cc2)cc(OC)c1OC | nan | ||
| CHEMBL1432721 | 34988 | None | 9 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 10 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 372 | 7 | 0 | 8 | 3.3 | COc1cc(CSc2nnnn2-c2ccc(C)cc2)cc(OC)c1OC | nan | ||
| 6906133 | 108339 | None | 2 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 404 | 9 | 1 | 5 | 4.0 | COc1ccc(/C=N/OCC(=O)NC(c2ccccc2)c2ccccc2)cc1OC | nan | ||
| CHEMBL3197447 | 108339 | None | 2 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 404 | 9 | 1 | 5 | 4.0 | COc1ccc(/C=N/OCC(=O)NC(c2ccccc2)c2ccccc2)cc1OC | nan | ||
| 4969272 | 36632 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 431 | 5 | 1 | 4 | 5.4 | CC(=O)c1ccc(N2CCN(C(S)=Nc3ccc(Oc4ccccc4)cc3)CC2)cc1 | nan | ||
| CHEMBL1448690 | 36632 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 431 | 5 | 1 | 4 | 5.4 | CC(=O)c1ccc(N2CCN(C(S)=Nc3ccc(Oc4ccccc4)cc3)CC2)cc1 | nan | ||
| 647700 | 47692 | None | 6 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 12 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 474 | 8 | 0 | 8 | 4.3 | O=C(CSc1nnc(Cn2nnc3ccccc32)o1)N(Cc1ccc(F)cc1)c1ccccc1 | nan | ||
| CHEMBL1547232 | 47692 | None | 6 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 12 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 474 | 8 | 0 | 8 | 4.3 | O=C(CSc1nnc(Cn2nnc3ccccc32)o1)N(Cc1ccc(F)cc1)c1ccccc1 | nan | ||
| 2405889 | 48843 | None | 2 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 327 | 6 | 1 | 3 | 4.5 | CC(=O)c1c(C)[nH]c(C(=O)COc2cc(C)ccc2C(C)C)c1C | nan | ||
| CHEMBL1559053 | 48843 | None | 2 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 327 | 6 | 1 | 3 | 4.5 | CC(=O)c1c(C)[nH]c(C(=O)COc2cc(C)ccc2C(C)C)c1C | nan | ||
| 135521496 | 88727 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 523 | 6 | 3 | 13 | 1.8 | Nc1nonc1-n1nnc(C(=O)N/N=C/c2cc(Br)ccc2O)c1CSC1=NCCS1 | nan | ||
| CHEMBL2359911 | 88727 | None | 3 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 523 | 6 | 3 | 13 | 1.8 | Nc1nonc1-n1nnc(C(=O)N/N=C/c2cc(Br)ccc2O)c1CSC1=NCCS1 | nan | ||
| 24790899 | 53450 | None | 1 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 367 | 8 | 0 | 5 | 4.1 | C=CCC1(CC=C)CCCN1C(=O)c1cc(COc2ccc(C)nc2)on1 | nan | ||
| CHEMBL1600776 | 53450 | None | 1 | Human | Functional | pIC50 | = | 5.9 | 5.9 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 367 | 8 | 0 | 5 | 4.1 | C=CCC1(CC=C)CCCN1C(=O)c1cc(COc2ccc(C)nc2)on1 | nan | ||
| 616573 | 4600 | None | 20 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 2 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 235 | 3 | 1 | 3 | 3.2 | c1ccc(CNc2ncnc3ccccc23)cc1 | nan | ||
| CHEMBL102726 | 4600 | None | 20 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 2 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 235 | 3 | 1 | 3 | 3.2 | c1ccc(CNc2ncnc3ccccc23)cc1 | nan | ||
| CHEMBL1444764 | 4600 | None | 20 | Human | Functional | pIC50 | = | 5.9 | 5.9 | 2 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) |
ChEMBL | 235 | 3 | 1 | 3 | 3.2 | c1ccc(CNc2ncnc3ccccc23)cc1 | nan | ||
Showing 1 to 50 of 401 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| CHEMBL503473 | 216655 | None | 15 | Human | Binding | pKd | = | 7.8 | 7.8 | -478 | 3 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(N)=O | 10.1021/jm801088x | ||||
| 16132180 | 1724 | None | 20 | Human | Binding | pKd | = | 6.5 | 6.5 | -208 | 8 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 16133822 | 1724 | None | 20 | Human | Binding | pKd | = | 6.5 | 6.5 | -208 | 8 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 6087 | 1724 | None | 20 | Human | Binding | pKd | = | 6.5 | 6.5 | -208 | 8 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| CHEMBL499980 | 1724 | None | 20 | Human | Binding | pKd | = | 6.5 | 6.5 | -208 | 8 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| CHEMBL526003 | 218159 | None | 24 | Human | Binding | pKd | = | 7.4 | 7.4 | -416 | 3 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)C(N)=O | 10.1021/jm801088x | ||||
| 155817464 | 1499 | None | 0 | Human | Binding | pKd | = | 7.2 | 7.2 | -173 | 4 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 3866 | 1499 | None | 0 | Human | Binding | pKd | = | 7.2 | 7.2 | -173 | 4 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 44587986 | 1499 | None | 0 | Human | Binding | pKd | = | 7.2 | 7.2 | -173 | 4 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 91934870 | 1499 | None | 0 | Human | Binding | pKd | = | 7.2 | 7.2 | -173 | 4 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| CHEMBL499179 | 1499 | None | 0 | Human | Binding | pKd | = | 7.2 | 7.2 | -173 | 4 | Binding affinity to human GalR3Binding affinity to human GalR3 |
ChEMBL | None | None | None | None | 10.1021/jm801088x | ||||
| 44414120 | 79886 | None | 0 | Human | Binding | pKi | = | 6 | 6.0 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 481 | 8 | 0 | 4 | 6.2 | CCN(CC)CCOc1ccccc1N1C(=O)/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc21 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL212224 | 79886 | None | 0 | Human | Binding | pKi | = | 6 | 6.0 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 481 | 8 | 0 | 4 | 6.2 | CCN(CC)CCOc1ccccc1N1C(=O)/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc21 | 10.1016/j.bmcl.2006.05.025 | ||
| 11677898 | 139343 | None | 0 | Human | Binding | pKi | = | 7.8 | 7.8 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)CC(O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL378991 | 139343 | None | 0 | Human | Binding | pKi | = | 7.8 | 7.8 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)CC(O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 3561805 | 80015 | None | 12 | Human | Binding | pKi | = | 6.8 | 6.8 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 330 | 3 | 0 | 2 | 4.6 | C=CCN1C(=O)/C(=N/c2ccc(Cl)c(Cl)c2)c2ccccc21 | 10.1021/jm060001n | ||
| CHEMBL212729 | 80015 | None | 12 | Human | Binding | pKi | = | 6.8 | 6.8 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 330 | 3 | 0 | 2 | 4.6 | C=CCN1C(=O)/C(=N/c2ccc(Cl)c(Cl)c2)c2ccccc21 | 10.1021/jm060001n | ||
| 1471834 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1021/jm060001n | ||
| 6126 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1021/jm060001n | ||
| CHEMBL210288 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1021/jm060001n | ||
| 1471834 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| 6126 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL210288 | 3629 | None | 40 | Human | Binding | pKi | = | 7.8 | 7.8 | 4 | 3 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 366 | 2 | 0 | 2 | 5.5 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1ccccc1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414299 | 139312 | None | 0 | Human | Binding | pKi | = | 7.7 | 7.7 | 19 | 2 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 495 | 9 | 0 | 4 | 6.6 | CCN(CC)CCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL378825 | 139312 | None | 0 | Human | Binding | pKi | = | 7.7 | 7.7 | 19 | 2 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 495 | 9 | 0 | 4 | 6.6 | CCN(CC)CCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414138 | 79555 | None | 0 | Human | Binding | pKi | = | 7.6 | 7.6 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 453 | 6 | 0 | 4 | 5.4 | CN(C)CCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL211398 | 79555 | None | 0 | Human | Binding | pKi | = | 7.6 | 7.6 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 453 | 6 | 0 | 4 | 5.4 | CN(C)CCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414234 | 77982 | None | 0 | Human | Binding | pKi | = | 7.6 | 7.6 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)C[C@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL209642 | 77982 | None | 0 | Human | Binding | pKi | = | 7.6 | 7.6 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)C[C@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414075 | 138557 | None | 0 | Human | Binding | pKi | = | 7.5 | 7.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 467 | 7 | 0 | 4 | 5.8 | CN(C)CCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL377468 | 138557 | None | 0 | Human | Binding | pKi | = | 7.5 | 7.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 467 | 7 | 0 | 4 | 5.8 | CN(C)CCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414225 | 79698 | None | 0 | Human | Binding | pKi | = | 6.5 | 6.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)C[C@@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL211522 | 79698 | None | 0 | Human | Binding | pKi | = | 6.5 | 6.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 511 | 9 | 1 | 5 | 5.6 | CCN(CC)C[C@@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 11540517 | 80292 | None | 0 | Human | Binding | pKi | = | 7.5 | 7.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 495 | 9 | 0 | 4 | 6.6 | CCN(CC)CCCOc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL213893 | 80292 | None | 0 | Human | Binding | pKi | = | 7.5 | 7.5 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 495 | 9 | 0 | 4 | 6.6 | CCN(CC)CCCOc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414235 | 141482 | None | 0 | Human | Binding | pKi | = | 7.4 | 7.4 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 467 | 7 | 0 | 4 | 6.2 | CCN(CC)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL383941 | 141482 | None | 0 | Human | Binding | pKi | = | 7.4 | 7.4 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 467 | 7 | 0 | 4 | 6.2 | CCN(CC)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 135559217 | 139323 | None | 1 | Human | Binding | pKi | = | 6.4 | 6.4 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 290 | 1 | 1 | 2 | 4.1 | O=C1Nc2ccccc2/C1=N\c1cccc(Cl)c1Cl | 10.1021/jm060001n | ||
| CHEMBL378877 | 139323 | None | 1 | Human | Binding | pKi | = | 6.4 | 6.4 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 290 | 1 | 1 | 2 | 4.1 | O=C1Nc2ccccc2/C1=N\c1cccc(Cl)c1Cl | 10.1021/jm060001n | ||
| 44414058 | 77952 | None | 0 | Human | Binding | pKi | = | 7.4 | 7.4 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 509 | 10 | 0 | 4 | 7.0 | CCN(CC)CCCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL209476 | 77952 | None | 0 | Human | Binding | pKi | = | 7.4 | 7.4 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 509 | 10 | 0 | 4 | 7.0 | CCN(CC)CCCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 44414043 | 78405 | None | 0 | Human | Binding | pKi | = | 7.3 | 7.3 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 493 | 7 | 0 | 4 | 6.4 | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1c1cccc(OCCCN2CCCC2)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL211031 | 78405 | None | 0 | Human | Binding | pKi | = | 7.3 | 7.3 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 493 | 7 | 0 | 4 | 6.4 | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1c1cccc(OCCCN2CCCC2)c1 | 10.1016/j.bmcl.2006.05.025 | ||
| 11698643 | 3630 | None | 12 | Human | Binding | pKi | = | 8.3 | 8.3 | 15 | 4 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 479 | 6 | 0 | 4 | 6.0 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1cccc(c1)OCCN1CCCC1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| 6125 | 3630 | None | 12 | Human | Binding | pKi | = | 8.3 | 8.3 | 15 | 4 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 479 | 6 | 0 | 4 | 6.0 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1cccc(c1)OCCN1CCCC1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| CHEMBL209497 | 3630 | None | 12 | Human | Binding | pKi | = | 8.3 | 8.3 | 15 | 4 | Displacement of [125I]galanin from human galanin Gal3 receptorDisplacement of [125I]galanin from human galanin Gal3 receptor |
ChEMBL | 479 | 6 | 0 | 4 | 6.0 | O=C1C(=Nc2cccc(c2)C(F)(F)F)c2c(N1c1cccc(c1)OCCN1CCCC1)cccc2 | 10.1016/j.bmcl.2006.05.025 | ||
| 44412817 | 78489 | None | 0 | Human | Binding | pKi | = | 7.3 | 7.3 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 360 | 4 | 0 | 2 | 5.4 | CCC(CC)N1C(=O)/C(=N/c2ccc(C(F)(F)F)cc2)c2ccccc21 | 10.1021/jm060001n | ||
| CHEMBL211169 | 78489 | None | 0 | Human | Binding | pKi | = | 7.3 | 7.3 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 360 | 4 | 0 | 2 | 5.4 | CCC(CC)N1C(=O)/C(=N/c2ccc(C(F)(F)F)cc2)c2ccccc21 | 10.1021/jm060001n | ||
| 135411930 | 77955 | None | 11 | Human | Binding | pKi | = | 6.2 | 6.2 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 290 | 1 | 1 | 2 | 3.8 | O=C1Nc2ccccc2/C1=N\c1cccc(C(F)(F)F)c1 | 10.1021/jm060001n | ||
| CHEMBL209480 | 77955 | None | 11 | Human | Binding | pKi | = | 6.2 | 6.2 | - | 1 | Displacement of [125I]galanin from human GAL3Displacement of [125I]galanin from human GAL3 |
ChEMBL | 290 | 1 | 1 | 2 | 3.8 | O=C1Nc2ccccc2/C1=N\c1cccc(C(F)(F)F)c1 | 10.1021/jm060001n | ||
Showing 1 to 50 of 241 entries