Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(D-Thr6, D-Trp8,9)galanin(1-15)ol | 1494 | None | 0 | Rat | Binding | pKi | > | - | 6.00 | 1 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9405385 | |
[Ala6, D-Trp8]galanin-(1-15)-ol | 337 | None | 0 | Rat | Binding | pKi | = | - | 7.75 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9405385 | |
[D-Trp2]galanin-(1-29) | 1499 | None | 0 | Human | Binding | Kd | = | 69.00 | 7.16 | -173 | 4 | Binding affinity to human GalR3 | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm801088x | |
C7 | 777 | None | 0 | Human | Binding | pKi | = | - | 8.08 | -34 | 8 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9722565 | |
C7 | 777 | None | 0 | Human | Binding | pKi | = | - | 8.08 | -34 | 8 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9880084 | |
C7 | 777 | None | 0 | Rat | Binding | pKi | = | - | 8.73 | -7 | 8 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9722565 | |
C7 | 777 | None | 0 | Rat | Binding | pKi | = | - | 8.73 | -7 | 8 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9405385 | |
CHEMBL209476 | 77952 | None | 0 | Human | Binding | Ki | = | 45.00 | 7.35 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 509.2 | 10 | 0 | 4 | 7.00 | CCN(CC)CCCCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL209480 | 77955 | None | 11 | Human | Binding | Ki | = | 596.00 | 6.22 | - | 1 | Displacement of [125I]galanin from human GAL3 | ChEMBL | 290.1 | 1 | 1 | 2 | 3.78 | O=C1Nc2ccccc2/C1=N\c1cccc(C(F)(F)F)c1 | https://dx.doi.org/10.1021/jm060001n | |
CHEMBL209481 | 77956 | None | 0 | Human | Binding | Ki | = | 87.00 | 7.06 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 481.2 | 8 | 0 | 4 | 6.22 | CCN(CC)CCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL209498 | 77958 | None | 0 | Human | Binding | Ki | = | 8.00 | 8.10 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 493.2 | 6 | 0 | 4 | 6.37 | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1c1cccc(OCCN2CCCCC2)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL209642 | 77982 | None | 0 | Human | Binding | Ki | = | 27.00 | 7.57 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 511.2 | 9 | 1 | 5 | 5.59 | CCN(CC)C[C@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL209730 | 78030 | None | 0 | Human | Binding | Ki | = | 89.00 | 7.05 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 453.2 | 6 | 0 | 4 | 5.45 | CN(C)CCOc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL209737 | 78032 | None | 32 | Human | Binding | Ki | = | 850.00 | 6.07 | - | 1 | Displacement of [125I]galanin from human GAL3 | ChEMBL | 256.0 | 1 | 1 | 2 | 3.41 | O=C1Nc2ccccc2/C1=N\c1ccc(Cl)cc1 | https://dx.doi.org/10.1021/jm060001n | |
CHEMBL211031 | 78405 | None | 0 | Human | Binding | Ki | = | 49.00 | 7.31 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 493.2 | 7 | 0 | 4 | 6.37 | O=C1/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc2N1c1cccc(OCCCN2CCCC2)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL211169 | 78489 | None | 0 | Human | Binding | Ki | = | 52.00 | 7.28 | - | 1 | Displacement of [125I]galanin from human GAL3 | ChEMBL | 360.1 | 4 | 0 | 2 | 5.36 | CCC(CC)N1C(=O)/C(=N/c2ccc(C(F)(F)F)cc2)c2ccccc21 | https://dx.doi.org/10.1021/jm060001n | |
CHEMBL211398 | 79555 | None | 0 | Human | Binding | Ki | = | 26.00 | 7.58 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 453.2 | 6 | 0 | 4 | 5.45 | CN(C)CCOc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL211467 | 79639 | None | 0 | Human | Binding | Ki | = | 78.00 | 7.11 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 481.2 | 8 | 0 | 4 | 6.22 | CCN(CC)CCOc1ccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL211522 | 79698 | None | 0 | Human | Binding | Ki | = | 290.00 | 6.54 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 511.2 | 9 | 1 | 5 | 5.59 | CCN(CC)C[C@@H](O)COc1cccc(N2C(=O)/C(=N/c3cccc(C(F)(F)F)c3)c3ccccc32)c1 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 | |
CHEMBL212224 | 79886 | None | 0 | Human | Binding | Ki | = | 1000.00 | 6.00 | - | 1 | Displacement of [125I]galanin from human galanin Gal3 receptor | ChEMBL | 481.2 | 8 | 0 | 4 | 6.22 | CCN(CC)CCOc1ccccc1N1C(=O)/C(=N/c2cccc(C(F)(F)F)c2)c2ccccc21 | https://dx.doi.org/10.1016/j.bmcl.2006.05.025 |
Showing 1 to 20 of 117 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
acetylcholine | 255 | None | 24 | Human | Functional | IC50 | = | 617.81 | 6.21 | -22 | 12 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 146.1 | 3 | 0 | 2 | 0.26 | CC(=O)OCC[N+](C)(C)C | - | |
acetylcholine | 255 | None | 24 | Human | Functional | IC50 | = | 1658.00 | 5.78 | -22 | 12 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 146.1 | 3 | 0 | 2 | 0.26 | CC(=O)OCC[N+](C)(C)C | - | |
alarin | 327 | None | 0 | Rat | Functional | pIC50 | > | - | 6.00 | 1 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20880399 | |
CARBOXYAMIDOTRIAZOLE | 210141 | None | 50 | Human | Functional | IC50 | = | 303.14 | 6.52 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 423.0 | 5 | 2 | 6 | 3.20 | NC(=O)c1nnn(Cc2cc(Cl)c(C(=O)c3ccc(Cl)cc3)c(Cl)c2)c1N | - | |
CHEMBL102726 | 4600 | None | 20 | Human | Functional | IC50 | = | 2419.00 | 5.62 | 2 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 235.1 | 3 | 1 | 3 | 3.24 | c1ccc(CNc2ncnc3ccccc23)cc1 | - | |
CHEMBL102726 | 4600 | None | 20 | Human | Functional | IC50 | = | 1251.00 | 5.90 | 2 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 235.1 | 3 | 1 | 3 | 3.24 | c1ccc(CNc2ncnc3ccccc23)cc1 | - | |
CHEMBL1198353 | 14160 | None | 5 | Human | Functional | IC50 | = | 1948.00 | 5.71 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 220.2 | 8 | 1 | 2 | 3.72 | CCCCCCCCCn1ccc(=N)cc1 | - | |
CHEMBL1300302 | 19622 | None | 5 | Human | Functional | IC50 | = | 2026.00 | 5.69 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 528.2 | 11 | 1 | 6 | 3.88 | Cc1oc(-c2ccc(Cl)cc2)nc1C[S+]([O-])CC(=O)NCCCN1CCN(Cc2ccccc2)CC1 | - | |
CHEMBL1300327 | 19623 | None | 5 | Human | Functional | IC50 | = | 399.90 | 6.40 | 100 | 2 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 296.2 | 2 | 1 | 4 | 3.36 | COc1cccc2[nH]c3c(N4CCCC(C)C4)ncnc3c12 | - | |
CHEMBL1300536 | 19654 | None | 3 | Human | Functional | IC50 | = | 3742.00 | 5.43 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 310.1 | 4 | 1 | 3 | 4.85 | CNc1ccccc1C(C)(C)c1cc(-c2ccc(F)cc2)no1 | - | |
CHEMBL1301887 | 19824 | None | 4 | Human | Functional | IC50 | = | 2895.00 | 5.54 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 420.1 | 7 | 2 | 8 | 3.75 | Cc1cc(C(=O)CSc2nc(N)cc(O)n2)c(C)n1-c1ccc(OC(F)F)cc1 | - | |
CHEMBL1309273 | 20746 | None | 5 | Human | Functional | IC50 | = | 1451.00 | 5.84 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 414.0 | 6 | 2 | 6 | 3.87 | CCOC(=O)c1[nH]c2ccc(OC)cc2c1NS(=O)(=O)c1ccc(Cl)s1 | - | |
CHEMBL1319304 | 21802 | None | 9 | Human | Functional | IC50 | = | 147.93 | 6.83 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 478.2 | 7 | 1 | 7 | 2.57 | CCCCCn1c(=O)[nH]c2cc(C(=O)N3CCN(Cc4ccc5c(c4)OCO5)CC3)ccc2c1=O | - | |
CHEMBL1319737 | 21856 | None | 6 | Human | Functional | IC50 | = | 5361.00 | 5.27 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 377.2 | 7 | 3 | 4 | 2.83 | CCC(NCCC(c1ccccc1)c1ccccc1)=C1C(=O)NC(=O)NC1=O | - | |
CHEMBL1321513 | 22054 | None | 3 | Human | Functional | IC50 | = | 5943.00 | 5.23 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 460.1 | 10 | 0 | 7 | 4.50 | COCCn1c(SCCCC(=O)c2ccc(Br)cc2)nnc1-c1ccncc1 | - | |
CHEMBL1325226 | 22486 | None | 15 | Human | Functional | IC50 | = | 2267.00 | 5.64 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 298.1 | 6 | 1 | 3 | 4.64 | CCCOc1ccc(CSc2nc3ccccc3[nH]2)cc1 | - | |
CHEMBL1328481 | 22859 | None | 7 | Human | Functional | IC50 | = | 1810.00 | 5.74 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 244.1 | 2 | 0 | 6 | 0.94 | N#Cc1nc(N2CCCC2)nc(N2CCCC2)n1 | - | |
CHEMBL1337567 | 23984 | None | 3 | Human | Functional | IC50 | = | 3674.00 | 5.43 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 353.2 | 7 | 0 | 6 | 3.27 | COCCn1c(C)cc(C(=O)COc2nc3ccccc3nc2C)c1C | - | |
CHEMBL1340112 | 24270 | None | 9 | Human | Functional | IC50 | = | 157.61 | 6.80 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 297.0 | 3 | 1 | 3 | 2.96 | Cc1nn(C)c(C(=O)NCc2ccc(Cl)cc2)c1Cl | - | |
CHEMBL1344025 | 24729 | None | 1 | Human | Functional | IC50 | = | 2059.00 | 5.69 | - | 1 | PubChem BioAssay. Fluorescence-based cell-based primary high throughput dose response assay to identify antagonists of the Galanin Receptor 3 (GalR3). (Class of assay: confirmatory) | ChEMBL | 418.1 | 3 | 0 | 8 | 1.97 | O=S(=O)(c1ccc2c(c1)OCCO2)N1CCN(c2ncnc3sccc23)CC1 | - |
Showing 1 to 20 of 179 entries