Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 1327 | 496 | None | 0 | Human | Functional | pIC50 | None | 7.3 | 7.3 | -6 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 11705773 | ||||
| 13339 | 1207 | None | 7 | Human | Functional | pKB | = | 9.5 | 9.5 | -1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
| 146361282 | 1207 | None | 7 | Human | Functional | pKB | = | 9.5 | 9.5 | -1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
| CHEMBL5414447 | 1207 | None | 7 | Human | Functional | pKB | = | 9.5 | 9.5 | -1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
| 13339 | 1207 | None | 7 | Rat | Functional | pKB | = | 9.6 | 9.6 | 1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
| 146361282 | 1207 | None | 7 | Rat | Functional | pKB | = | 9.6 | 9.6 | 1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
| CHEMBL5414447 | 1207 | None | 7 | Rat | Functional | pKB | = | 9.6 | 9.6 | 1 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 613 | 8 | 1 | 6 | 5.1 | CCOC1=C(C=CC=C1)C2=CC=C(N3CCN(C[C@H]3CC)C(=O)C4(CCC4)C(F)(F)F)C(=N2)C(=O)N[C@@H]5CN6CCC5CC6 | 38628803 | ||
Showing 1 to 7 of 7 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 146361194 | 195888 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 644 | 8 | 1 | 7 | 5.4 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5412684 | 195888 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 644 | 8 | 1 | 7 | 5.4 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361194 | 195888 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 644 | 8 | 1 | 7 | 5.4 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5412684 | 195888 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 644 | 8 | 1 | 7 | 5.4 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361364 | 196958 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 630 | 8 | 2 | 7 | 5.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCNC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5435583 | 196958 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 630 | 8 | 2 | 7 | 5.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCNC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361364 | 196958 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 630 | 8 | 2 | 7 | 5.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCNC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5435583 | 196958 | None | 0 | Human | Binding | pKi | = | 9.5 | 9.5 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 630 | 8 | 2 | 7 | 5.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)N[C@@H]2CCNC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361184 | 196809 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 632 | 10 | 1 | 7 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5432648 | 196809 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 632 | 10 | 1 | 7 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361278 | 195987 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 642 | 8 | 1 | 7 | 5.3 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C34CCC(C(F)(F)F)(CC3)CC4)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5414709 | 195987 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 642 | 8 | 1 | 7 | 5.3 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C34CCC(C(F)(F)F)(CC3)CC4)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361184 | 196809 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 632 | 10 | 1 | 7 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5432648 | 196809 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 632 | 10 | 1 | 7 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361278 | 195987 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 642 | 8 | 1 | 7 | 5.3 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C34CCC(C(F)(F)F)(CC3)CC4)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5414709 | 195987 | None | 0 | Human | Binding | pKi | = | 9.4 | 9.4 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 642 | 8 | 1 | 7 | 5.3 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C34CCC(C(F)(F)F)(CC3)CC4)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361317 | 195981 | None | 0 | Human | Binding | pKi | = | 9.3 | 9.3 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 618 | 10 | 2 | 7 | 4.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5414552 | 195981 | None | 0 | Human | Binding | pKi | = | 9.3 | 9.3 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 618 | 10 | 2 | 7 | 4.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361317 | 195981 | None | 0 | Human | Binding | pKi | = | 9.3 | 9.3 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 618 | 10 | 2 | 7 | 4.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5414552 | 195981 | None | 0 | Human | Binding | pKi | = | 9.3 | 9.3 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 618 | 10 | 2 | 7 | 4.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361372 | 195079 | None | 0 | Human | Binding | pKi | = | 9.2 | 9.2 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 8 | 1 | 7 | 4.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5396357 | 195079 | None | 0 | Human | Binding | pKi | = | 9.2 | 9.2 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 8 | 1 | 7 | 4.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361372 | 195079 | None | 0 | Human | Binding | pKi | = | 9.2 | 9.2 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 8 | 1 | 7 | 4.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5396357 | 195079 | None | 0 | Human | Binding | pKi | = | 9.2 | 9.2 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 8 | 1 | 7 | 4.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361524 | 196119 | None | 0 | Human | Binding | pKi | = | 9.1 | 9.1 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 649 | 10 | 1 | 6 | 6.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1F | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5417272 | 196119 | None | 0 | Human | Binding | pKi | = | 9.1 | 9.1 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 649 | 10 | 1 | 6 | 6.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1F | 10.1021/acsmedchemlett.3c00514 | ||
| 146361526 | 196478 | None | 0 | Human | Binding | pKi | = | 9.0 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 617 | 10 | 2 | 6 | 5.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5424729 | 196478 | None | 0 | Human | Binding | pKi | = | 9.0 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 617 | 10 | 2 | 6 | 5.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361524 | 196119 | None | 0 | Human | Binding | pKi | = | 9 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 649 | 10 | 1 | 6 | 6.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1F | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5417272 | 196119 | None | 0 | Human | Binding | pKi | = | 9 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 649 | 10 | 1 | 6 | 6.0 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1F | 10.1021/acsmedchemlett.3c00514 | ||
| 146361526 | 196478 | None | 0 | Human | Binding | pKi | = | 9 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 617 | 10 | 2 | 6 | 5.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5424729 | 196478 | None | 0 | Human | Binding | pKi | = | 9 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 617 | 10 | 2 | 6 | 5.5 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCNC)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361312 | 194974 | None | 0 | Human | Binding | pKi | = | 9.0 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 603 | 9 | 2 | 6 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5394322 | 194974 | None | 0 | Human | Binding | pKi | = | 9.0 | 9.0 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 603 | 9 | 2 | 6 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361312 | 194974 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 603 | 9 | 2 | 6 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5394322 | 194974 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 603 | 9 | 2 | 6 | 5.2 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361710 | 195578 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 587 | 8 | 1 | 6 | 4.7 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5406402 | 195578 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 587 | 8 | 1 | 6 | 4.7 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361710 | 195578 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 587 | 8 | 1 | 6 | 4.7 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5406402 | 195578 | None | 0 | Human | Binding | pKi | = | 8.9 | 8.9 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 587 | 8 | 1 | 6 | 4.7 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)N[C@@H]2CCN(C)C2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361256 | 196050 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 631 | 10 | 1 | 6 | 5.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5415832 | 196050 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 631 | 10 | 1 | 6 | 5.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361487 | 195337 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 9 | 2 | 5 | 5.9 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5401503 | 195337 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 9 | 2 | 5 | 5.9 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361256 | 196050 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 631 | 10 | 1 | 6 | 5.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5415832 | 196050 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 631 | 10 | 1 | 6 | 5.9 | CCOc1ncccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN(C)C)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| 172470186 | 197101 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 601 | 8 | 1 | 6 | 5.1 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)NC2CCN(C)CC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5438739 | 197101 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 601 | 8 | 1 | 6 | 5.1 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)C3(C(F)(F)F)CCC3)C[C@H]2CC)c(C(=O)NC2CCN(C)CC2)n1 | 10.1021/acsmedchemlett.3c00514 | ||
| 146361487 | 195337 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 9 | 2 | 5 | 5.9 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
| CHEMBL5401503 | 195337 | None | 0 | Human | Binding | pKi | = | 8.8 | 8.8 | - | 1 | Displacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting methodDisplacement of [[125I]-Tyr23]-ACTH (1-39) from human MC2R incubated for 1.5 hrs by Topcount scintillation counting method |
ChEMBL | 602 | 9 | 2 | 5 | 5.9 | CCOc1ccccc1-c1ccc(N2CCN(C(=O)c3ccc(Cl)cc3C(F)(F)F)C[C@H]2CC)c(C(=O)NCCN)c1 | 10.1021/acsmedchemlett.3c00514 | ||
Showing 1 to 50 of 134 entries