Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
1DMe | 32 | None | 0 | Human | Binding | pKi | None | - | 8.55 | -3 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/11024015 | |
1DMe | 32 | None | 0 | Human | Binding | pKi | None | - | 8.55 | -3 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/17011599 | |
1DMe | 32 | None | 0 | Human | Binding | pKi | None | - | 8.55 | -3 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12421602 | |
AC262620 | 237 | None | 0 | Human | Binding | pKi | = | - | 7.90 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20354177 | |
AC262970 | 238 | None | 0 | Human | Binding | pKi | = | - | 7.75 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20354177 | |
BIBP3226 | 631 | None | 27 | Human | Binding | pKi | None | - | 7.40 | -4 | 4 | Unclassified | Guide to Pharmacology | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://pubmed.ncbi.nlm.nih.gov/11024015 | |
BIBP3226 | 631 | None | 27 | Human | Binding | pKi | None | - | 7.40 | -4 | 4 | Unclassified | Guide to Pharmacology | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://pubmed.ncbi.nlm.nih.gov/12242085 | |
BIBP3226 | 631 | None | 27 | Human | Binding | pKi | None | - | 7.40 | -4 | 4 | Unclassified | Guide to Pharmacology | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://pubmed.ncbi.nlm.nih.gov/12421602 | |
BIBP3226 | 631 | None | 27 | Human | Binding | Ki | = | 18.00 | 7.75 | -4 | 4 | Displacement of [3H]NPVF from human NPFF1 expressed in CHO cells by radioligand binding assay | ChEMBL | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.5b00925 | |
BIBP3226 | 631 | None | 27 | Human | Binding | Ki | = | 12.00 | 7.92 | -4 | 4 | Binding affinity to human NPFF1 receptor expressed in CHO cells | ChEMBL | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.5b00925 | |
CHEMBL1672379 | 211289 | None | 0 | Human | Binding | IC50 | = | 1.90 | 8.72 | - | 2 | Displacement of (D-[125I]Tyr1, MePhe3)-NPFF from NPFFR1 after 2 hrs | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/ml1002053 | |
CHEMBL2165920 | 211792 | None | 25 | Human | Binding | Ki | = | 3.66 | 8.44 | 10 | 2 | Displacement of [3H]NPVF from human NPFF1 receptor expressed in CHO cells after 1 hr by liquid scintillation counting analysis | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm500989n | |
CHEMBL2165920 | 211792 | None | 25 | Human | Binding | Ki | = | 1.30 | 8.89 | 10 | 2 | Displacement of [125I]YVP from human NPFFR1 expressed in HEK293 cells by radioligand binding assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acs.jmedchem.0c00643 | |
CHEMBL2165920 | 211792 | None | 25 | Human | Binding | Ki | = | 0.59 | 9.23 | 10 | 2 | Displacement of [125I]YVP from human NPFFR1 expressed in CHO cells by gamma-counter method | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acs.jmedchem.0c00643 | |
CHEMBL2165920 | 211792 | None | 25 | Human | Binding | Ki | = | 0.01 | 11.00 | 10 | 2 | Displacement of [125I]-1DMeNPFF from recombinant human NPFF1 receptor expressed in CHO cells by TopCount scintillation counting method | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acs.jmedchem.1c00256 | |
CHEMBL2204019 | 83575 | None | 0 | Human | Binding | Ki | = | 198.00 | 6.70 | 10 | 2 | Displacement of [3H]FFRF-NH2 from human flag-tagged NPFF1 receptor expressed in CHO cells by scintillation counting | ChEMBL | 424.2 | 11 | 6 | 4 | 0.26 | N=C(N)NCCC[C@@H](NC(=O)c1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2012.10.049 | |
CHEMBL2208294 | 84178 | None | 0 | Human | Binding | Ki | = | 87.00 | 7.06 | 1 | 2 | Displacement of [3H]FFRF-NH2 from human flag-tagged NPFF1 receptor expressed in CHO cells by scintillation counting | ChEMBL | 474.2 | 11 | 6 | 4 | 1.41 | N=C(N)NCCC[C@H](NC(=O)c1cccc2ccccc12)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2012.10.049 | |
CHEMBL2208296 | 84179 | None | 0 | Human | Binding | Ki | = | 378.00 | 6.42 | -2 | 2 | Displacement of [3H]FFRF-NH2 from human flag-tagged NPFF1 receptor expressed in CHO cells by scintillation counting | ChEMBL | 463.2 | 11 | 7 | 4 | 0.74 | N=C(N)NCCC[C@H](NC(=O)c1ccc2cc[nH]c2c1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2012.10.049 | |
CHEMBL2208299 | 84180 | None | 0 | Human | Binding | Ki | = | 15.00 | 7.82 | 15 | 2 | Displacement of [3H]FFRF-NH2 from human flag-tagged NPFF1 receptor expressed in CHO cells by scintillation counting | ChEMBL | 514.3 | 13 | 6 | 4 | 1.78 | N=C(N)NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2012.10.049 | |
CHEMBL2208301 | 84181 | None | 0 | Human | Binding | Ki | = | 0.90 | 9.05 | - | 1 | Displacement of [3H]FFRF-NH2 from human flag-tagged NPFF1 receptor expressed in CHO cells by scintillation counting | ChEMBL | 573.3 | 13 | 6 | 6 | 2.64 | N=C(N)NCCC[C@H](NC(=O)CCN1c2ccccc2Sc2ccccc21)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1016/j.bmcl.2012.10.049 |
Showing 1 to 20 of 144 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
BIBP3226 | 631 | None | 27 | Human | Functional | Kd | = | 20.89 | 7.68 | - | 4 | Competitive antagonist activity at human NPFF1 receptor expressed in COS1 cells assessed as inhibition of NPVF-induced [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | 473.2 | 11 | 5 | 4 | 2.38 | NC(N)=NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)NCc1ccc(O)cc1 | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 16.00 | 7.80 | -21 | 2 | Agonist activity at human NPFF1 receptor F/Y7.35A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 30.00 | 7.52 | -21 | 2 | Agonist activity at human NPFF1R expressed in HEK293 cells by dynamic mass redistribution assay | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acs.jmedchem.1c00256 | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 4.90 | 8.31 | -21 | 2 | Agonist activity at human NPFF1 receptor Y7.33A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 7.70 | 8.11 | -21 | 2 | Agonist activity at human NPFF1 receptor H/Q6.69A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 99.00 | 7.00 | -21 | 2 | Agonist activity at human NPFF1 receptor D6.59A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 9.90 | 8.00 | -21 | 2 | Agonist activity at human NPFF1 receptor F5.34A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 314.00 | 6.50 | -21 | 2 | Agonist activity at human NPFF1 receptor Y5.38A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 7876.00 | 5.10 | -21 | 2 | Agonist activity at human NPFF1 receptor E5.27A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 1.70 | 8.77 | -21 | 2 | Agonist activity at human NPFF1 receptor expressed in COS1 cells assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165920 | 211792 | None | 25 | Human | Functional | EC50 | = | 50.00 | 7.30 | -21 | 2 | Agonist activity at human NPFF1 receptor expressed in HEK293 cells assessed as reduction in forskolin- stimulated cAMP level | ChEMBL | - | - | - | - | - | CC(C)C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/acs.jmedchem.1c00256 | |
CHEMBL2165921 | 82140 | None | 0 | Human | Functional | EC50 | = | 4608.00 | 5.34 | -3 | 2 | Agonist activity at human NPFF1 receptor Y7.33A mutant assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | 374.0 | 3 | 3 | 3 | 3.54 | N=C(N)N/N=C/c1ccc(-c2ccc(Br)cc2C(F)(F)F)o1 | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165921 | 82140 | None | 0 | Human | Functional | EC50 | = | 5624.00 | 5.25 | -3 | 2 | Agonist activity at human NPFF1 receptor expressed in COS1 cells assessed as [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | 374.0 | 3 | 3 | 3 | 3.54 | N=C(N)N/N=C/c1ccc(-c2ccc(Br)cc2C(F)(F)F)o1 | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL2165922 | 82141 | None | 0 | Human | Functional | Kd | = | 41.69 | 7.38 | - | 2 | Competitive antagonist activity at human NPFF1 receptor expressed in COS1 cells assessed as inhibition of NPVF-induced [3H]inositol phosphate accumulation after 2 hrs by liquid scintillation counting | ChEMBL | 220.2 | 2 | 3 | 2 | 1.67 | N=C(N)N/N=C/C12CC3CC(CC(C3)C1)C2 | https://dx.doi.org/10.1021/jm300535s | |
CHEMBL3360829 | 116504 | None | 0 | Human | Functional | EC50 | = | 4700.00 | 5.33 | - | 2 | Antagonist activity at human NPFF1 receptor expressed in CHO cells assessed as inhibition of forskolin-induced intracellular cAMP accumulation relative to control | ChEMBL | 481.3 | 11 | 5 | 4 | 2.27 | CC(=N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc1ccccc1)C(N)=O | https://dx.doi.org/10.1021/jm500989n | |
CHEMBL3361416 | 116561 | None | 0 | Human | Functional | EC50 | = | 21980.00 | 4.66 | - | 3 | Antagonist activity at human NPFF1 receptor expressed in CHO cells assessed as reversal of NPVF-induced inhibition of intracellular cAMP accumulation after 10 mins by liquid scintillation counting analysis relative to control | ChEMBL | 394.2 | 8 | 5 | 4 | 1.73 | N=C(N)NCC(=O)NCC1(Nc2ccccc2)CCN(Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm500989n | |
CHEMBL3361433 | 116578 | None | 0 | Human | Functional | EC50 | = | 2600.00 | 5.58 | -4 | 4 | Antagonist activity at human NPFF1 receptor expressed in CHO cells assessed as reversal of NPVF-induced inhibition of intracellular cAMP accumulation after 10 mins by liquid scintillation counting analysis relative to control | ChEMBL | 443.3 | 8 | 4 | 3 | 3.26 | N=C(N)NCC(=O)NCC1(Cc2cccc3ccccc23)CCN(Cc2ccccc2)CC1 | https://dx.doi.org/10.1021/jm500989n | |
CHEMBL3422516 | 118951 | None | 0 | Human | Functional | EC50 | = | 222.00 | 6.65 | -141 | 2 | Agonist activity at human NPFF1R expressed in CHO cells assessed as effect on forskolin-induced cAMP accumulation after 15 mins by luminescence based assay | ChEMBL | 1765.0 | 61 | 21 | 21 | 2.98 | CCCCCCCCCCCCCCCC(=O)N[C@@H](CCC(=O)NCCCC[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCc1cn([C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(N)=O)nn1)C(=O)O | https://dx.doi.org/10.1021/jm5019675 | |
CHEMBL4442534 | 170122 | None | 0 | Human | Functional | IC50 | = | 190.00 | 6.72 | 1 | 3 | Antagonist activity at NPFF1 receptor (unknown origin) expressed in HEK293A cells assessed as reversal of NPPF induced inhibition of forskolin-stimulated cAMP accumulation measured after 30 mins | ChEMBL | 1164.6 | 30 | 12 | 11 | 2.66 | N=C(N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(N)=O | https://dx.doi.org/10.1016/j.bmc.2019.01.003 | |
CHEMBL4449491 | 170612 | None | 0 | Human | Functional | IC50 | = | 520.00 | 6.28 | -2 | 4 | Antagonist activity at NPFF1 receptor (unknown origin) expressed in HEK293A cells assessed as reversal of NPPF induced inhibition of forskolin-stimulated cAMP accumulation measured after 30 mins | ChEMBL | 1164.6 | 30 | 12 | 11 | 2.66 | N=C(N)NCCC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(N)=O | https://dx.doi.org/10.1016/j.bmc.2019.01.003 |
Showing 1 to 20 of 97 entries