Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[D-Trp32]NPY | 1500 | None | 0 | Human | Binding | pKi | None | - | 6.80 | -25 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/8632753 | |
[D-Trp32]NPY | 1500 | None | 0 | Rat | Binding | pKi | None | - | 7.30 | -7 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/11408607 | |
[Leu31,Pro34]NPY | 2302 | None | 0 | Human | Binding | pKi | None | - | 6.20 | -25118 | 6 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7592910 | |
[Leu31,Pro34]NPY (pig) | 2303 | None | 0 | Human | Binding | pKi | None | - | 6.10 | -1000 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/8632753 | |
[Leu31,Pro34]PYY (human) | 2304 | None | 0 | Human | Binding | pKi | None | - | 6.20 | -9999 | 6 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/8632753 | |
[Leu31,Pro34]PYY (pig) | 2305 | None | 0 | Human | Binding | IC50 | = | 261.00 | 6.58 | - | 5 | Affinity against Neuropeptide Y receptor Y2 in SK-N-BE2 cell line | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm000052z | |
[Leu31,Pro34]PYY (pig) | 2305 | None | 0 | Rat | Binding | IC50 | = | 54.00 | 7.27 | - | 5 | Antisecretory potency, affinity for intestinal PYY of rat jejunum by using short circuit current (SCC) method. | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm000052z | |
[Pro34]PYY (human) | 3191 | None | 0 | Human | Binding | pKi | None | - | 6.30 | -1584 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/8632753 | |
ABT-594 | 219818 | 125I-Peptide YY | 0 | Human | Binding | pKi | = | 1000.00 | 6.00 | -2 | 37 | - | PDSP KiDatabase | 198.1 | 3 | 1 | 3 | 1.48 | Clc1ccc(OCC2CCN2)cn1 | - | |
BIIE0246 | 218722 | [125I] - Peptide YY | 0 | Chicken | Binding | pKi | = | 630.96 | 6.20 | -83 | 3 | - | PDSP KiDatabase | 895.4 | 16 | 5 | 11 | 3.29 | NC(N)=NCCCC(NC(=O)CC1(CC(=O)N2CCN(C3c4ccccc4NC(=O)c4ccccc43)CC2)CCCC1)C(=O)NCCn1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O | - | |
BIIE0246 | 633 | None | 0 | Rat | Binding | pKi | None | - | 8.00 | - | 2 | Unclassified | Guide to Pharmacology | 895.4 | 16 | 5 | 11 | 3.29 | NC(N)=NCCC[C@H](NC(=O)CC1(CC(=O)N2CCN(C3c4ccccc4NC(=O)c4ccccc43)CC2)CCCC1)C(=O)NCCn1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O | https://pubmed.ncbi.nlm.nih.gov/11408607 | |
BIIE0246 | 218722 | [125I] - Peptide YY | 0 | Rat | Binding | pKi | = | 6.50 | 8.19 | 83 | 3 | - | PDSP KiDatabase | 895.4 | 16 | 5 | 11 | 3.29 | NC(N)=NCCCC(NC(=O)CC1(CC(=O)N2CCN(C3c4ccccc4NC(=O)c4ccccc43)CC2)CCCC1)C(=O)NCCn1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O | - | |
BIIE0246 | 218722 | [125I] - Peptide YY | 0 | Rat | Binding | pKi | = | 9.00 | 8.05 | 83 | 3 | - | PDSP KiDatabase | 895.4 | 16 | 5 | 11 | 3.29 | NC(N)=NCCCC(NC(=O)CC1(CC(=O)N2CCN(C3c4ccccc4NC(=O)c4ccccc43)CC2)CCCC1)C(=O)NCCn1c(=O)n(-c2ccccc2)n(-c2ccccc2)c1=O | - | |
C2-NPY (pig) | 764 | None | 0 | Human | Binding | pKi | None | - | 8.50 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7592910 | |
CGP 71683A | 899 | None | 11 | Human | Binding | IC50 | = | 1890.00 | 5.72 | - | 8 | Compound was tested for human Neuropeptide Y receptor type 2 | ChEMBL | 475.2 | 7 | 3 | 6 | 4.56 | Nc1nc(NCC2CCC(CNS(=O)(=O)c3cccc4ccccc34)CC2)nc2ccccc12 | https://dx.doi.org/10.1016/s0960-894x(00)00177-3 | |
CHEMBL127282 | 211129 | None | 0 | Human | Binding | Ki | = | 2.60 | 8.59 | 1 | 2 | Affinity against Neuropeptide Y2 receptor on SK-N-BE2 human neuroblastoma cells | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCN=C(N)N)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(N)=O)[C@@H](C)O)[C@@H](C)CC | https://dx.doi.org/10.1021/jm00076a007 | |
CHEMBL1543306 | 47205 | None | 32 | Human | Binding | IC50 | = | 200.00 | 6.70 | - | 1 | Displacement of [125I]PYY from human NPY Y2 receptor expressed endogenously in KAN-Ts cells by scintillation counting | ChEMBL | 446.2 | 6 | 2 | 3 | 5.43 | CCOc1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.06.136 | |
CHEMBL1823341 | 65040 | None | 0 | Human | Binding | IC50 | = | 25.00 | 7.60 | - | 1 | Displacement of [125I]PYY from human NPY Y2 receptor expressed endogenously in KAN-Ts cells by scintillation counting | ChEMBL | 464.2 | 6 | 1 | 5 | 5.05 | COc1cccnc1C(=O)N1CCN(c2ccc(NC(C)(C)c3ccccc3)cc2Cl)CC1 | https://dx.doi.org/10.1016/j.bmcl.2011.06.136 | |
CHEMBL1823342 | 65041 | None | 47 | Human | Binding | IC50 | = | 6.00 | 8.22 | - | 1 | Displacement of [125I]PYY from human NPY Y2 receptor expressed endogenously in KAN-Ts cells by scintillation counting | ChEMBL | 565.3 | 9 | 1 | 5 | 5.87 | CCN(CC)C(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3cccnc3)cc2F)CC1 | https://dx.doi.org/10.1016/j.bmcl.2011.06.136 | |
CHEMBL1823342 | 65041 | None | 47 | Human | Binding | IC50 | = | 6.00 | 8.22 | - | 1 | Displacement of [125I]-NPY from NPYY2 receptor (unknown origin) | ChEMBL | 565.3 | 9 | 1 | 5 | 5.87 | CCN(CC)C(=O)C(c1ccccc1)N1CCN(c2ccc(NC(=O)c3ccccc3-c3cccnc3)cc2F)CC1 | https://dx.doi.org/10.1016/j.bmcl.2013.11.061 |
Showing 1 to 20 of 729 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |