Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1200171 | 14370 | None | 0 | Human | Binding | EC50 | = | 54.20 | 7.27 | - | 4 | Binding affinity to human NTR2 by gamma counting | ChEMBL | 816.5 | 22 | 9 | 8 | 1.43 | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)CCC[N+](C)(C)C)C(C)(C)C)C(=O)O | https://dx.doi.org/10.1021/jm100092s | |
CHEMBL1200171 | 14370 | None | 0 | Rat | Binding | Kd | = | 23.31 | 7.63 | - | 4 | Displacement of [125I]NT from rat NTR2 by gamma counting | ChEMBL | 816.5 | 22 | 9 | 8 | 1.43 | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)CCC[N+](C)(C)C)C(C)(C)C)C(=O)O | https://dx.doi.org/10.1021/jm100092s | |
CHEMBL129953 | 19542 | None | 0 | Human | Binding | IC50 | = | 5.30 | 8.28 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 817.5 | 23 | 10 | 10 | 0.12 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)NC(=O)[C@@H](N)CCC[N+](C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL132409 | 22352 | None | 0 | Human | Binding | IC50 | = | 0.90 | 9.05 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 816.5 | 23 | 11 | 11 | -1.52 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL132507 | 22472 | None | 0 | Human | Binding | IC50 | = | 2.80 | 8.55 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 816.5 | 24 | 9 | 11 | 0.15 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCCN(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL132524 | 22489 | None | 0 | Human | Binding | IC50 | = | 0.78 | 9.11 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 844.5 | 24 | 12 | 13 | -1.73 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCNC1NCCN1)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL132794 | 22791 | None | 0 | Human | Binding | IC50 | = | 3.10 | 8.51 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 845.6 | 25 | 10 | 10 | 0.90 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)NC(=O)[C@@H](N)CCCCC[N+](C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL133340 | 23466 | None | 0 | Human | Binding | IC50 | = | 3.50 | 8.46 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 788.5 | 23 | 10 | 11 | -0.58 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCNC)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL133378 | 23519 | None | 0 | Human | Binding | IC50 | = | 5.10 | 8.29 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 802.5 | 23 | 9 | 11 | -0.24 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCN(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL133798 | 24022 | None | 0 | Human | Binding | IC50 | = | 3.20 | 8.49 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 831.5 | 24 | 10 | 10 | 0.51 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCCNC(=N)NC(=O)[C@@H](N)CCCC[N+](C)(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL133849 | 24103 | None | 0 | Human | Binding | IC50 | = | 6.90 | 8.16 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 816.5 | 25 | 10 | 11 | 0.20 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCCCNC)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL133850 | 24104 | None | 0 | Human | Binding | IC50 | = | 3.50 | 8.46 | - | 2 | Evaluated for binding affinity by inhibiting binding of [125I]Tyr(3)-NT to human Neurotensin receptor 2 | ChEMBL | 830.5 | 25 | 9 | 11 | 0.55 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CCC/N=C(/N)NC(=O)[C@@H](N)CCCCCN(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm0300633 | |
CHEMBL172313 | 211311 | None | 0 | Human | Binding | Ki | = | 63.00 | 7.20 | -14 | 3 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766825 | 211318 | None | 0 | Human | Binding | Ki | = | 8.80 | 8.06 | 3235 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)CN(CCc1ccc(O)cc1)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766923 | 211319 | None | 0 | Human | Binding | Ki | = | 56.00 | 7.25 | -12 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766924 | 211320 | None | 0 | Human | Binding | Ki | = | 24.00 | 7.62 | -2 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766925 | 211321 | None | 0 | Human | Binding | Ki | = | 63.00 | 7.20 | -2 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766926 | 211322 | None | 0 | Human | Binding | Ki | = | 83.00 | 7.08 | 15 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766927 | 211323 | None | 0 | Human | Binding | Ki | = | 1300.00 | 5.89 | -1 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766928 | 211324 | None | 0 | Human | Binding | Kd | = | 1.20 | 8.92 | -5 | 2 | Displacement of [3H]NT from human NTS2 receptor expressed in HEK293 cells | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](CC1=CC=C(O)CC1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c |
Showing 1 to 20 of 220 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[D-Trp11]neurotensin | 1496 | None | 0 | Mouse | Functional | pIC50 | None | - | 7.55 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9480852 | |
CHEMBL1766825 | 211318 | None | 0 | Human | Functional | EC50 | = | 480.00 | 6.32 | - | 2 | Agonist activity at human NTS2 receptor expressed in HEK293 cells assessed as inhibition of constitutive activity on MAPK-mediated luciferase activity | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)CN(CCc1ccc(O)cc1)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766944 | 211335 | None | 0 | Human | Functional | EC50 | = | 840.00 | 6.08 | - | 2 | Agonist activity at human NTS2 receptor expressed in HEK293 cells assessed as inhibition of constitutive activity on MAPK-mediated luciferase activity | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)CN(CCc1ccc(O)cc1)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766945 | 211336 | None | 0 | Human | Functional | EC50 | = | 690.00 | 6.16 | - | 2 | Agonist activity at human NTS2 receptor expressed in HEK293 cells assessed as inhibition of constitutive activity on MAPK-mediated luciferase activity | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)CN(CCc1ccc(O)cc1)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL1766946 | 211337 | None | 0 | Human | Functional | EC50 | = | 590.00 | 6.23 | - | 2 | Agonist activity at human NTS2 receptor expressed in HEK293 cells assessed as inhibition of constitutive activity on MAPK-mediated luciferase activity | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)CN(CCc1ccc(O)cc1)C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)O | https://dx.doi.org/10.1021/jm200006c | |
CHEMBL3290090 | 112199 | None | 0 | Rat | Functional | EC50 | = | 216.00 | 6.67 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 548.2 | 8 | 2 | 7 | 5.52 | COc1ccc(OC)c(-c2cc(C(=O)N[C@H](C(=O)O)C3CCCCC3)nn2-c2ccnc3cc(Cl)ccc23)c1 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290091 | 112200 | None | 0 | Rat | Functional | EC50 | = | 382.00 | 6.42 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 548.2 | 8 | 2 | 7 | 5.52 | COc1ccc(-c2cc(C(=O)N[C@H](C(=O)O)C3CCCCC3)nn2-c2ccnc3cc(Cl)ccc23)c(OC)c1 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290092 | 112201 | None | 0 | Rat | Functional | EC50 | = | 258.00 | 6.59 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 518.2 | 7 | 2 | 6 | 5.51 | COc1ccccc1-c1cc(C(=O)N[C@H](C(=O)O)C2CCCCC2)nn1-c1ccnc2cc(Cl)ccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290093 | 112202 | None | 0 | Rat | Functional | EC50 | = | 166.00 | 6.78 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 524.1 | 6 | 2 | 5 | 5.78 | O=C(N[C@H](C(=O)O)C1CCCCC1)c1cc(-c2c(F)cccc2F)n(-c2ccnc3cc(Cl)ccc23)n1 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290094 | 112203 | None | 0 | Rat | Functional | EC50 | = | 94.00 | 7.03 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 576.2 | 9 | 2 | 7 | 6.08 | CCc1c(C(=O)N[C@H](C(=O)O)C2CCCCC2)nn(-c2ccnc3cc(Cl)ccc23)c1-c1c(OC)cccc1OC | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290095 | 112204 | None | 0 | Rat | Functional | EC50 | = | 21.00 | 7.68 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 548.2 | 7 | 2 | 7 | 5.67 | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)CCCCCC2)nn1-c1ccnc2cc(Cl)ccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290096 | 112205 | None | 0 | Rat | Functional | EC50 | = | 29.00 | 7.54 | - | 2 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 534.2 | 7 | 2 | 7 | 5.28 | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)CCCCC2)nn1-c1ccnc2cc(Cl)ccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290097 | 112206 | None | 0 | Rat | Functional | EC50 | = | 20.00 | 7.70 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 520.2 | 7 | 2 | 7 | 4.88 | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)CCCC2)nn1-c1ccnc2cc(Cl)ccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290098 | 112207 | None | 0 | Rat | Functional | EC50 | = | 62.00 | 7.21 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 504.2 | 6 | 2 | 6 | 5.27 | COc1ccccc1-c1cc(C(=O)NC2(C(=O)O)CCCCC2)nn1-c1ccnc2cc(Cl)ccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290099 | 112208 | None | 0 | Rat | Functional | EC50 | = | 159.00 | 6.80 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 513.2 | 8 | 2 | 6 | 5.47 | COc1cccc(OC)c1-c1cc(C(=O)N[C@H](C(=O)O)C2CCCCC2)nn1-c1cccc2ccccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290100 | 112209 | None | 0 | Rat | Functional | EC50 | = | 229.00 | 6.64 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 483.2 | 7 | 2 | 5 | 5.46 | COc1ccccc1-c1cc(C(=O)N[C@H](C(=O)O)C2CCCCC2)nn1-c1cccc2ccccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290101 | 112210 | None | 0 | Rat | Functional | EC50 | = | 18.00 | 7.75 | - | 2 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 499.2 | 7 | 2 | 6 | 5.23 | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)CCCCC2)nn1-c1cccc2ccccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290102 | 112211 | None | 0 | Rat | Functional | EC50 | = | 108.00 | 6.97 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 469.2 | 6 | 2 | 5 | 5.22 | COc1ccccc1-c1cc(C(=O)NC2(C(=O)O)CCCCC2)nn1-c1cccc2ccccc12 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290103 | 112212 | None | 0 | Rat | Functional | EC50 | = | 68.00 | 7.17 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 519.2 | 7 | 2 | 6 | 4.71 | COc1cccc(OC)c1-c1cc(C(=O)NC2(C(=O)O)C3CC4CC(C3)CC2C4)nn1-c1ccc(F)cc1 | https://dx.doi.org/10.1021/jm5003843 | |
CHEMBL3290104 | 112213 | None | 0 | Rat | Functional | EC50 | = | 271.00 | 6.57 | - | 1 | Agonist activity at rat NTS2 stably expressed in CHOK1 cells assessed as induction of calcium release by FLIPR assay | ChEMBL | 481.2 | 8 | 2 | 6 | 4.46 | COc1cccc(OC)c1-c1cc(C(=O)N[C@H](C(=O)O)C2CCCCC2)nn1-c1ccc(F)cc1 | https://dx.doi.org/10.1021/jm5003843 |
Showing 1 to 20 of 58 entries