Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
A(Δ10/15C)INSL3 | 282 | None | 0 | Human | Binding | pKi | = | - | 8.32 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20570702 | |
A(10-24)INSL3 | 190 | None | 0 | Human | Binding | pKi | = | - | 8.67 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 | |
A(4-24)(B7-24)H2 | 202 | None | 0 | Human | Binding | pKi | = | - | 6.00 | -9 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/21878627 | |
A(9-26)INSL3 | 214 | None | 0 | Human | Binding | pKi | = | - | 9.14 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 | |
A(C10/15S)INSL3 | 233 | None | 0 | Human | Binding | pKi | = | - | 8.59 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20570702 | |
cyclic INSL3 B-chain analogue 6 | 1279 | None | 0 | Human | Binding | pKi | = | - | 6.65 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/17120268 | |
europium-labelled INSL3 | 1599 | None | 0 | Human | Binding | pKd | = | - | 9.00 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18529069 | |
INSL3 | 2044 | None | 0 | Human | Binding | pKd | = | - | 10.35 | 16982 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 | |
INSL3 | 2044 | None | 0 | Human | Binding | pKi | = | - | 9.52 | 16982 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15649866 | |
INSL3 | 2044 | None | 0 | Human | Binding | pKi | = | - | 9.52 | 16982 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 | |
INSL3 [A(5-26):B(7-27)] | 2045 | None | 0 | Human | Binding | pKi | = | - | 7.80 | - | 1 | Receptor binding | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/22654853 | |
INSL3 B chain dimer analogue 8 | 2047 | None | 0 | Human | Binding | pKi | = | - | 8.50 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/20560146 | |
INSL3 B-chain analogue | 2046 | None | 0 | Human | Binding | pKi | = | - | 5.10 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16547350 | |
NanoLuc-INSL3 | 2731 | None | 0 | Human | Binding | pKd | = | - | 8.70 | - | 1 | Receptor binding affinity | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/24056075 | |
relaxin | 3302 | None | 0 | Human | Binding | pKi | None | - | 7.80 | -39 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15649866 | |
relaxin | 3303 | None | 0 | Human | Binding | pKi | None | - | 7.90 | -15 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15649866 | |
relaxin | 3305 | None | 0 | Human | Binding | pKi | = | - | 8.39 | -40 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15649866 | |
relaxin | 3305 | None | 0 | Human | Binding | pKi | = | - | 8.39 | -40 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 | |
relaxin-1 | 3306 | None | 0 | Human | Binding | pKi | None | - | 8.80 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16411781 | |
relaxin-3 | 3307 | None | 0 | Human | Binding | pKi | None | - | 7.00 | -81 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16411781 |
Showing 1 to 20 of 20 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
A(4-24)(B7-24)H2 | 202 | None | 0 | Human | Functional | pEC50 | = | - | 6.00 | -165 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/21878627 | |
CHEMBL3715750 | 133980 | None | 0 | Human | Functional | AC50 | = | 7470.00 | 5.13 | 1 | 2 | Agonist activity at RXFP2 receptor (unknown origin) expressed in HEK293 cells assessed as stimulation of cAMP production incubated for 30 mins by HTRF assay | ChEMBL | 375.1 | 4 | 2 | 4 | 4.20 | O=C(Nc1ccccc1C(=O)Nc1cccc(C(F)(F)F)c1)c1ccno1 | - | |
CHEMBL3716158 | 134094 | None | 0 | Human | Functional | AC50 | = | 9400.00 | 5.03 | - | 1 | Agonist activity at RXFP2 receptor (unknown origin) expressed in HEK293 cells assessed as stimulation of cAMP production incubated for 30 mins by HTRF assay | ChEMBL | 361.2 | 4 | 3 | 2 | 4.94 | O=C(Nc1ccc2cc[nH]c2c1)c1ccccc1NC(=O)C1CCCCC1 | - | |
CHEMBL3718470 | 134778 | None | 0 | Human | Functional | AC50 | = | 3340.00 | 5.48 | 1 | 2 | Agonist activity at RXFP2 receptor (unknown origin) expressed in HEK293 cells assessed as stimulation of cAMP production incubated for 30 mins by HTRF assay | ChEMBL | 428.1 | 4 | 2 | 4 | 4.94 | O=C(Nc1ccccc1C(=O)Nc1cccc(C(F)(F)F)c1)c1ccc2c(c1)OCO2 | - | |
compound 6641 | 1127 | None | 0 | Human | Functional | pEC50 | = | - | 6.42 | - | 1 | Determined in a HTRF cAMP assay using HEK-RXFP2 cells. | Guide to Pharmacology | 787.0 | 5 | 1 | 5 | 6.58 | O=C1Nc2ccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc2C(=O)N2CCN(C(=O)COc3ccc(OC(F)(F)F)cc3I)C[C@@H]12 | https://pubmed.ncbi.nlm.nih.gov/36333465 | |
INSL3 [A(5-26):B(7-27)] | 2045 | None | 0 | Human | Functional | pEC50 | = | - | 10.00 | - | 1 | Receptor activation | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/22654853 | |
relaxin | 3305 | None | 0 | Human | Functional | pEC50 | = | - | 9.13 | -17 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/18434306 |
Showing 1 to 7 of 7 entries