Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 42637503 | 198273 | None | 0 | Human | Functional | pEC50 | = | 9.4 | 9.4 | 100 | 3 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | 1238 | 19 | 12 | 15 | 2.0 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@H](N)Cc3ccc(O)cc3)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL558161 | 198273 | None | 0 | Human | Functional | pEC50 | = | 9.4 | 9.4 | 100 | 3 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | 1238 | 19 | 12 | 15 | 2.0 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@H](N)Cc3ccc(O)cc3)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL563125 | 218236 | None | 0 | Human | Functional | pEC50 | = | 9.0 | 9.0 | - | 1 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](c2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1021/jm801314f | ||||
| 42637069 | 197965 | None | 0 | Human | Functional | pEC50 | = | 8.4 | 8.4 | 48 | 3 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | 1074 | 15 | 10 | 13 | 1.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL553655 | 197965 | None | 0 | Human | Functional | pEC50 | = | 8.4 | 8.4 | 48 | 3 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | 1074 | 15 | 10 | 13 | 1.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL556949 | 218226 | None | 0 | Human | Functional | pEC50 | = | 7.5 | 7.5 | - | 1 | Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14Agonist activity at human sst1 receptor expressed in Chinese hamster CCL39 cells by luciferase reporter gene assay relative to somatostatin-14 |
ChEMBL | None | None | None | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](Cc3c[nH]c4ccccc34)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3)CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H]([C@@H](C)O)NC2=O)cc1 | 10.1021/jm801314f | ||||
| 68254010 | 166509 | None | 0 | Human | Functional | pIC50 | = | 5.2 | 5.2 | -1778 | 3 | Antagonist activity at human SSTR1 expressed in CHO-K1 cell membranesAntagonist activity at human SSTR1 expressed in CHO-K1 cell membranes |
ChEMBL | 559 | 10 | 2 | 7 | 6.6 | CCOc1cc(CN2CC[C@H]3C(Nc4nc5ccc(C(=O)O)cc5o4)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 | 10.1021/acsmedchemlett.8b00305 | ||
| CHEMBL4277106 | 166509 | None | 0 | Human | Functional | pIC50 | = | 5.2 | 5.2 | -1778 | 3 | Antagonist activity at human SSTR1 expressed in CHO-K1 cell membranesAntagonist activity at human SSTR1 expressed in CHO-K1 cell membranes |
ChEMBL | 559 | 10 | 2 | 7 | 6.6 | CCOc1cc(CN2CC[C@H]3C(Nc4nc5ccc(C(=O)O)cc5o4)CC[C@H]32)cc(OCC)c1-c1ccc(F)cc1 | 10.1021/acsmedchemlett.8b00305 | ||
| 145705877 | 220222 | None | 0 | Human | Functional | pIC50 | = | 8.1 | 8.1 | 1 | 5 | NoneNone |
Drug Central | 1047 | 17 | 9 | 11 | 3.4 | NCCCC[C@@H]1NC(=O)[C@@H](CC2=CNC3=C2C=CC=C3)NC(=O)C(NC(=O)[C@@H]2C[C@H](CN2C(=O)[C@H](CC2=CC=CC=C2)NC(=O)[C@H](CC2=CC=C(OCC3=CC=CC=C3)C=C2)NC1=O)OC(=O)NCCN)C1=CC=CC=C1 | None | ||
| 2027 | 655 | None | 0 | Human | Functional | pIC50 | = | 5.6 | 5.6 | -398 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 11897676 | ||||
| 2003 | 641 | None | 0 | Human | Functional | pIC50 | = | 6.4 | 6.4 | -79 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 8100350 | ||||
| 2006 | 906 | None | 0 | Rat | Functional | pIC50 | = | 7.3 | 7.3 | -15 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9166718 | ||||
| 2010 | 1376 | None | 0 | Human | Functional | pIC50 | = | 7.5 | 7.5 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15658864 | ||||
| 2011 | 1374 | None | 0 | Human | Functional | pIC50 | = | 7.8 | 7.8 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15658865 | ||||
| 2018 | 3007 | None | 26 | Human | Functional | pIC50 | = | 8 | 8.0 | -63 | 22 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15477717 | ||||
| 9941444 | 3007 | None | 26 | Human | Functional | pIC50 | = | 8 | 8.0 | -63 | 22 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15477717 | ||||
| CHEMBL3349607 | 3007 | None | 26 | Human | Functional | pIC50 | = | 8 | 8.0 | -63 | 22 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15477717 | ||||
| DB06663 | 3007 | None | 26 | Human | Functional | pIC50 | = | 8 | 8.0 | -63 | 22 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15477717 | ||||
| 2025 | 1281 | None | 0 | Human | Functional | pIC50 | = | 8.2 | 8.2 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15658865 | ||||
| 2009 | 1373 | None | 0 | Human | Functional | pIC50 | = | 8.3 | 8.3 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15658865 | ||||
| 2013 | 2180 | None | 0 | Human | Functional | pIC50 | = | 8.6 | 8.6 | -3 | 6 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 12450568 | ||||
| 2012 | 1375 | None | 0 | Human | Functional | pIC50 | = | 9 | 9.0 | 1 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 15658864 | ||||
| 2026 | 654 | None | 0 | Human | Functional | pIC50 | None | 6 | 6.0 | -31 | 5 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 11897676 | ||||
| 2019 | 3675 | None | 0 | Rat | Functional | pIC50 | None | 8.4 | 8.4 | -50 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9166718 | ||||
| 44386062 | 3675 | None | 0 | Rat | Functional | pIC50 | None | 8.4 | 8.4 | -50 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9166718 | ||||
| CHEMBL440072 | 3675 | None | 0 | Rat | Functional | pIC50 | None | 8.4 | 8.4 | -50 | 4 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9166718 | ||||
| 2006 | 906 | None | 0 | Human | Functional | pIC50 | None | 8.5 | 8.5 | 15 | 2 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 9600011 | ||||
Showing 1 to 27 of 27 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 124168080 | 181940 | None | 0 | Human | Binding | pEC50 | = | 6.5 | 6.5 | - | 0 | Agonist activity at human SST1Agonist activity at human SST1 |
ChEMBL | 507 | 6 | 2 | 7 | 4.4 | Cc1cc(Cl)cc(-c2cnc3ncn(-c4cc(O)cc(F)c4)c(=O)c3c2CN(C)C[C@@H]2CCCN2)c1 | 10.1016/j.bmcl.2020.127496 | ||
| CHEMBL4778342 | 181940 | None | 0 | Human | Binding | pEC50 | = | 6.5 | 6.5 | - | 0 | Agonist activity at human SST1Agonist activity at human SST1 |
ChEMBL | 507 | 6 | 2 | 7 | 4.4 | Cc1cc(Cl)cc(-c2cnc3ncn(-c4cc(O)cc(F)c4)c(=O)c3c2CN(C)C[C@@H]2CCCN2)c1 | 10.1016/j.bmcl.2020.127496 | ||
| 16129706 | 211490 | None | 36 | Human | Binding | pIC50 | = | 9.9 | 9.9 | -6 | 5 | Binding affinity to Somatostatin receptor type 1 (unknown origin) by radioligand displacement assayBinding affinity to Somatostatin receptor type 1 (unknown origin) by radioligand displacement assay |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1016/j.bmc.2013.03.016 | ||||
| CHEMBL1823872 | 211490 | None | 36 | Human | Binding | pIC50 | = | 9.9 | 9.9 | -6 | 5 | Binding affinity to Somatostatin receptor type 1 (unknown origin) by radioligand displacement assayBinding affinity to Somatostatin receptor type 1 (unknown origin) by radioligand displacement assay |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1016/j.bmc.2013.03.016 | ||||
| 42637503 | 198273 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1238 | 19 | 12 | 15 | 2.0 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@H](N)Cc3ccc(O)cc3)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL558161 | 198273 | None | 0 | Human | Binding | pIC50 | = | 9.7 | 9.7 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1238 | 19 | 12 | 15 | 2.0 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@H](N)Cc3ccc(O)cc3)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| 45268875 | 198066 | None | 0 | Human | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1363 | 19 | 12 | 15 | 2.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3I)CSSC[C@@H](C(=O)N[C@@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL555977 | 198066 | None | 0 | Human | Binding | pIC50 | = | 9.1 | 9.1 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1363 | 19 | 12 | 15 | 2.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3I)CSSC[C@@H](C(=O)N[C@@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL408338 | 215166 | None | 0 | Human | Binding | pIC50 | = | 9.0 | 9.0 | - | 0 | Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1 |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCCCN)NC1=O | 10.1021/jm049520l | ||||
| 45268875 | 198066 | None | 0 | Human | Binding | pIC50 | = | 9 | 9.0 | - | 0 | Binding affinity to sst1 receptor in human prostate cancer cells by autoradiographyBinding affinity to sst1 receptor in human prostate cancer cells by autoradiography |
ChEMBL | 1363 | 19 | 12 | 15 | 2.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3I)CSSC[C@@H](C(=O)N[C@@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL555977 | 198066 | None | 0 | Human | Binding | pIC50 | = | 9 | 9.0 | - | 0 | Binding affinity to sst1 receptor in human prostate cancer cells by autoradiographyBinding affinity to sst1 receptor in human prostate cancer cells by autoradiography |
ChEMBL | 1363 | 19 | 12 | 15 | 2.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](NC(=O)[C@@H](N)Cc3ccc(O)cc3I)CSSC[C@@H](C(=O)N[C@@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| 42637069 | 197965 | None | 0 | Human | Binding | pIC50 | = | 9 | 9.0 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1074 | 15 | 10 | 13 | 1.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL553655 | 197965 | None | 0 | Human | Binding | pIC50 | = | 9 | 9.0 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1074 | 15 | 10 | 13 | 1.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL409100 | 215206 | None | 0 | Human | Binding | pIC50 | = | 9 | 9.0 | - | 0 | Tested for ability to bind to 20 uM thick cryostat sections of a membrane pellet of cells transfected with human cloned somatostatin (sst) receptor subtype 1.Tested for ability to bind to 20 uM thick cryostat sections of a membrane pellet of cells transfected with human cloned somatostatin (sst) receptor subtype 1. |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@@H]1CSSC[C@H](C(=O)O)NC(=O)[C@@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](CCCCN)NC1=O | 10.1021/jm010037+ | ||||
| 70689723 | 73994 | None | 0 | Human | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1170 | 16 | 9 | 12 | 4.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@@H](Cc3ccc4ccccc4c3)C(N)=O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| CHEMBL2021559 | 73994 | None | 0 | Human | Binding | pIC50 | = | 8.9 | 8.9 | - | 0 | Displacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiographyDisplacement of [125I]LTT-SRIF-28 from human sst1 receptor by autoradiography |
ChEMBL | 1170 | 16 | 9 | 12 | 4.6 | CC(C)NCc1ccc(C[C@@H]2NC(=O)[C@@H](N(C)C(=O)c3ccc4ccccc4c3)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)N[C@@H](Cc3ccc4ccccc4c3)C(N)=O)NC(=O)[C@H](Cc3ccccc3)NC2=O)cc1 | 10.1021/jm801314f | ||
| 16129706 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.8 | 8.8 | -6 | 5 | Displacement of 125I-[LTT]-SRIF-28 from human sst1 receptor in CHO cells after 2 hrs by autoradiographyDisplacement of 125I-[LTT]-SRIF-28 from human sst1 receptor in CHO cells after 2 hrs by autoradiography |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1021/jm200307v | ||||
| CHEMBL1823872 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.8 | 8.8 | -6 | 5 | Displacement of 125I-[LTT]-SRIF-28 from human sst1 receptor in CHO cells after 2 hrs by autoradiographyDisplacement of 125I-[LTT]-SRIF-28 from human sst1 receptor in CHO cells after 2 hrs by autoradiography |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1021/jm200307v | ||||
| 16129706 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.7 | 8.7 | -6 | 5 | Displacement of [125I]-[LTT]-SS28 from human SST1 receptor expressed in CHO cells after 2 hrs by autoradiographic analysisDisplacement of [125I]-[LTT]-SS28 from human SST1 receptor expressed in CHO cells after 2 hrs by autoradiographic analysis |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1016/j.ejmech.2013.12.003 | ||||
| CHEMBL1823872 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.7 | 8.7 | -6 | 5 | Displacement of [125I]-[LTT]-SS28 from human SST1 receptor expressed in CHO cells after 2 hrs by autoradiographic analysisDisplacement of [125I]-[LTT]-SS28 from human SST1 receptor expressed in CHO cells after 2 hrs by autoradiographic analysis |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1016/j.ejmech.2013.12.003 | ||||
| CHEMBL442494 | 216374 | None | 0 | Human | Binding | pIC50 | = | 8.7 | 8.7 | -6 | 5 | Displacement of [125I]-[Leu8, DTrp22, Tyr25]-somatostatin-28 from human recombinant sst1 receptor expressed in chinese hamster CCL39 cellsDisplacement of [125I]-[Leu8, DTrp22, Tyr25]-somatostatin-28 from human recombinant sst1 receptor expressed in chinese hamster CCL39 cells |
ChEMBL | None | None | None | CSCC[C@H](NC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)NCC(=O)N[C@@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](CCCCN)NC1=O | 10.1021/jm801205x | ||||
| 16129706 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.7 | 8.7 | -6 | 5 | Inhibition of 125I-[Leu8,D-Trp22,Tyr25]SRIF-28 binding to human somatostatin receptor type 1Inhibition of 125I-[Leu8,D-Trp22,Tyr25]SRIF-28 binding to human somatostatin receptor type 1 |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1021/jm049519m | ||||
| CHEMBL1823872 | 211490 | None | 36 | Human | Binding | pIC50 | = | 8.7 | 8.7 | -6 | 5 | Inhibition of 125I-[Leu8,D-Trp22,Tyr25]SRIF-28 binding to human somatostatin receptor type 1Inhibition of 125I-[Leu8,D-Trp22,Tyr25]SRIF-28 binding to human somatostatin receptor type 1 |
ChEMBL | None | None | None | C[C@H](N)C(=O)NCC(=O)N[C@H]1CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC1=O | 10.1021/jm049519m | ||||
| CHEMBL262379 | 212997 | None | 0 | Human | Binding | pIC50 | = | 8 | 8.0 | - | 0 | Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1 |
ChEMBL | None | None | None | C[C@@H](O)[C@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H]([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@@H](CCCCN)NC(=O)[C@H](N)CSSC[C@@H](C(=O)O)NC(=O)[C@H](CO)NC1=O | 10.1021/jm049520l | ||||
| CHEMBL425465 | 215796 | None | 0 | Human | Binding | pIC50 | = | 8 | 8.0 | - | 0 | Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1Inhibition of [Leu8,D-Trp22,125I-Tyr25]SRIF-28 binding to human somatostatin receptor type 1 |
ChEMBL | None | None | None | CC(C)NCc1ccc(C[C@H]2C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@H]([C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)O)CSSC[C@@H](N)C(=O)N[C@H](CCCCN)C(=O)N[C@H](Cc3ccccc3)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N2C)cc1 | 10.1021/jm049520l | ||||
| CHEMBL3350911 | 213988 | None | 0 | Human | Binding | pIC50 | = | 8.0 | 8.0 | - | 0 | Binding affinity towards human somatostatin receptor type 1 using [125I][Leu8,D-Trp22,Tyr25]SRIF-28 as radioligand.Binding affinity towards human somatostatin receptor type 1 using [125I][Leu8,D-Trp22,Tyr25]SRIF-28 as radioligand. |
ChEMBL | None | None | None | C[C@@H](O)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](N)CSSC[C@@H](C(=O)O)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O | 10.1021/jm030245x | ||||
| 118718507 | 115422 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | 1050 | 14 | 11 | 12 | 3.4 | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)CSSC[C@@H](C(=O)NC(C)(C)C)NC1=O | 10.1021/jm970730q | ||
| CHEMBL3349670 | 115422 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | 1050 | 14 | 11 | 12 | 3.4 | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)CSSC[C@@H](C(=O)NC(C)(C)C)NC1=O | 10.1021/jm970730q | ||
| CHEMBL2079558 | 211653 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](NC(=O)[C@H](N)Cc2ccc3ccccc3c2)CSSC[C@H](C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349505 | 213869 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(N)=O)[C@@H](C)O | 10.1021/jm970730q | ||||
| CHEMBL3349506 | 213870 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(N)=O)[C@@H](C)O | 10.1021/jm970730q | ||||
| CHEMBL3349508 | 213872 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=O)[C@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(N)=O)[C@@H](C)O | 10.1021/jm970730q | ||||
| CHEMBL3349597 | 213885 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | C[C@@H](O)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1)[C@@H](C)O)C(N)=O | 10.1021/jm970730q | ||||
| CHEMBL3349608 | 213895 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | C[C@@H](O)[C@H](NC(=O)[C@@H]1CSSC[C@@H](NC(=O)[C@@H](N)Cc2ccccc2)C(=O)N[C@@H](Cc2cccnc2)C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1)C(N)=O | 10.1021/jm970730q | ||||
| CHEMBL3349610 | 213896 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@H](N)Cc2ccccc2)C(C)(C)SSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349611 | 213897 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(=O)N[C@@H]1CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349612 | 213898 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccccc2)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349613 | 213899 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@H](N)Cc2ccccc2)CSSC[C@@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349617 | 213902 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | C[C@@H](O)[C@H](NC(=O)[C@@H]1CSSC[C@@H](NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2cccnc2)C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1)C(N)=O | 10.1021/jm970730q | ||||
| CHEMBL3349618 | 213903 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | C[C@@H](O)[C@H](NC(=O)[C@@H]1CSSC[C@@H](NC(=O)[C@H](N)Cc2ccccc2)C(=O)N[C@@H](Cc2cccnc2)C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1)C(N)=O | 10.1021/jm970730q | ||||
| CHEMBL3349663 | 213906 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2cccnc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2cccc(-c3ccccc3)c2)CSSC[C@@H](C(=O)N[C@@H](Cc2cccc(-c3ccccc3)c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349665 | 213908 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2cccnc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)CSSC[C@@H](C(=O)N[C@@H](Cc2cccc(-c3ccccc3)c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349668 | 213911 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2cccc(-c3ccccc3)c2)CSSC[C@@H](C(=O)N[C@@H](Cc2cccc(-c3ccccc3)c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349673 | 213915 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)CSSC[C@@H](C(=O)N[C@H](Cc2ccc3ccccc3c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349674 | 213916 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=O)[C@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cccc2ccccc12)C(N)=O | 10.1021/jm970730q | ||||
| CHEMBL3349675 | 213917 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349678 | 213920 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@@H]1NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2c[nH]cn2)NC(=O)[C@H](NC(=O)[C@@H](N)Cc2ccc3ccccc3c2)CSSC[C@@H](C(=O)N[C@@H](Cc2ccc3ccccc3c2)C(N)=O)NC1=O | 10.1021/jm970730q | ||||
| CHEMBL3349680 | 213922 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Binding affinity towards cloned human somatostatin 1 (hsst) receptorBinding affinity towards cloned human somatostatin 1 (hsst) receptor |
ChEMBL | None | None | None | CC(C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](Cc1ccc(Cl)cc1)NC(=O)[C@@H](N)Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cccc2ccccc12)C(N)=O | 10.1021/jm970730q | ||||
| 49865345 | 15918 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]-[LTT] SIRF-28 from human SST1 receptor expressed in CHO cells by autoradiographyDisplacement of [125I]-[LTT] SIRF-28 from human SST1 receptor expressed in CHO cells by autoradiography |
ChEMBL | 1043 | 18 | 13 | 12 | 0.7 | C[C@@H](O)[C@@H](CO)NC(=O)[C@@H]1C/C=C/C[C@H](NC(=O)[C@H](N)Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](Cc2cc3ccccc3[nH]2)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1 | 10.1021/jm1005868 | ||
| CHEMBL1223230 | 15918 | None | 0 | Human | Binding | pIC50 | = | 6 | 6.0 | - | 0 | Displacement of [125I]-[LTT] SIRF-28 from human SST1 receptor expressed in CHO cells by autoradiographyDisplacement of [125I]-[LTT] SIRF-28 from human SST1 receptor expressed in CHO cells by autoradiography |
ChEMBL | 1043 | 18 | 13 | 12 | 0.7 | C[C@@H](O)[C@@H](CO)NC(=O)[C@@H]1C/C=C/C[C@H](NC(=O)[C@H](N)Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](Cc2cc3ccccc3[nH]2)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N1 | 10.1021/jm1005868 | ||
Showing 1 to 50 of 1,467 entries