Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 4-BENZENESULFINYLMETHYL-1-[2-(5-FLUORO-1H-INDOL-3-YL)-ETHYL]-PIPERIDIN-4-OL (STRUCTURAL MIX) | 203249 | None | 1 | Human | Binding | IC50 | = | 22.00 | 7.66 | - | 2 | Binding affinity for heterologously expressed human Tachykinin receptor 2 using [3H]-SR- 48968 as radioligand | ChEMBL | 400.2 | 6 | 2 | 3 | 3.48 | [O-][S+](CC1(O)CCN(CCc2c[nH]c3ccc(F)cc23)CC1)c1ccccc1 | https://dx.doi.org/10.1016/s0960-894x(01)00074-9 | |
| 4-BENZENESULFINYLMETHYL-1-[2-(5-FLUORO-1H-INDOL-3-YL)-ETHYL]-PIPERIDIN-4-OL (STRUCTURAL MIX) | 203249 | None | 1 | Rat | Binding | Ki | = | 7.94 | 8.10 | - | 2 | Binding affinity by displacement of radiolabeled GR-100679 from Tachykinin receptor 2 from homogenized rat colon | ChEMBL | 400.2 | 6 | 2 | 3 | 3.48 | [O-][S+](CC1(O)CCN(CCc2c[nH]c3ccc(F)cc23)CC1)c1ccccc1 | https://dx.doi.org/10.1016/S0960-894X(01)80541-2 | |
| 4-BENZENESULFINYLMETHYL-1-[2-(5-FLUORO-1H-INDOL-3-YL)-ETHYL]-PIPERIDIN-4-OL (STRUCTURAL MIX) | 203249 | None | 1 | Rat | Binding | Ki | = | 0.50 | 9.30 | - | 2 | Binding affinity by displacement of radiolabeled GR-100679 from Tachykinin receptor 2 from homogenized rat colon | ChEMBL | 400.2 | 6 | 2 | 3 | 3.48 | [O-][S+](CC1(O)CCN(CCc2c[nH]c3ccc(F)cc23)CC1)c1ccccc1 | https://dx.doi.org/10.1016/S0960-894X(01)80541-2 | |
| 4-NONYLPHENOL | 45775 | None | 35 | Human | Binding | IC50 | = | 4514.00 | 5.34 | -1 | 5 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 220.2 | 8 | 1 | 1 | 4.68 | CCCCCCCCCc1ccc(O)cc1 | - | |
| 4-NONYLPHENOL | 45775 | None | 35 | Human | Binding | Ki | = | 1505.00 | 5.82 | -1 | 5 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 220.2 | 8 | 1 | 1 | 4.68 | CCCCCCCCCc1ccc(O)cc1 | - | |
| 4-OCTYLPHENOL | 71142 | None | 57 | Human | Binding | IC50 | = | 17430.00 | 4.76 | -2 | 10 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 206.2 | 7 | 1 | 1 | 4.29 | CCCCCCCCc1ccc(O)cc1 | - | |
| 4-OCTYLPHENOL | 71142 | None | 57 | Human | Binding | Ki | = | 5810.00 | 5.24 | -2 | 10 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 206.2 | 7 | 1 | 1 | 4.29 | CCCCCCCCc1ccc(O)cc1 | - | |
| [βAla8]neurokinin A-(4-10) | 604 | None | 0 | Human | Binding | pKd | = | - | 6.00 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7682062 | |
| [Phe(Me)7]neurokinin B | 3094 | None | 0 | Human | Binding | pKi | None | - | 6.90 | -199 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9190866 | |
| A-85380 | 218616 | 125I-Neurokinin A | 0 | Human | Binding | pKi | = | 10000.00 | 5.00 | -1 | 13 | - | PDSP KiDatabase | 164.1 | 3 | 1 | 3 | 0.82 | c1cncc(OCC2CCN2)c1 | - | |
| ABT-418 | 218617 | 125I-Neurokinin A | 0 | Human | Binding | pKi | = | 10000.00 | 5.00 | -1 | 8 | - | PDSP KiDatabase | 166.1 | 1 | 0 | 3 | 1.75 | Cc1cc(C2CCCN2C)on1 | - | |
| ABT-594 | 219818 | 125I-NKA | 0 | Human | Binding | pKi | = | 1000.00 | 6.00 | -2 | 37 | - | PDSP KiDatabase | 198.1 | 3 | 1 | 3 | 1.48 | Clc1ccc(OCC2CCN2)cn1 | - | |
| ALPHA-NAPHTHOFLAVONE | 99541 | None | 62 | Human | Binding | IC50 | = | 5847.10 | 5.23 | -2 | 5 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 272.1 | 1 | 0 | 2 | 4.61 | O=c1cc(-c2ccccc2)oc2c1ccc1ccccc12 | - | |
| ALPHA-NAPHTHOFLAVONE | 99541 | None | 62 | Human | Binding | Ki | = | 1949.00 | 5.71 | -2 | 5 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 272.1 | 1 | 0 | 2 | 4.61 | O=c1cc(-c2ccccc2)oc2c1ccc1ccccc12 | - | |
| amiodarone | 398 | None | 47 | Human | Binding | pKi | = | 5.19 | 8.28 | -4 | 40 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | Drug Central | 645.0 | 11 | 0 | 4 | 6.94 | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 | - | |
| amiodarone | 398 | None | 47 | Human | Binding | IC50 | = | 19315.00 | 4.71 | -4 | 40 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 645.0 | 11 | 0 | 4 | 6.94 | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 | - | |
| amiodarone | 398 | None | 47 | Human | Binding | Ki | = | 6438.00 | 5.19 | -4 | 40 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 645.0 | 11 | 0 | 4 | 6.94 | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 | - | |
| astemizole | 505 | None | 55 | Human | Binding | IC50 | = | 2986.00 | 5.53 | -44 | 48 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 458.2 | 8 | 1 | 5 | 5.35 | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 | - | |
| astemizole | 505 | None | 55 | Human | Binding | pKi | = | 6.00 | 8.22 | -44 | 48 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | Drug Central | 458.2 | 8 | 1 | 5 | 5.35 | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 | - | |
| astemizole | 505 | None | 55 | Human | Binding | Ki | = | 995.00 | 6.00 | -44 | 48 | DRUGMATRIX: Tachykinin NK2 radioligand binding (ligand: [3H] SR-48968) | ChEMBL | 458.2 | 8 | 1 | 5 | 5.35 | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 | - | |
Showing 1 to 20 of 1,364 entries
| Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |