Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[Phaa1,D-Tyr(Et)2,Lys6,des-Gly9]AVP | 3089 | None | 0 | Human | Binding | pKi | None | - | 6.55 | -281 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr(Et)2,Lys6,des-Gly9]AVP | 3089 | None | 0 | Human | Binding | pKi | None | - | 6.55 | -281 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/11012895 | |
[Phaa1,D-Tyr(Et)2,Val4,Lys6,Tyr-NH28,des-Gly9]AVP | 3090 | None | 0 | Human | Binding | pKi | None | - | 5.70 | -707 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr(Me)2,Arg6,Tyr-NH29]AVP | 3091 | None | 0 | Human | Binding | pKi | None | - | 6.50 | -398 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phaa1,D-Tyr2,Val4,Arg6,Arg-NH29]AVP | 3092 | None | 0 | Human | Binding | pKi | None | - | 6.60 | -398 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Phe3]OT | 3106 | None | 0 | Human | Binding | pKi | None | - | 7.10 | -50 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7774575 | |
[tBaa1,D-Tyr(Et)2,Val4,Lys6,Arg-NH28,des-Gly9]AVP | 3760 | None | 0 | Human | Binding | pKi | None | - | 7.30 | -63 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
[Val4]AVP | 3970 | None | 0 | Human | Binding | pKi | None | - | 8.40 | -3 | 3 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12446593 | |
AMENTOFLAVONE | 205483 | 3H-VASOPRESSIN | 63 | Human | Binding | pKi | = | 10000.00 | 5.00 | -275 | 33 | - | PDSP KiDatabase | 538.1 | 3 | 6 | 10 | 5.13 | O=c1cc(-c2ccc(O)c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c2)oc2cc(O)cc(O)c12 | - | |
amiodarone | 398 | None | 47 | Human | Binding | AC50 | = | 27020.30 | 4.57 | - | 40 | Binding affinity towards human AVPR2 in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 645.0 | 11 | 0 | 4 | 6.94 | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
amoxapine | 403 | None | 60 | Human | Binding | AC50 | = | 23979.50 | 4.62 | - | 42 | Binding affinity towards human AVPR2 in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 313.1 | 0 | 1 | 4 | 3.43 | Clc1ccc2c(c1)C(N1CCNCC1)=Nc1ccccc1O2 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
arginine vasotocin | 466 | None | 0 | Human | Binding | pKi | = | - | 7.90 | -31 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9322919 | |
arginine vasotocin | 466 | None | 0 | Human | Binding | pKi | = | - | 7.90 | -31 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/7774575 | |
atosiban | 518 | None | 30 | Human | Binding | pKi | None | - | 5.75 | -660 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12660315 | |
atosiban | 518 | None | 30 | Human | Binding | pKi | None | - | 5.75 | -660 | 5 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/14722330 | |
Atosiban | 218972 | 3H-AVP | 0 | Human | Binding | pKi | = | 954.00 | 6.02 | -13 | 5 | - | PDSP KiDatabase | 993.4 | 18 | 11 | 15 | -3.04 | CCOc1ccc(CC2NC(=O)CCSSCC(C(=O)N3CCCC3C(=O)NC(CCCN)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C(C)O)NC(=O)C(C(C)CC)NC2=O)cc1 | - | |
Atosiban | 218972 | None | 0 | Human | Binding | pKi | = | 6.48 | 8.19 | -13 | 5 | Binding affinity to human vasopressin V2 receptor | Drug Central | 993.4 | 18 | 11 | 15 | -3.04 | CCOc1ccc(CC2NC(=O)CCSSCC(C(=O)N3CCCC3C(=O)NC(CCCN)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(C(C)O)NC(=O)C(C(C)CC)NC2=O)cc1 | - | |
atosiban | 518 | None | 30 | Human | Binding | AC50 | = | 3700.00 | 5.43 | -660 | 5 | Binding affinity towards human AVPR2 in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
atosiban | 518 | None | 30 | Human | Binding | Ki | = | 330.00 | 6.48 | -660 | 5 | Binding affinity to human vasopressin V2 receptor | ChEMBL | - | - | - | - | - | - | https://dx.doi.org/10.1016/j.bmcl.2007.11.008 | |
AVP | 218566 | 3H-AVP | 0 | Human | Binding | pKi | = | 0.78 | 9.11 | -1 | 10 | - | PDSP KiDatabase | 1083.4 | 19 | 14 | 16 | -5.40 | NC(=O)CCC1NC(=O)C(Cc2ccccc2)NC(=O)C(Cc2ccc(O)cc2)NC(=O)C(N)CSSCC(C(=O)N2CCCC2C(=O)NC(CCCN=C(N)N)C(=O)NCC(N)=O)NC(=O)C(CC(N)=O)NC1=O | - |
Showing 1 to 20 of 1,472 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
carbetocin | 797 | None | 33 | Human | Functional | EC50 | = | 1100.00 | 5.96 | -173 | 5 | Agonist activity at human V2 receptor expressed in HEK293FT cells incubated for 30 mins by beta-arrestin recruitment assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)CCCSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O | https://dx.doi.org/10.1021/acs.jmedchem.8b00697 | |
carbetocin | 797 | None | 33 | Human | Functional | EC50 | = | 6700.00 | 5.17 | -173 | 5 | Agonist activity at human V2 receptor expressed in HEK293FT cells assessed as stimulation of calcium release by Aequorin based assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(OC)cc2)NC(=O)CCCSC[C@@H](C(=O)N2CCC[C@H]2C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O | https://dx.doi.org/10.1021/acs.jmedchem.8b00697 | |
CHEMBL104839 | 4969 | None | 0 | Human | Functional | IC50 | = | 9.00 | 8.05 | 1 | 2 | Evaluated for accumulation of cAMP in transfected HEK293 cells expressing human V2 receptor (Compound 7o) | ChEMBL | 608.3 | 7 | 2 | 4 | 6.29 | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)N2CCC3(C=C(C(=O)NCCN4CCCCC4)CC3)Cc3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.04.016 | |
CHEMBL104839 | 4969 | None | 0 | Human | Functional | IC50 | = | 48.00 | 7.32 | 1 | 2 | Evaluated for accumulation of cAMP in transfected HEK293 cells expressing human vasopressin V2 receptor | ChEMBL | 608.3 | 7 | 2 | 4 | 6.29 | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)N2CCC3(C=C(C(=O)NCCN4CCCCC4)CC3)Cc3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.04.016 | |
CHEMBL106938 | 5369 | None | 0 | Human | Functional | IC50 | = | 48.00 | 7.32 | -1 | 2 | Evaluated for accumulation of cAMP in transfected HEK293 cells expressing human vasopressin V2 receptor | ChEMBL | 594.3 | 7 | 2 | 4 | 5.90 | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)N2CCC3(C=C(C(=O)NCCN4CCCC4)CC3)Cc3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.04.016 | |
CHEMBL1083703 | 6729 | None | 0 | Human | Functional | IC50 | = | 838.00 | 6.08 | -20 | 2 | Antagonist activity at human Vasopressin 2 receptor assessed as inhibition of intracellular cAMP accumulation | ChEMBL | 419.2 | 3 | 0 | 3 | 6.62 | COc1cc(C(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)ccc1-c1csc2ccccc12 | https://dx.doi.org/10.1016/j.bmcl.2010.04.068 | |
CHEMBL1090654 | 7998 | None | 0 | Human | Functional | Ki | = | 2830.00 | 5.55 | - | 2 | Antagonist activity at human cloned vasopressin V2 receptor by cell based beta-lactamase reporter gene assay | ChEMBL | 362.2 | 5 | 0 | 5 | 3.83 | CCN(C(=O)c1cnc(-c2cccc(C)c2C)cn1)c1ccc(OC)nc1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.018 | |
CHEMBL1092459 | 8265 | None | 0 | Human | Functional | Ki | = | 2300.00 | 5.64 | - | 2 | Antagonist activity at human cloned vasopressin V2 receptor by cell based beta-lactamase reporter gene assay | ChEMBL | 376.2 | 5 | 0 | 5 | 4.22 | COc1ccc(N(C(=O)c2cnc(-c3cccc(C)c3C)cn2)C(C)C)cn1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.018 | |
CHEMBL1093599 | 8436 | None | 0 | Human | Functional | Ki | = | 2400.00 | 5.62 | - | 2 | Antagonist activity at human cloned vasopressin V2 receptor by cell based beta-lactamase reporter gene assay | ChEMBL | 392.2 | 7 | 0 | 6 | 3.46 | COCCN(C(=O)c1cnc(-c2cccc(C)c2C)cn1)c1ccc(OC)nc1 | https://dx.doi.org/10.1016/j.bmcl.2010.02.018 | |
CHEMBL1186825 | 12581 | None | 0 | Human | Functional | EC50 | = | 1.25 | 8.90 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 550.2 | 5 | 1 | 4 | 5.97 | CC1CCN(c2ccc(C(=O)N3CCC(F)(F)/C(=C\C(=O)NCc4ccccn4)c4ccccc43)c(Cl)c2)C1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1186826 | 12582 | None | 0 | Human | Functional | EC50 | = | 1100.00 | 5.96 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 550.2 | 5 | 1 | 4 | 6.11 | CC1CCCN1c1ccc(C(=O)N2CCC(F)(F)/C(=C\C(=O)NCc3ccccn3)c3ccccc32)c(Cl)c1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1186831 | 12585 | None | 0 | Human | Functional | EC50 | = | 104.00 | 6.98 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 550.2 | 5 | 1 | 4 | 6.11 | O=C(/C=C1/c2ccccc2N(C(=O)c2ccc(N3CCCCC3)cc2Cl)CCC1(F)F)NCc1ccccn1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1186989 | 12614 | None | 0 | Human | Functional | EC50 | = | 61.90 | 7.21 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 533.1 | 5 | 1 | 5 | 5.31 | O=C(/C=C1/c2ccccc2N(C(=O)c2ccc(-n3cccn3)cc2Cl)CCC1(F)F)NCc1ccccn1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1187505 | 12699 | None | 0 | Human | Functional | EC50 | = | 646.00 | 6.19 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 564.2 | 5 | 1 | 4 | 6.50 | O=C(/C=C1/c2ccccc2N(C(=O)c2ccc(N3CCCCCC3)cc2Cl)CCC1(F)F)NCc1ccccn1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1187728 | 12738 | None | 0 | Human | Functional | EC50 | = | 3.13 | 8.50 | - | 1 | Agonist activity at human vasopressin V2 receptor expressed in CHO cells assessed as cAMP accumulation by HTRF assay | ChEMBL | 536.2 | 5 | 1 | 4 | 5.72 | O=C(/C=C1/c2ccccc2N(C(=O)c2ccc(N3CCCC3)cc2Cl)CCC1(F)F)NCc1ccccn1 | https://dx.doi.org/10.1016/j.bmc.2008.09.039 | |
CHEMBL1189693 | 13003 | None | 0 | Human | Functional | Ki | = | 17.00 | 7.77 | - | 2 | Inhibition of 1 nM AVP-induced cAMP accumulation in cells expressing human vasopressin V2 receptor | ChEMBL | 553.2 | 4 | 1 | 4 | 6.84 | O=C(Nc1ccc(C(=O)N2C[C@H]3CSCCN3Cc3ccccc32)c(Cl)c1)c1ccccc1-c1ccccc1 | https://dx.doi.org/10.1016/j.bmcl.2004.03.083 | |
CHEMBL128688 | 18966 | None | 0 | Human | Functional | IC50 | = | 30.00 | 7.52 | 24 | 2 | Inhibition of vasopressin induced cAMP accumulation in human V2 receptor expressing cells | ChEMBL | 536.2 | 7 | 2 | 4 | 6.98 | O=C(O)CC[C@H]1CCN(C(=O)c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2)c2ccccc2S1 | https://dx.doi.org/10.1016/j.bmcl.2003.08.051 | |
CHEMBL165670 | 57479 | None | 0 | Human | Functional | IC50 | = | 70.00 | 7.16 | -37 | 3 | Inhibitory activity of the human V2 receptor was assessed by the accumulation of cAMP in transfected HEK293 cells. | ChEMBL | 471.2 | 4 | 2 | 2 | 6.68 | O=C(Nc1ccc(C(=O)N2CCCc3c[nH]c4cccc2c34)cc1)c1ccccc1-c1ccccc1 | https://dx.doi.org/10.1016/s0960-894x(02)01059-4 | |
CHEMBL166261 | 57550 | None | 0 | Human | Functional | IC50 | = | 330.00 | 6.48 | - | 1 | Inhibitory activity of the human V2 receptor was assessed by the accumulation of cAMP in transfected HEK293 cells. | ChEMBL | 505.2 | 4 | 2 | 2 | 7.33 | O=C(Nc1ccc(C(=O)N2CCCc3c[nH]c4cccc2c34)c(Cl)c1)c1ccccc1-c1ccccc1 | https://dx.doi.org/10.1016/s0960-894x(02)01059-4 | |
CHEMBL1788220 | 63057 | None | 0 | Human | Functional | IC50 | = | 36.00 | 7.44 | -3 | 4 | Evaluated for accumulation of cAMP in transfected HEK293 cells expressing human vasopressin V2 receptor | ChEMBL | 612.3 | 8 | 2 | 4 | 6.58 | CN(C)CCNC(=O)C1=C[C@]2(CC1)CCN(C(=O)c1ccc(NC(=O)c3ccccc3-c3ccccc3)cc1)c1ccccc1C2 | https://dx.doi.org/10.1016/j.bmcl.2004.04.016 |
Showing 1 to 20 of 342 entries