Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CCL19 | 834 | None | 0 | Human | Binding | pKd | = | - | 10.00 | 39 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10512740 | |
| Ccl21b | 845 | None | 0 | Human | Binding | pKd | = | - | 9.87 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/10512740 | |
| cenicriviroc | 879 | None | 32 | Human | Binding | IC50 | = | 3.10 | 8.51 | - | 6 | Inhibition of CCR7 (unknown origin) | ChEMBL | 696.4 | 17 | 1 | 7 | 8.74 | CCCCOCCOc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc([S@@](=O)Cc4cncn4CCC)cc2)CCCN3CC(C)C)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.9b01701 | |
| CHEMBL5440411 | 197174 | None | 1 | Human | Binding | IC50 | = | 1780.00 | 5.75 | - | 2 | Competitive binding affinity to CCR7 in human U87 cells preincubated for 15 mins followed by CCL19 AF647 addition measured after 30 mins by flow cytometric analysis | ChEMBL | 310.2 | 9 | 3 | 7 | 2.21 | CCCCCCSc1nc(N[C@H](C)CO)c2nn[nH]c2n1 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| TAK-779 | 3742 | None | 8 | Human | Binding | IC50 | = | 1.40 | 8.85 | - | 5 | Inhibition of CCR7 (unknown origin) | ChEMBL | 495.3 | 6 | 1 | 2 | 6.78 | Cc1ccc(-c2ccc3c(c2)C=C(C(=O)Nc2ccc(C[N+](C)(C)C4CCOCC4)cc2)CCC3)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.9b01701 | |
Showing 1 to 5 of 5 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CCL19 | 834 | None | 0 | Human | Functional | pIC50 | = | - | 8.35 | -2 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9153236 | |
| CCL19 | 834 | None | 0 | Human | Functional | pIC50 | = | - | 8.35 | -2 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9507024 | |
| CCL19 | 834 | None | 0 | Human | Functional | pIC50 | = | - | 8.35 | -2 | 4 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16904643 | |
| CCL21 | 843 | None | 0 | Human | Functional | pIC50 | = | - | 9.30 | 12 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/9507024 | |
| Ccl21b | 845 | None | 0 | Human | Functional | pIC50 | = | - | 8.33 | - | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/16904643 | |
| CHEMBL4245355 | 165789 | None | 0 | Human | Functional | IC50 | = | 18000.00 | 4.75 | -1862 | 3 | Inhibition of human CCR7 expressed in CHO cells assessed as decrease in CCL19-induced reduction of forskolin-stimulated cAMP accumulation preincubated for 30 mins followed agonist addition measured after 30 mins by HTRF assay | ChEMBL | 504.1 | 6 | 2 | 6 | 4.46 | NC(=O)c1ccc(-c2ccc(S(=O)(=O)[C@H]3CC[C@H](Nc4ccc(C(F)(F)F)cn4)CC3)cc2)cn1 | https://dx.doi.org/10.1016/j.bmcl.2018.07.042 | |
| CHEMBL4248604 | 165922 | None | 19 | Human | Functional | IC50 | = | 9400.00 | 5.03 | -20892 | 3 | Inhibition of human CCR7 expressed in CHO cells assessed as decrease in CCL19-induced reduction of forskolin-stimulated cAMP accumulation preincubated for 30 mins followed agonist addition measured after 30 mins by HTRF assay | ChEMBL | 504.1 | 6 | 2 | 6 | 4.46 | NC(=O)c1cc(-c2ccc(S(=O)(=O)[C@H]3CC[C@H](Nc4ccc(C(F)(F)F)cn4)CC3)cc2)ccn1 | https://dx.doi.org/10.1016/j.bmcl.2018.07.042 | |
| CHEMBL5173775 | 190266 | None | 3 | Human | Functional | IC50 | = | 2430.00 | 5.61 | -14 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 352.1 | 6 | 3 | 7 | 2.11 | C[C@H](CO)Nc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5195797 | 191744 | None | 3 | Human | Functional | IC50 | = | 16920.00 | 4.77 | -478 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 352.1 | 6 | 2 | 7 | 2.98 | C[C@H](CO)Nc1nc(SCc2cccc(F)c2F)nc2oncc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5394402 | 194981 | None | 0 | Human | Functional | IC50 | = | 1680.00 | 5.78 | 3 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 336.2 | 7 | 3 | 7 | 2.60 | C[C@H](CO)Nc1nc(SCCC2CCCCC2)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5397416 | 195146 | None | 0 | Human | Functional | IC50 | = | 23780.00 | 4.62 | -5 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 336.1 | 6 | 3 | 7 | 1.40 | C[C@H](CO)Nc1nc(OCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5405321 | 195522 | None | 0 | Human | Functional | IC50 | = | 5560.00 | 5.25 | -28 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 366.1 | 7 | 3 | 7 | 2.50 | CC[C@H](CO)Nc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5407300 | 195622 | None | 0 | Human | Functional | IC50 | = | 2290.00 | 5.64 | -5 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 366.1 | 6 | 3 | 7 | 2.50 | CC(C)(CO)Nc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5409317 | 195701 | None | 0 | Human | Functional | IC50 | = | 17200.00 | 4.76 | -1 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 352.1 | 7 | 2 | 7 | 2.38 | COCCNc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5409489 | 195717 | None | 0 | Human | Functional | IC50 | = | 8490.00 | 5.07 | -3 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 310.2 | 8 | 3 | 7 | 2.07 | CCCC(C)CSc1nc(N[C@H](C)CO)c2nn[nH]c2n1 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5409816 | 195735 | None | 0 | Human | Functional | IC50 | = | 5280.00 | 5.28 | 2 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 324.2 | 9 | 3 | 7 | 2.46 | CC(C)CCCCSc1nc(N[C@H](C)CO)c2nn[nH]c2n1 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5411165 | 195812 | None | 0 | Human | Functional | IC50 | = | 6710.00 | 5.17 | -2 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 308.1 | 6 | 3 | 7 | 1.82 | C[C@H](CO)Nc1nc(SCC2CCCC2)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5411713 | 195840 | None | 0 | Human | Functional | IC50 | = | 5810.00 | 5.24 | -1 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 355.0 | 6 | 2 | 7 | 2.40 | OCCSc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5415154 | 196016 | None | 0 | Human | Functional | IC50 | = | 29300.00 | 4.53 | - | 1 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 312.1 | 9 | 3 | 8 | 1.06 | CCCOCCSc1nc(N[C@H](C)CO)c2nn[nH]c2n1 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
| CHEMBL5415857 | 196054 | None | 0 | Human | Functional | IC50 | = | 8660.00 | 5.06 | -2 | 2 | Antagonist activity at CCR7 in human CD4 cells by fluorescence based calcium mobilization assay | ChEMBL | 338.1 | 6 | 3 | 7 | 1.72 | OCCNc1nc(SCc2cccc(F)c2F)nc2[nH]nnc12 | https://dx.doi.org/10.1016/j.ejmech.2023.115240 | |
Showing 1 to 20 of 29 entries