Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL204419 | 75569 | None | 0 | Human | Binding | Ki | = | 15.00 | 7.82 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 531.3 | 8 | 1 | 4 | 6.27 | CCN1CCC(C(=O)NC2CCN(Cc3cccc(Oc4ccccc4Cl)c3)CC2)(c2ccccc2)CC1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205304 | 75997 | None | 0 | Human | Binding | Ki | = | 9100.00 | 5.04 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 338.2 | 6 | 1 | 3 | 3.83 | CCNC(=O)C1CCN(Cc2cccc(Oc3ccccc3)c2)CC1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205447 | 76013 | None | 0 | Human | Binding | Ki | = | 62.00 | 7.21 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 499.3 | 8 | 2 | 5 | 4.89 | COc1ccccc1Oc1cccc(CN2CCC(NC(=O)C3(c4ccccc4)CCNCC3)CC2)c1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205457 | 76017 | None | 0 | Human | Binding | Ki | = | 250.00 | 6.60 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 532.2 | 8 | 1 | 4 | 7.12 | COc1ccccc1Oc1cccc(CN2CCC(NC(=O)C3(c4ccc(Cl)cc4)CCCCC3)CC2)c1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205692 | 76062 | None | 0 | Human | Binding | Ki | = | 1400.00 | 5.85 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 400.2 | 7 | 1 | 3 | 4.80 | O=C(Cc1ccccc1)NC1CCN(Cc2cccc(Oc3ccccc3)c2)CC1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205808 | 76218 | None | 4 | Human | Binding | Ki | = | 2600.00 | 5.58 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 339.2 | 6 | 0 | 4 | 4.25 | CCOC(=O)C1CCN(Cc2cccc(Oc3ccccc3)c2)CC1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL205993 | 76543 | None | 0 | Human | Binding | Ki | = | 6.00 | 8.22 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 575.3 | 9 | 2 | 5 | 5.72 | CC(C)(C(=O)O)N1CCC(C(=O)NC2CCN(Cc3cccc(Oc4ccccc4Cl)c3)CC2)(c2ccccc2)C1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL209350 | 77905 | None | 0 | Human | Binding | Ki | = | 11.00 | 7.96 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 527.3 | 9 | 1 | 5 | 5.62 | CCN1CCC(C(=O)NC2CCN(Cc3cccc(Oc4ccccc4OC)c3)CC2)(c2ccccc2)CC1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL210322 | 78155 | None | 0 | Human | Binding | Ki | = | 250.00 | 6.60 | - | 1 | Displacement of [125I]I309 from human CCR8 expressed in L1.2 cells | ChEMBL | 430.2 | 8 | 1 | 4 | 4.81 | COc1ccccc1Oc1cccc(CN2CCC(NC(=O)Cc3ccccc3)CC2)c1 | https://dx.doi.org/10.1021/jm050965z | |
CHEMBL217979 | 82803 | None | 0 | Human | Binding | Ki | = | 50.90 | 7.29 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 465.2 | 7 | 2 | 4 | 3.69 | CCCC(=O)N1CC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C)c3ccccc23)C1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218036 | 82856 | None | 0 | Human | Binding | Ki | = | 5.40 | 8.27 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 481.2 | 6 | 3 | 5 | 2.66 | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC2CCN(C(=O)CO)CC2)c2ccccc12 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218037 | 82857 | None | 0 | Human | Binding | Ki | = | 2.30 | 8.64 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 481.2 | 6 | 2 | 5 | 3.99 | CCOC(=O)N1CCC(NS(=O)(=O)c2cccc3c(NC(=O)c4ccccc4)cccc23)CC1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218207 | 83174 | None | 6 | Human | Binding | Ki | = | 7745.00 | 5.11 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 396.1 | 4 | 1 | 4 | 3.11 | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)c2ccccc12)c1ccccc1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218218 | 83179 | None | 0 | Human | Binding | Ki | = | 6.30 | 8.20 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 536.2 | 5 | 2 | 5 | 3.60 | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC2CCN(C(=O)N3CCOCC3)CC2)c2ccccc12 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218350 | 83204 | None | 0 | Human | Binding | Ki | = | 77.70 | 7.11 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 508.2 | 6 | 3 | 4 | 4.26 | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC2CCN(C(=O)NC(C)C)CC2)c2ccccc12 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218366 | 83208 | None | 0 | Human | Binding | Ki | = | 71.00 | 7.15 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 578.3 | 9 | 2 | 6 | 3.78 | Cc1ccccc1C(=O)Nc1ccc(S(=O)(=O)NC2CCN(C(=O)CCCN3CCOCC3)CC2)c2ccccc12 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218374 | 83211 | None | 0 | Human | Binding | Ki | = | 0.17 | 9.77 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 481.2 | 6 | 2 | 5 | 3.99 | CCOC(=O)N1CCC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3)c3ccccc23)CC1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218375 | 83212 | None | 11 | Human | Binding | Ki | = | 1.60 | 8.80 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 495.2 | 6 | 2 | 5 | 4.30 | CCOC(=O)N1CCC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C)c3ccccc23)CC1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL218503 | 83233 | None | 0 | Human | Binding | Ki | = | 4.40 | 8.36 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 408.2 | 5 | 2 | 3 | 4.70 | O=C(Nc1ccc(S(=O)(=O)NC2CCCCC2)c2ccccc12)c1ccccc1 | https://dx.doi.org/10.1021/jm061118e | |
CHEMBL219327 | 83393 | None | 0 | Human | Binding | Ki | = | 34.30 | 7.46 | - | 1 | Binding affinity to human CCR8 expressed in L1.2 cells by FMAT assay | ChEMBL | 479.2 | 7 | 2 | 4 | 4.08 | CCCC(=O)N1CCC(NS(=O)(=O)c2ccc(NC(=O)c3ccccc3C)c3ccccc23)C1 | https://dx.doi.org/10.1021/jm061118e |
Showing 1 to 20 of 106 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |