Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL2349179 | 88384 | None | 0 | Human | Binding | Ki | = | 6.20 | 8.21 | 181 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 438.1 | 8 | 3 | 9 | 4.39 | CC(C)C[C@H](CO)Nc1nc(S[C@@H](C)c2cc(Cl)ccn2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349180 | 88385 | None | 0 | Human | Binding | Ki | = | 5.80 | 8.24 | 85 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 439.1 | 8 | 3 | 8 | 4.10 | CC(C)C[C@H](CO)Nc1nc(S[C@@H](C)c2cc(Cl)ccn2)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349181 | 88386 | None | 0 | Human | Binding | Ki | = | 21.00 | 7.68 | 10 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 425.1 | 8 | 3 | 8 | 3.85 | CCC[C@H](CO)Nc1nc(S[C@@H](C)c2cnccc2Cl)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349182 | 88387 | None | 0 | Human | Binding | Ki | = | 18.00 | 7.75 | 19 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 403.1 | 9 | 3 | 8 | 3.82 | CC(C)C[C@H](CO)Nc1nc(SCCc2ccccc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349183 | 88388 | None | 0 | Human | Binding | Ki | = | 110.00 | 6.96 | 4 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 417.2 | 10 | 3 | 8 | 4.21 | CC(C)C[C@H](CO)Nc1nc(SCCCc2ccccc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349184 | 88389 | None | 0 | Human | Binding | Ki | = | 110.00 | 6.96 | -1 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 422.1 | 8 | 3 | 8 | 2.17 | CC(C)C[C@H](CO)Nc1nc(S(=O)(=O)Cc2ccccc2)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349185 | 88390 | None | 0 | Human | Binding | Ki | = | 280.00 | 6.55 | 1 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 406.1 | 8 | 3 | 7 | 2.51 | CC(C)C[C@H](CO)Nc1nc([S+]([O-])Cc2ccccc2)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349186 | 88391 | None | 0 | Human | Binding | Ki | = | 44.00 | 7.36 | 13 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 374.1 | 8 | 3 | 7 | 2.78 | CC(C)C[C@H](CO)Nc1nc(OCc2ccccc2)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349187 | 88392 | None | 0 | Human | Binding | Ki | = | 1200.00 | 5.92 | - | 1 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 417.2 | 8 | 3 | 8 | 4.56 | CC(C)C[C@@H](Nc1nc(SCc2ccccc2)nc2nc(N)sc12)C(C)(C)O | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349301 | 88398 | None | 0 | Human | Binding | Ki | = | 91.00 | 7.04 | - | 1 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 437.1 | 9 | 3 | 8 | 4.82 | CC(C)C[C@H](CCO)Nc1nc(SCc2ccccc2Cl)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349302 | 88399 | None | 0 | Human | Binding | Ki | = | 43.00 | 7.37 | 97 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 451.1 | 8 | 2 | 9 | 4.61 | COC(=O)[C@@H](CC(C)C)Nc1nc(SCc2ccccc2Cl)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349303 | 88400 | None | 0 | Human | Binding | Ki | = | 8.30 | 8.08 | 234 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 417.1 | 8 | 2 | 9 | 3.96 | COC(=O)[C@@H](CC(C)C)Nc1nc(SCc2ccccc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349304 | 88401 | None | 0 | Human | Binding | Ki | = | 220.00 | 6.66 | 10 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 402.1 | 8 | 3 | 8 | 3.27 | CC(C)C[C@@H](Nc1nc(SCc2ccccc2)nc2nc(N)sc12)C(N)=O | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349305 | 88402 | None | 0 | Human | Binding | Ki | = | 320.00 | 6.50 | 18 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 403.1 | 8 | 3 | 8 | 3.87 | CC(C)C[C@@H](Nc1nc(SCc2ccccc2)nc2nc(N)sc12)C(=O)O | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349306 | 88403 | None | 0 | Human | Binding | Ki | = | 10.00 | 8.00 | -2 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 426.1 | 8 | 3 | 7 | 3.77 | CC(C)C[C@H](CO)Nc1nc(SCc2cccc(F)c2F)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349307 | 88404 | None | 0 | Human | Binding | Ki | = | 360.00 | 6.44 | -5 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 390.1 | 8 | 3 | 9 | 3.17 | CC(C)C[C@H](CO)Nc1nc(SCc2ccccn2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349308 | 88405 | None | 0 | Human | Binding | Ki | = | 670.00 | 6.17 | 7 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 390.1 | 8 | 3 | 9 | 3.17 | CC(C)C[C@H](CO)Nc1nc(SCc2cccnc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349309 | 88406 | None | 0 | Human | Binding | Ki | = | 900.00 | 6.05 | 10 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 390.1 | 8 | 3 | 9 | 3.17 | CC(C)C[C@H](CO)Nc1nc(SCc2ccncc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349310 | 88408 | None | 36 | Human | Binding | Ki | = | 3.90 | 8.41 | 33 | 3 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 403.1 | 8 | 3 | 8 | 4.34 | CC(C)C[C@H](CO)Nc1nc(S[C@@H](C)c2ccccc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
| CHEMBL2349311 | 88409 | None | 0 | Human | Binding | Ki | = | 18.00 | 7.75 | 117 | 2 | Displacement of [125I]-CX3CL1 from human CX3CR1 transfected in HEK293 cells after 24 hrs by scintillation counting analysis | ChEMBL | 403.1 | 8 | 3 | 8 | 4.34 | CC(C)C[C@H](CO)Nc1nc(S[C@H](C)c2ccccc2)nc2nc(N)sc12 | https://dx.doi.org/10.1021/jm3012273 | |
Showing 1 to 20 of 64 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| A77636 | 208 | None | 8 | Human | Functional | IC50 | = | 1575.75 | 5.80 | -524 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 329.2 | 2 | 3 | 4 | 3.25 | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL3310783 | 113020 | None | 15 | Human | Functional | EC50 | = | 1424.24 | 5.85 | -18 | 3 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 319.1 | 4 | 1 | 5 | 3.50 | N#Cc1c(O)nc(SCc2cccc(F)c2F)nc1C1CC1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL3819292 | 140924 | None | 26 | Human | Functional | EC50 | = | 385.94 | 6.41 | -19 | 2 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 408.9 | 3 | 4 | 4 | 3.64 | NS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2cccc(Cl)c2Cl)c1O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL403225 | 155430 | None | 19 | Human | Functional | EC50 | = | 307.81 | 6.51 | -309 | 3 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 400.0 | 6 | 3 | 7 | 3.26 | C[C@H](CO)Nc1nc(SCc2cccc(Cl)c2F)nc2[nH]c(=O)sc12 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CX3CL1 | 1270 | None | 0 | Human | Functional | pIC50 | = | - | 8.90 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/14607932 | |
| danirixin | 1316 | None | 38 | Human | Functional | EC50 | = | 800.53 | 6.10 | -85 | 2 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 441.1 | 4 | 4 | 5 | 3.66 | Cc1c(F)cccc1NC(=O)Nc1ccc(Cl)c(S(=O)(=O)[C@H]2CCCNC2)c1O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| DIFLUOROBENZTROPINE | 107426 | None | 4 | Human | Functional | IC50 | = | 3341.56 | 5.48 | 1 | 19 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 343.2 | 4 | 0 | 2 | 4.70 | CN1C2CCC1CC(OC(c1ccc(F)cc1)c1ccc(F)cc1)C2 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| elagolix | 1545 | None | 35 | Human | Functional | EC50 | = | 9206.41 | 5.04 | -2511 | 9 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 631.2 | 12 | 2 | 7 | 5.54 | COc1cccc(-c2c(C)n(Cc3c(F)cccc3C(F)(F)F)c(=O)n(C[C@H](NCCCC(=O)O)c3ccccc3)c2=O)c1F | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| fluoxetine | 1658 | None | 52 | Human | Functional | IC50 | = | 3001.59 | 5.52 | -25 | 44 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 309.1 | 6 | 1 | 2 | 4.43 | CNCCC(Oc1ccc(C(F)(F)F)cc1)c1ccccc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| JMS-17-2 | 2119 | None | 40 | Human | Functional | pIC50 | = | - | 9.49 | 4 | 3 | Measuring the inhibition of FKN-stimulated ERK1/2 phosphorylation. | Guide to Pharmacology | 419.2 | 5 | 0 | 4 | 5.18 | O=c1c2cccn2c2ccccc2n1CCCN1CCC(c2ccc(Cl)cc2)CC1 | https://pubmed.ncbi.nlm.nih.gov/27001765 | |
| JMS-17-2 | 2119 | None | 40 | Human | Functional | IC50 | = | 3932.99 | 5.41 | 4 | 3 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 419.2 | 5 | 0 | 4 | 5.18 | O=c1c2cccn2c2ccccc2n1CCCN1CCC(c2ccc(Cl)cc2)CC1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| JTC-801 | 2154 | None | 25 | Human | Functional | IC50 | = | 2597.49 | 5.58 | -87 | 30 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 411.2 | 6 | 2 | 4 | 5.52 | CCc1ccc(OCc2ccccc2C(=O)Nc2ccc3nc(C)cc(N)c3c2)cc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| NCGC 84 | 2748 | None | 1 | Human | Functional | IC50 | = | 6124.84 | 5.21 | -724 | 24 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 465.2 | 6 | 0 | 2 | 5.00 | Cc1c(P(=S)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C/C=C/c1ccccc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| perphenazine | 3057 | None | 57 | Human | Functional | IC50 | = | 2949.10 | 5.53 | -1288 | 38 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 403.1 | 6 | 1 | 5 | 3.94 | OCCN1CCN(CCCN2c3ccccc3Sc3ccc(Cl)cc32)CC1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| PF-514273 | 3068 | None | 31 | Human | Functional | EC50 | = | 17564.20 | 4.75 | -32 | 10 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 451.1 | 4 | 0 | 4 | 5.34 | CC(F)(F)CN1CCOc2c(nn(-c3ccccc3Cl)c2-c2ccc(Cl)cc2)C1=O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| pimavanserin | 3124 | None | 53 | Human | Functional | IC50 | = | 3258.17 | 5.49 | -218 | 16 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 427.3 | 8 | 1 | 3 | 4.67 | CC(C)COc1ccc(CNC(=O)N(Cc2ccc(F)cc2)C2CCN(C)CC2)cc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| salmeterol | 3463 | None | 53 | Human | Functional | IC50 | = | 3138.60 | 5.50 | -5623 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 415.3 | 16 | 4 | 5 | 4.11 | OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| SB 271046 | 3513 | None | 37 | Human | Functional | IC50 | = | 3831.60 | 5.42 | -1905 | 24 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 451.1 | 5 | 2 | 6 | 4.08 | COc1ccc(NS(=O)(=O)c2sc3ccc(Cl)cc3c2C)cc1N1CCNCC1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| SCH-23390 | 205211 | None | 16 | Human | Functional | EC50 | = | 3833.90 | 5.42 | -9549 | 35 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 287.1 | 1 | 1 | 2 | 3.67 | CN1CCc2cc(Cl)c(O)cc2[C@@H](c2ccccc2)C1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| SSR240612 | 3680 | None | 7 | Human | Functional | IC50 | = | 2142.54 | 5.67 | 1 | 17 | GPCR PRESTO-Tango dose-response in antagonist mode with target: CX3CR1 | ChEMBL | 756.4 | 14 | 2 | 8 | 6.34 | COc1ccc2cc(S(=O)(=O)N[C@H](CC(=O)N[C@H](Cc3ccc(CN4[C@@H](C)CCC[C@H]4C)cc3)C(=O)N(C)C(C)C)c3ccc4c(c3)OCO4)ccc2c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
Showing 1 to 20 of 22 entries