Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL2216803 | 84371 | None | 0 | Human | Binding | EC50 | = | 1.00 | 9.00 | - | 1 | Allosteric activation of human FSH receptor | ChEMBL | 653.2 | 10 | 2 | 6 | 5.75 | COc1ccc(CCNC(=O)C[C@H]2S[C@@H](c3ccc(C#Cc4ccccc4)cc3)N(c3ccc(C(N)=O)c(Cl)c3)C2=O)cc1OC | https://dx.doi.org/10.1016/j.bmc.2012.03.069 | |
CHEMBL3263667 | 111198 | None | 0 | Human | Binding | EC50 | = | 100.00 | 7.00 | - | 1 | Positive allosteric modulation of human FSHR expressed in rat granulocytes assessed as FSH-induced estradiol production after 72 hrs by radioimmunossay | ChEMBL | 570.3 | 10 | 2 | 7 | 4.18 | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCN3CCCC3=O)cc2NC(=O)c2coc(C3CC3)n2)CC1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00082 | |
CHEMBL3263691 | 111203 | None | 0 | Human | Binding | EC50 | = | 100.00 | 7.00 | - | 1 | Positive allosteric modulation of human FSHR expressed in rat granulocytes assessed as FSH-induced estradiol production after 72 hrs by radioimmunossay | ChEMBL | 555.3 | 10 | 3 | 9 | 3.31 | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCc3nn[nH]n3)cc2NC(=O)c2coc(C3CC3)n2)CC1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00082 | |
CHEMBL3809148 | 140518 | None | 0 | Human | Binding | EC50 | = | 100.00 | 7.00 | - | 1 | Positive allosteric modulation of human FSHR expressed in rat granulocytes assessed as FSH-induced estradiol production after 72 hrs by radioimmunossay | ChEMBL | 557.3 | 9 | 2 | 5 | 4.46 | Cc1ccccc1N1CCN(c2ccc(C(=O)NCCCN3CCCC3=O)cc2NC(=O)c2ccc(F)cc2)CC1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00082 | |
CHEMBL4780505 | 182103 | None | 0 | Human | Binding | IC50 | = | 8030.00 | 5.09 | - | 2 | Antagonist activity at human FSHR expressed in CHO-K1 cells by PathHunter beta-arrestin assay | ChEMBL | 565.2 | 4 | 2 | 6 | 5.09 | COC(=O)[C@H]1[C@@H](O)CC[C@H]2CN(C#N)CCc3c([nH]c4ccccc34)[C@H](OCc3ccc(Br)cc3)C[C@@H]21 | https://dx.doi.org/10.1016/j.bmc.2020.115546 | |
CHEMBL5267037 | 193615 | None | 0 | Human | Binding | IC50 | = | 1440.00 | 5.84 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 439.2 | 4 | 1 | 3 | 5.65 | CC(=O)N1c2ncc(NC(=O)CCc3cccc(Cl)c3)cc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5267043 | 193617 | None | 0 | Human | Binding | IC50 | = | 156.00 | 6.81 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 476.2 | 3 | 1 | 5 | 4.96 | CC(=O)N1c2cnc(NC(=O)OCC3(C(F)(F)F)CC3)nc2C2(CCC(F)(F)CC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5267166 | 193619 | None | 0 | Human | Binding | IC50 | = | 6000.00 | 5.22 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 440.2 | 3 | 1 | 3 | 6.44 | CC(=O)N1c2ccc(NC(=O)OCc3cccc(Cl)c3)cc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5268512 | 193677 | None | 0 | Human | Binding | IC50 | = | 5670.00 | 5.25 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 387.3 | 2 | 1 | 4 | 5.02 | CC(=O)N1c2ncc(NC(=O)OCC(C)(C)C)cc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5268829 | 193688 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 410.2 | 1 | 1 | 5 | 4.42 | CC(=O)N1c2cnc(NC(=O)OC(C)(C)C)nc2C2(CCC(F)(F)CC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5270266 | 193735 | None | 0 | Human | Binding | IC50 | = | 214.00 | 6.67 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 408.2 | 3 | 1 | 5 | 4.57 | CC(=O)N1c2cnc(NC(=O)OCc3ccccc3)nc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5270771 | 193758 | None | 0 | Human | Binding | IC50 | = | 1750.00 | 5.76 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 478.2 | 3 | 1 | 5 | 5.47 | CC(=O)N1c2cnc(NC(=O)OCc3cccc(Cl)c3)nc2C2(CCC(F)(F)CC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5271120 | 193778 | None | 0 | Human | Binding | IC50 | = | 2550.00 | 5.59 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 386.3 | 2 | 1 | 3 | 5.63 | CC(=O)N1c2ccc(NC(=O)OCC(C)(C)C)cc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5273361 | 193867 | None | 0 | Human | Binding | IC50 | = | 322.00 | 6.49 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 424.2 | 4 | 1 | 2 | 5.87 | CC(=O)N1c2ccc(NC(=O)CCc3cccc(Cl)c3)cc2C2(CCCCC2)C1C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5275140 | 193949 | None | 0 | Human | Binding | IC50 | = | 606.00 | 6.22 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 438.2 | 3 | 1 | 5 | 5.05 | CC(=O)N1c2cnc(NC(=O)OC(C)(C)C(C)C)nc2C2(CCC(F)(F)CC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5275472 | 193965 | None | 0 | Human | Binding | IC50 | = | 912.00 | 6.04 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 424.2 | 2 | 1 | 5 | 4.66 | CC(=O)N1c2cnc(NC(=O)OCC(C)(C)C)nc2C2(CCC(F)(F)CC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5275619 | 193975 | None | 0 | Human | Binding | IC50 | = | 432.00 | 6.37 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 388.2 | 2 | 1 | 5 | 4.42 | CC(=O)N1c2cnc(NC(=O)OCC(C)(C)C)nc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5279687 | 194145 | None | 0 | Human | Binding | IC50 | = | 466.00 | 6.33 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 440.2 | 4 | 1 | 4 | 5.05 | CC(=O)N1c2cnc(NC(=O)CCc3cccc(Cl)c3)nc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5280508 | 194181 | None | 0 | Human | Binding | IC50 | = | 458.00 | 6.34 | - | 3 | Antagonist activity at human FSHR expressed in HEK293 cells assessed as reduction in cAMP production incubated for 2 hrs by Eu-cAMP tracer based TR-FRET assay | ChEMBL | 438.2 | 4 | 1 | 2 | 6.26 | CC(=O)N1c2ccc(NC(=O)CCc3cccc(Cl)c3)cc2C2(CCCCC2)C1(C)C | https://dx.doi.org/10.1016/j.bmc.2023.117258 | |
CHEMBL5281228 | 194216 | None | 0 | Human | Binding | IC50 | = | 17.00 | 7.77 | - | 2 | Allosteric antagonist activity at human FSHR expressed in CHO cells assessed as inhibition of FSH-induced activity incubated for 4 hrs by CRE-luciferase assay | ChEMBL | 480.2 | 5 | 1 | 2 | 6.34 | CC(=O)N1CCC(C)(c2ccccc2)c2cc(NC(=O)CCc3cccc(C(F)(F)F)c3)ccc21 | https://dx.doi.org/10.1016/j.bmc.2023.117258 |
Showing 1 to 20 of 30 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1555290 | 48423 | None | 1 | Human | Functional | Potency | = | 5011.90 | 5.30 | -158 | 2 | PUBCHEM_BIOASSAY: Counterscreen for Agonists of Thyroid Stimulating Hormone Receptor: HTRF Activity in a Follicle Stimulating Hormone Receptor Cell Line. (Class of assay: confirmatory) [Related pubchem assays: 926, 939, 933, 938, 953 ] | ChEMBL | 459.2 | 7 | 3 | 8 | 1.64 | NC(=O)c1nsc(C(=O)N(CC(=O)NC2CCCCC2)Cc2ccc3c(c2)OCO3)c1N | - | |
CHEMBL1651721 | 57382 | None | 0 | Human | Functional | EC50 | = | 126.00 | 6.90 | -125 | 2 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 482.2 | 7 | 4 | 8 | 3.35 | C#CCNC(=O)CNc1cccc(-c2nc(SC)nc3sc(C(=O)NC(C)(C)C)c(N)c23)c1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651722 | 57383 | None | 0 | Human | Functional | IC50 | = | 39.00 | 7.41 | - | 1 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as inhibition of FSH-induced luciferase activity by CRE-driven luciferase reporter gene assay relative to control | ChEMBL | 542.3 | 6 | 1 | 3 | 7.46 | C#CCOc1ccc([C@@]2(C)CC(C)(C)N(C(C)=O)c3ccc(NC(=O)c4ccc(-c5ccccc5)cc4)cc32)cc1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651824 | 57396 | None | 0 | Human | Functional | IC50 | = | 920.00 | 6.04 | -21 | 2 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as inhibition of FSH-induced luciferase activity by CRE-driven luciferase reporter gene assay relative to control | ChEMBL | 1224.5 | 24 | 5 | 19 | 10.18 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651825 | 57397 | None | 0 | Human | Functional | IC50 | = | 1662.00 | 5.78 | -26 | 2 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as inhibition of FSH-induced luciferase activity by CRE-driven luciferase reporter gene assay relative to control | ChEMBL | 1268.5 | 27 | 5 | 20 | 10.19 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651826 | 57398 | None | 0 | Human | Functional | IC50 | = | 1023.00 | 5.99 | -18 | 2 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as inhibition of FSH-induced luciferase activity by CRE-driven luciferase reporter gene assay relative to control | ChEMBL | 1312.6 | 30 | 5 | 21 | 10.21 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCOCCOCCn4cc(COc5ccc([C@@]6(C)CC(C)(C)N(C(C)=O)c7ccc(NC(=O)c8ccc(-c9ccccc9)cc8)cc76)cc5)nn4)nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651827 | 57399 | None | 0 | Human | Functional | IC50 | = | 324.00 | 6.49 | - | 1 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as inhibition of FSH-induced luciferase activity by CRE-driven luciferase reporter gene assay relative to control | ChEMBL | 742.4 | 16 | 1 | 9 | 7.96 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2[C@@](C)(c2ccc(OCc3cn(CCOCCOCCN=[N+]=[N-])nn3)cc2)CC1(C)C | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL1651828 | 57400 | None | 0 | Human | Functional | EC50 | = | 397.00 | 6.40 | -79 | 2 | Agonist activity at human FSHR receptor expressed in CHO-K1 cells assessed as stimulation of luciferase activity by CRE-driven luciferase reporter gene assay | ChEMBL | 682.3 | 17 | 4 | 14 | 3.85 | CSc1nc(-c2cccc(NCC(=O)NCc3cn(CCOCCOCCN=[N+]=[N-])nn3)c2)c2c(N)c(C(=O)NC(C)(C)C)sc2n1 | https://dx.doi.org/10.1021/ml100229v | |
CHEMBL178980 | 63184 | None | 0 | Human | Functional | IC50 | = | 31.00 | 7.51 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 446.2 | 3 | 1 | 2 | 6.43 | CC(=O)N1c2ccc(NC(=O)c3ccc(Cl)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL179505 | 63382 | None | 0 | Human | Functional | IC50 | = | 76.00 | 7.12 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 422.3 | 4 | 1 | 3 | 5.28 | CC(=O)N1c2ccc(NC(=O)COC(C)(C)C)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192135 | 68701 | None | 0 | Human | Functional | IC50 | = | 28.00 | 7.55 | 51 | 2 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 488.2 | 4 | 1 | 2 | 7.45 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192135 | 68701 | None | 0 | Human | Functional | IC50 | = | 10.00 | 8.00 | 51 | 2 | In vitro inhibition of maximum response evoked by cAMP on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 488.2 | 4 | 1 | 2 | 7.45 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192135 | 68701 | None | 0 | Human | Functional | IC50 | = | 4.00 | 8.40 | 51 | 2 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 488.2 | 4 | 1 | 2 | 7.45 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192135 | 68701 | None | 0 | Rat | Functional | IC50 | = | 540.00 | 6.27 | -51 | 2 | In vitro inhibition against maximum response evoked by cAMP in rat GFSHR-17 granulosa cell line | ChEMBL | 488.2 | 4 | 1 | 2 | 7.45 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192334 | 69028 | None | 0 | Human | Functional | IC50 | = | 54.00 | 7.27 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 489.2 | 4 | 0 | 3 | 7.41 | CC(=O)N1c2ccc(OC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL192868 | 69346 | None | 0 | Human | Functional | IC50 | = | 30.00 | 7.52 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 518.3 | 5 | 1 | 3 | 7.46 | COc1cc(NC(=O)c2ccc(-c3ccccc3)cc2)cc2c1N(C(C)=O)C(C)(C)CC2(C)c1ccccc1 | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL194996 | 70648 | None | 0 | Human | Functional | IC50 | = | 930.00 | 6.03 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 454.3 | 4 | 1 | 2 | 7.44 | CC(=O)N1c2ccc(NCc3ccc(C(C)(C)C)cc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL195321 | 71114 | None | 0 | Human | Functional | IC50 | = | 1880.00 | 5.73 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 470.3 | 6 | 1 | 3 | 5.51 | COc1ccc(CCNC(=O)c2ccc3c(c2)C(C)(c2ccccc2)CC(C)(C)N3C(C)=O)cc1 | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL195347 | 71119 | None | 0 | Human | Functional | IC50 | = | 50.00 | 7.30 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 502.3 | 4 | 1 | 2 | 7.76 | CC(=O)N1c2ccc(NC(=O)c3ccc(-c4ccccc4)cc3)cc2C(C)(c2ccc(C)cc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l | |
CHEMBL195469 | 71146 | None | 0 | Human | Functional | IC50 | = | 25.00 | 7.60 | - | 1 | In vitro inhibition of maximum response on CHO-K1 cells expressing human Follicle stimulating hormone receptor | ChEMBL | 488.2 | 4 | 1 | 2 | 7.45 | CC(=O)N1c2ccc(NC(=O)c3ccccc3-c3ccccc3)cc2C(C)(c2ccccc2)CC1(C)C | https://dx.doi.org/10.1021/jm049676l |
Showing 1 to 20 of 80 entries