Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL459142 | 176203 | None | 0 | Human | Binding | Ki | = | 71162.00 | 4.15 | -15 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membrane | ChEMBL | 477.2 | 10 | 3 | 10 | 1.03 | CCc1ccc(Cn2c(=O)nc(NCCNC3=NCCN3)n(Cc3ccc(OC)cc3)c2=O)cc1 | https://dx.doi.org/10.1021/jm800854e | |
| CHEMBL514895 | 189732 | None | 0 | Human | Binding | Ki | = | 23422.00 | 4.63 | -53 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membrane | ChEMBL | 409.2 | 9 | 2 | 8 | 1.44 | CCc1ccc(Cn2c(=O)nc(NCCN)n(Cc3ccc(OC)cc3)c2=O)cc1 | https://dx.doi.org/10.1021/jm800854e | |
| triazine compound PC1 | 3856 | None | 0 | Human | Binding | pKi | = | - | 5.79 | -74 | 2 | Unclassified | Guide to Pharmacology | 451.2 | 10 | 3 | 8 | 0.76 | CCc1ccc(Cn2c(=O)nc(NCCN=C(N)N)n(Cc3ccc(OC)cc3)c2=O)cc1 | https://pubmed.ncbi.nlm.nih.gov/19006379 | |
| triazine compound PC1 | 3856 | None | 0 | Human | Binding | Ki | = | 1610.00 | 5.79 | -74 | 2 | Displacement of [I125]MIT from PKR2 expressed in CHO cell membrane | ChEMBL | 451.2 | 10 | 3 | 8 | 0.76 | CCc1ccc(Cn2c(=O)nc(NCCN=C(N)N)n(Cc3ccc(OC)cc3)c2=O)cc1 | https://dx.doi.org/10.1021/jm800854e | |
Showing 1 to 4 of 4 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| MIT1 | 2543 | None | 0 | Human | Functional | pIC50 | = | - | 9.20 | 6 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12054613 | |
| PKR-A | 3135 | None | 0 | Human | Functional | pIC50 | = | - | 7.32 | - | 1 | Unclassified | Guide to Pharmacology | 438.3 | 7 | 0 | 5 | 3.73 | CC(C)CN(Cc1ccc2c(c1)OCCCO2)C(=O)C1CN(Cc2ccccc2)CCO1 | https://pubmed.ncbi.nlm.nih.gov/22431614 | |
| prokineticin-1 | 3177 | None | 0 | Human | Functional | pIC50 | = | - | 7.20 | 1 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12054613 | |
| prokineticin-1 | 3177 | None | 0 | Human | Functional | pIC50 | = | - | 7.20 | 1 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15772293 | |
| prokineticin-2 | 3180 | None | 0 | Human | Functional | pIC50 | = | - | 8.15 | -1 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12054613 | |
| prokineticin-2 | 3180 | None | 0 | Human | Functional | pIC50 | = | - | 8.15 | -1 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15772293 | |
| prokineticin-2β | 3181 | None | 0 | Human | Functional | pIC50 | > | - | 6.00 | -31 | 2 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15772293 | |
| triazine compound PC10 | 3857 | None | 0 | Human | Functional | pIC50 | = | - | 5.92 | -10 | 2 | Unclassified | Guide to Pharmacology | 563.2 | 10 | 4 | 9 | 2.15 | COc1ccc(Cn2c(NCCNC(=N)NC(=O)c3ccc(F)cc3)nc(=O)n(Cc3ccc(F)cc3)c2=O)cc1 | https://pubmed.ncbi.nlm.nih.gov/21421710 | |
Showing 1 to 8 of 8 entries