Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL4065397 | 156386 | None | 0 | Human | Binding | EC50 | = | 25312.00 | 4.60 | - | 6 | Agonist activity at human FFA2 receptor by FLIPR assay | ChEMBL | 368.1 | 7 | 1 | 3 | 4.62 | COc1ccc(C(F)(F)F)cc1COc1ccc(CCC(=O)O)cc1C | https://dx.doi.org/10.1016/j.bmcl.2017.01.034 | |
CHEMBL4159019 | 162064 | None | 0 | Human | Binding | Ki | = | 1202.26 | 5.92 | - | 1 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 419.1 | 5 | 1 | 4 | 4.70 | COc1ccccc1-c1ccc(C(=O)N2[C@H](C(=O)O)CS[C@@H]2c2ccccc2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4162307 | 162263 | None | 0 | Human | Binding | Ki | = | 158.49 | 6.80 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 505.2 | 10 | 1 | 6 | 6.05 | COc1ccc(-c2ccccc2-c2csc(N(C(=O)[C@@H](CC(=O)O)CC3CCCC3)C3CC3)n2)cn1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4165748 | 162489 | None | 0 | Human | Binding | Ki | = | 251.19 | 6.60 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 479.2 | 10 | 1 | 6 | 5.51 | COc1ccc(-c2ccccc2-c2csc(N(C(=O)[C@@H](CC(=O)O)CC(C)C)C3CC3)n2)cn1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4166818 | 162553 | None | 0 | Human | Binding | Ki | = | 398.11 | 6.40 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 440.1 | 8 | 1 | 4 | 5.29 | O=C(O)C[C@@H](Cc1ccccc1)C(=O)N(c1nc(-c2ccccc2Cl)cs1)C1CC1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4167577 | 162606 | None | 0 | Human | Binding | Ki | = | 977.24 | 6.01 | - | 1 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 423.1 | 4 | 1 | 3 | 5.35 | O=C(O)[C@@H]1CS[C@H](c2ccccc2Cl)N1C(=O)c1ccc(-c2ccccc2)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4168456 | 162657 | None | 0 | Human | Binding | Ki | = | 398.11 | 6.40 | - | 1 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 424.1 | 4 | 1 | 4 | 5.04 | Cc1noc(C)c1-c1ccc(C(=O)N2[C@H](C(=O)O)CC[C@@H]2c2ccccc2Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4170748 | 162799 | None | 0 | Human | Binding | Ki | = | 338.84 | 6.47 | - | 1 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 453.1 | 5 | 1 | 4 | 5.36 | COc1ccccc1-c1ccc(C(=O)N2[C@H](C(=O)O)CS[C@@H]2c2ccccc2Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4170829 | 162804 | None | 0 | Human | Binding | Ki | = | 100.00 | 7.00 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 537.1 | 10 | 1 | 7 | 5.96 | COc1ccc(-c2ccc(Cl)cc2-c2csc(N(C(=O)[C@@H](CC(=O)O)Cc3ccco3)C3CC3)n2)cn1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4171128 | 162823 | None | 0 | Human | Binding | Ki | = | 478.63 | 6.32 | - | 1 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 435.1 | 5 | 1 | 3 | 5.45 | COc1ccccc1-c1ccc(C(=O)N2[C@H](C(=O)O)CC[C@@H]2c2ccccc2Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4172349 | 162893 | None | 0 | Human | Binding | Ki | = | 1995.26 | 5.70 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 422.1 | 7 | 1 | 5 | 4.33 | CN(C(=O)[C@@H](CC(=O)O)CC1CCOCC1)c1nc(-c2ccccc2Cl)cs1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4172928 | 162942 | None | 1 | Human | Binding | Ki | = | 199.53 | 6.70 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 474.1 | 8 | 1 | 4 | 5.95 | O=C(O)C[C@@H](Cc1ccccc1)C(=O)N(c1nc(-c2cc(Cl)ccc2Cl)cs1)C1CC1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4173387 | 162975 | None | 0 | Human | Binding | Ki | = | 251.19 | 6.60 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 406.1 | 7 | 1 | 4 | 5.10 | CN(C(=O)[C@@H](CC(=O)O)CC1CCCC1)c1nc(-c2ccccc2Cl)cs1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4173663 | 162988 | None | 0 | Human | Binding | Ki | = | 63.10 | 7.20 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 541.2 | 10 | 1 | 7 | 6.22 | O=C(O)C[C@@H](CC1CCCC1)C(=O)N(c1nc(-c2ccccc2-c2ccc(-n3cccn3)nc2)cs1)C1CC1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4174307 | 163030 | None | 0 | Human | Binding | Ki | = | 794.33 | 6.10 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 414.1 | 7 | 1 | 4 | 4.76 | CN(C(=O)[C@@H](CC(=O)O)Cc1ccccc1)c1nc(-c2ccccc2Cl)cs1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL4176503 | 163169 | None | 33 | Human | Binding | Ki | = | 204.17 | 6.69 | - | 2 | Displacement of [3H]-GLPG0974 from human FFA2 expressed in Flp-InT-REx 293 cell membranes after 2 hrs by liquid scintillation spectrometry | ChEMBL | 442.1 | 4 | 1 | 5 | 4.95 | Cc1noc(C)c1-c1ccc(C(=O)N2[C@H](C(=O)O)CS[C@@H]2c2ccccc2Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
CHEMBL4177037 | 163192 | None | 0 | Human | Binding | Ki | = | 158.49 | 6.80 | - | 2 | Displacement of [3H]ES227703 from human FFA2R expressed in CHOK1 cells after 60 mins by TopCount scintillation counting method | ChEMBL | 515.2 | 10 | 1 | 7 | 5.69 | CC(C)C[C@H](CC(=O)O)C(=O)N(c1nc(-c2ccccc2-c2ccc(-n3cccn3)nc2)cs1)C1CC1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
CHEMBL5270112 | 193728 | None | 0 | Human | Binding | EC50 | = | 740.00 | 6.13 | - | 3 | Agonist activity at FFA2 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 252.1 | 3 | 2 | 4 | 1.88 | CCCCc1cc(=O)oc2[nH]c(=S)[nH]c(=O)c12 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5275861 | 193981 | None | 0 | Human | Binding | EC50 | = | 2500.00 | 5.60 | - | 3 | Agonist activity at FFA2 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 286.0 | 4 | 2 | 4 | 2.10 | O=c1cc(CCCCCl)c2c(=O)[nH]c(=S)[nH]c2o1 | https://dx.doi.org/10.1039/d2md00076h | |
CHEMBL5284951 | 194381 | None | 0 | Human | Binding | EC50 | = | 380.00 | 6.42 | - | 3 | Agonist activity at FFA2 (unknown origin) expressed in human Flp-In-293 cells assessed as inhibition of forskolin-stimulated cAMP accumulation incubated for 30 mins by Lance cAMP assay | ChEMBL | 270.0 | 4 | 2 | 4 | 0.73 | O=c1[nH]c(=O)c2c(CCCCCl)cc(=O)oc2[nH]1 | https://dx.doi.org/10.1039/d2md00076h |
Showing 1 to 20 of 22 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(S)-4-CMTB | 3448 | None | 0 | Human | Functional | pEC50 | = | - | 6.40 | - | 1 | Unclassified | Guide to Pharmacology | 312.1 | 4 | 1 | 3 | 4.31 | CC(C)[C@H](C(=O)Nc1ncc(F)s1)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/18818303 | |
(S)-4-CMTB | 3448 | None | 0 | Human | Functional | pEC50 | = | - | 6.40 | - | 1 | Unclassified | Guide to Pharmacology | 312.1 | 4 | 1 | 3 | 4.31 | CC(C)[C@H](C(=O)Nc1ncc(F)s1)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/23066016 | |
(S)-4-CMTB | 3448 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Agonist activity at human FFA2 receptor expressed in CHO cells assessed as inhibition of forskolin-induced cAMP production | ChEMBL | 312.1 | 4 | 1 | 3 | 4.31 | CC(C)[C@H](C(=O)Nc1ncc(F)s1)c1ccc(Cl)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.11.112 | |
1-methylcyclopropanecarboxylic acid | 34 | None | 66 | Human | Functional | pEC50 | = | - | 2.60 | -47 | 2 | Unclassified | Guide to Pharmacology | 100.1 | 1 | 1 | 1 | 0.87 | CC1(C(=O)O)CC1 | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.85 | 3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12496283 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.85 | 3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12684041 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.85 | 3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12711604 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | - | 3.85 | 3 | 2 | Unclassified | Guide to Pharmacology | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
acetic acid | 254 | None | 52 | Human | Functional | pEC50 | = | 4.60 | 8.34 | 3 | 2 | None | Drug Central | 60.0 | 0 | 1 | 1 | 0.09 | CC(=O)O | - | |
AMG7703 | 394 | None | 20 | Human | Functional | pEC50 | = | - | 6.12 | -2 | 2 | Unclassified | Guide to Pharmacology | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/18818303 | |
AMG7703 | 394 | None | 20 | Human | Functional | pEC50 | = | - | 6.12 | -2 | 2 | Unclassified | Guide to Pharmacology | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/21498659 | |
AMG7703 | 394 | None | 20 | Human | Functional | EC50 | = | 100.00 | 7.00 | -2 | 2 | Agonist activity at human FFA2R expressed in CHOK1 cells assessed as induction of GTPgamma35S binding preincubated for 15 mins followed by GTPgamma35S addition measured after 2.5 hrs by SPA method | ChEMBL | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
AMG7703 | 394 | None | 20 | Human | Functional | EC50 | = | 416.87 | 6.38 | -2 | 2 | Agonist activity to human FFA2R expressed in HEK293T cells assessed as induction beta-arrestin-2 recruitment after 10 mins by BRET assay | ChEMBL | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://dx.doi.org/10.1021/acs.jmedchem.8b00855 | |
AMG7703 | 394 | None | 20 | Human | Functional | IC50 | = | 700.00 | 6.16 | -2 | 2 | Agonist activity at human FFA2 receptor expressed in CHO cells assessed as inhibition of forskolin-induced cAMP production | ChEMBL | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.11.112 | |
AMG7703 | 394 | None | 20 | Mouse | Functional | EC50 | = | 158.49 | 6.80 | 2 | 2 | Agonist activity at mouse FFA2R expressed in CHOK1 cells assessed as induction of GTPgamma35S binding preincubated for 15 mins followed by GTPgamma35S addition measured after 2.5 hrs by SPA method | ChEMBL | 294.1 | 4 | 1 | 3 | 4.17 | CC(C)[C@H](C(=O)Nc1nccs1)c1ccc(Cl)cc1 | https://dx.doi.org/10.1016/j.bmc.2018.09.015 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 3.75 | -7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12496283 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 3.75 | -7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12684041 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 3.75 | -7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/12711604 | |
butyric acid | 750 | None | 54 | Human | Functional | pEC50 | = | - | 3.75 | -7 | 3 | Unclassified | Guide to Pharmacology | 88.1 | 2 | 1 | 1 | 0.87 | CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/21220428 | |
CATPB | 810 | None | 23 | Human | Functional | pIC50 | = | - | 6.50 | - | 1 | Unclassified | Guide to Pharmacology | 399.1 | 7 | 2 | 2 | 4.10 | O=C(O)C[C@H](Cc1ccc(C(F)(F)F)cc1)NC(=O)Cc1cccc(Cl)c1 | https://pubmed.ncbi.nlm.nih.gov/23066016 |
Showing 1 to 20 of 304 entries