Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL1170012 | 10602 | None | 37 | Human | Binding | EC50 | = | 29512.09 | 4.53 | - | 2 | Agonist activity at human FFA4 receptor expressed in CHO-K1 cells assessed as increase in amplitude of dynamic mass redistribution response by DMR assay | ChEMBL | 315.1 | 3 | 1 | 2 | 3.81 | Cc1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2020.127650 | |
| CHEMBL2315528 | 86563 | None | 0 | Human | Binding | EC50 | = | 4786.30 | 5.32 | - | 3 | Agonist activity at GPR120 (unknown origin) | ChEMBL | 289.1 | 4 | 1 | 2 | 3.17 | N#CCc1ccccc1C#Cc1ccc(CCC(=O)O)cc1 | https://dx.doi.org/10.1021/jm301470a | |
| CHEMBL2315528 | 86563 | None | 0 | Human | Binding | EC50 | = | 776.25 | 6.11 | - | 3 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 289.1 | 4 | 1 | 2 | 3.17 | N#CCc1ccccc1C#Cc1ccc(CCC(=O)O)cc1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386354 | 90395 | None | 0 | Human | Binding | EC50 | = | 3890.45 | 5.41 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 307.1 | 4 | 1 | 2 | 3.31 | N#CCc1cccc(C#Cc2ccc(CCC(=O)O)c(F)c2)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386355 | 90396 | None | 0 | Human | Binding | EC50 | = | 1380.38 | 5.86 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 321.1 | 5 | 1 | 2 | 3.70 | N#CCCc1ccccc1C#Cc1ccc(CCC(=O)O)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386357 | 90398 | None | 0 | Human | Binding | EC50 | = | 91201.08 | 4.04 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 251.1 | 3 | 1 | 2 | 2.50 | O=C(O)CCc1ccc(C#Cc2ccccc2)nc1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386358 | 90399 | None | 0 | Human | Binding | EC50 | = | 5754.40 | 5.24 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 268.1 | 3 | 1 | 1 | 3.24 | O=C(O)CCc1ccc(C#Cc2ccccc2)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386359 | 90400 | None | 0 | Human | Binding | EC50 | = | 7943.28 | 5.10 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 268.1 | 3 | 1 | 1 | 3.24 | O=C(O)CCc1ccc(C#Cc2ccccc2)cc1F | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386360 | 90401 | None | 0 | Human | Binding | EC50 | = | 8317.64 | 5.08 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 286.1 | 3 | 1 | 1 | 3.38 | O=C(O)CCc1c(F)cc(C#Cc2ccccc2)cc1F | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386361 | 90402 | None | 0 | Human | Binding | EC50 | = | 1584.89 | 5.80 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 282.1 | 3 | 1 | 1 | 3.55 | Cc1ccccc1C#Cc1ccc(CCC(=O)O)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386362 | 90403 | None | 0 | Human | Binding | EC50 | = | 3890.45 | 5.41 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 282.1 | 3 | 1 | 1 | 3.55 | Cc1cccc(C#Cc2ccc(CCC(=O)O)c(F)c2)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386363 | 90404 | None | 0 | Human | Binding | EC50 | = | 9549.93 | 5.02 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 307.1 | 3 | 1 | 2 | 3.42 | Cc1ccc(C#N)cc1C#Cc1ccc(CCC(=O)O)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386364 | 90405 | None | 0 | Human | Binding | EC50 | = | 1174.90 | 5.93 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 336.1 | 4 | 1 | 1 | 4.32 | O=C(O)CCc1ccc(C#Cc2cc(F)ccc2C(F)F)cc1F | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386365 | 90406 | None | 0 | Human | Binding | EC50 | = | 3162.28 | 5.50 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 336.0 | 3 | 1 | 1 | 4.55 | O=C(O)CCc1ccc(C#Cc2cc(Cl)cc(Cl)c2)cc1F | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386367 | 90408 | None | 0 | Human | Binding | EC50 | = | 64565.42 | 4.19 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 360.1 | 5 | 1 | 3 | 2.79 | CS(=O)(=O)Cc1cccc(C#Cc2ccc(CCC(=O)O)c(F)c2)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386368 | 90409 | None | 0 | Human | Binding | EC50 | = | 300.00 | 6.52 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 404.1 | 8 | 1 | 4 | 2.80 | CS(=O)(=O)CCOCc1ccccc1C#Cc1ccc(CCC(=O)O)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386369 | 90410 | None | 0 | Human | Binding | EC50 | = | 300.00 | 6.52 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 404.1 | 8 | 1 | 4 | 2.80 | CS(=O)(=O)CCOCc1cccc(C#Cc2ccc(CCC(=O)O)c(F)c2)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386370 | 90412 | None | 0 | Human | Binding | EC50 | = | 300.00 | 6.52 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 418.1 | 9 | 1 | 4 | 3.19 | CS(=O)(=O)CCCOCc1ccccc1C#Cc1ccc(CCC(=O)O)c(F)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL2386371 | 90413 | None | 0 | Human | Binding | EC50 | = | 300.00 | 6.52 | - | 2 | Agonist activity at C-terminal yellow fluorescent protein-fused human FFA4 receptor transfected in HEK293 cells after 5 mins by BRET assay | ChEMBL | 418.1 | 9 | 1 | 4 | 3.19 | CS(=O)(=O)CCCOCc1cccc(C#Cc2ccc(CCC(=O)O)c(F)c2)c1 | https://dx.doi.org/10.1021/ml4000673 | |
| CHEMBL3311302 | 113086 | None | 38 | Human | Binding | IC50 | = | 79.43 | 7.10 | - | 3 | Inhibition of human FFA4 receptor expressed in U2OS cells | ChEMBL | 351.1 | 3 | 1 | 3 | 4.17 | Cc1ccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)cc1 | https://dx.doi.org/10.1016/j.bmcl.2014.05.012 | |
Showing 1 to 20 of 274 entries
| Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |