Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 12R-HETE | 11 | None | 0 | Human | Binding | pKi | = | - | 7.50 | - | 1 | Unclassified | Guide to Pharmacology | 320.2 | 14 | 2 | 2 | 5.19 | CCCCC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/9177352 | |
| 20-hydroxy-LTB4 | 41 | None | 0 | Human | Binding | pKi | = | - | 8.10 | - | 1 | Unclassified | Guide to Pharmacology | 352.2 | 15 | 4 | 4 | 3.13 | O=C(O)CCC[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCCCCO | https://pubmed.ncbi.nlm.nih.gov/9177352 | |
| 5, 6-Dehydroarachidonic acid | 218693 | 3H-LTB4 | 0 | Human | Binding | pKi | = | 1000.00 | 6.00 | 1 | 2 | - | PDSP KiDatabase | 302.2 | 12 | 1 | 1 | 5.66 | CCCCCC=CCC=CCC=CCC#CCCCC(=O)O | - | |
| BIIL 260 | 634 | None | 0 | Human | Binding | pKi | = | - | 8.80 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/11259574 | |
| BIIL 260 | 634 | None | 0 | Human | Binding | pKi | = | - | 8.80 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/17170051 | |
| CHEMBL105139 | 5027 | None | 14 | Human | Binding | IC50 | = | 210.00 | 6.68 | - | 1 | Tested for inhibitory activity against leukotriene B4 (LTB4) receptor in human neutrophils | ChEMBL | 299.1 | 3 | 2 | 5 | 3.65 | CNc1nc2c(Cc3cccnc3)c(C)c(O)c(C)c2s1 | https://dx.doi.org/10.1021/jm00045a011 | |
| CHEMBL106055 | 5190 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 316.1 | 10 | 1 | 2 | 5.11 | O=C(O)CCCCCCc1csc(CCc2ccccc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL107760 | 5629 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 364.1 | 11 | 1 | 2 | 6.15 | O=C(O)CCCCCCc1ccsc1CCCc1ccc(Cl)cc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL107781 | 5650 | None | 0 | Human | Binding | IC50 | = | 5000.00 | 5.30 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 346.2 | 11 | 2 | 3 | 5.21 | O=C(O)CCCCCCc1csc(CCCc2ccc(O)cc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL108094 | 6148 | None | 0 | Human | Binding | IC50 | = | 3500.00 | 5.46 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 302.1 | 9 | 1 | 2 | 4.72 | O=C(O)CCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL108415 | 6867 | None | 3 | Human | Binding | IC50 | = | 60.00 | 7.22 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 358.2 | 11 | 1 | 2 | 6.14 | CC(C)(CCCCCc1sccc1CCCc1ccccc1)C(=O)O | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109015 | 7906 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 364.1 | 11 | 1 | 2 | 6.15 | O=C(O)CCCCCCc1csc(CCCc2ccc(Cl)cc2)c1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109016 | 7907 | None | 0 | Human | Binding | IC50 | = | 4500.00 | 5.35 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 316.1 | 10 | 1 | 2 | 5.11 | O=C(O)CCCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109128 | 8089 | None | 0 | Human | Binding | IC50 | = | 6000.00 | 5.22 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 346.2 | 11 | 2 | 3 | 4.99 | O=C(O)CCCCCC(O)c1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109129 | 8091 | None | 0 | Human | Binding | IC50 | = | 3000.00 | 5.52 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 362.1 | 11 | 1 | 3 | 5.97 | Cc1cc(CCCc2ccccc2)c(SCCCCCC(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL109176 | 8140 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 330.2 | 11 | 1 | 2 | 5.50 | O=C(O)CCCCCCc1sccc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110243 | 9179 | None | 0 | Human | Binding | IC50 | = | 200.00 | 6.70 | - | 1 | Capability of compound to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 372.2 | 11 | 1 | 2 | 6.45 | Cc1cc(CCCc2ccccc2)c(CCCCCC(C)(C)C(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110402 | 9203 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability of compound to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptors at the concentration of 10e-5 M | ChEMBL | 330.2 | 11 | 1 | 2 | 5.50 | O=C(O)CCCCCCc1ccsc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110707 | 9244 | None | 0 | Human | Binding | IC50 | = | 1000.00 | 6.00 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 406.2 | 12 | 1 | 2 | 7.17 | O=C(O)CCCCCCc1sc(-c2ccccc2)cc1CCCc1ccccc1 | https://dx.doi.org/10.1021/jm00095a011 | |
| CHEMBL110708 | 9245 | None | 0 | Human | Binding | IC50 | = | 1500.00 | 5.82 | - | 1 | Capability to inhibit the binding of [3H]LTB4 to guinea pig spleen Leukotriene B4 receptor at the concentration of 10e-5 M | ChEMBL | 344.2 | 11 | 1 | 2 | 5.81 | Cc1cc(CCCc2ccccc2)c(CCCCCCC(=O)O)s1 | https://dx.doi.org/10.1021/jm00095a011 | |
Showing 1 to 20 of 510 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| BIIL 260 | 634 | None | 0 | Human | Functional | pIC50 | = | - | 8.54 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/11259574 | |
| BIIL 260 | 634 | None | 0 | Human | Functional | pIC50 | = | - | 8.54 | - | 1 | Unclassified | Guide to Pharmacology | 466.2 | 9 | 3 | 4 | 6.16 | CC(C)(c1ccc(O)cc1)c1ccc(OCc2cccc(COc3ccc(C(=N)N)cc3)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/17170051 | |
| CHEMBL1094346 | 8533 | None | 0 | Human | Functional | IC50 | = | 0.22 | 9.66 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 625.3 | 18 | 2 | 7 | 7.59 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccncc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1094347 | 8534 | None | 0 | Human | Functional | IC50 | = | 0.38 | 9.42 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 626.3 | 18 | 2 | 8 | 6.98 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cncnc3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1094348 | 8535 | None | 0 | Human | Functional | IC50 | = | 1.19 | 8.92 | 15 | 2 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 642.3 | 18 | 2 | 6 | 8.33 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cccc(F)c3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1094348 | 8535 | None | 0 | Human | Functional | IC50 | = | 129.00 | 6.89 | 15 | 2 | Antagonist activity at FLAG-tagged human BLT1 receptor expressed in HEK293 cells assessed as inhibition of LTB4-stimulated calcium mobilization preincubated for 10 mins before LTB4 challenge | ChEMBL | 642.3 | 18 | 2 | 6 | 8.33 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3cccc(F)c3)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1094349 | 8536 | None | 0 | Human | Functional | IC50 | = | 0.61 | 9.21 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 642.3 | 18 | 2 | 6 | 8.33 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc4c(c3)OCO4)cc(-c3ccccc3F)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1094350 | 8537 | None | 0 | Human | Functional | IC50 | = | 60.20 | 7.22 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 656.3 | 18 | 2 | 6 | 8.37 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc(F)cc3)cc(-c3ccc4c(c3)OCCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1098550 | 9032 | None | 0 | Human | Functional | IC50 | = | 0.58 | 9.24 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 592.2 | 18 | 2 | 6 | 8.59 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccsc3)cc(-c3ccsc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099323 | 9116 | None | 0 | Human | Functional | IC50 | = | 38.50 | 7.42 | 223 | 2 | Antagonist activity at FLAG-tagged human BLT1 receptor expressed in HEK293 cells assessed as inhibition of LTB4-stimulated calcium mobilization preincubated for 10 mins before LTB4 challenge | ChEMBL | 580.3 | 18 | 2 | 4 | 8.46 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099323 | 9116 | None | 0 | Human | Functional | IC50 | = | 0.21 | 9.68 | 223 | 2 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 580.3 | 18 | 2 | 4 | 8.46 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099324 | 9117 | None | 0 | Human | Functional | IC50 | = | 8.50 | 8.07 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 616.3 | 18 | 2 | 4 | 8.74 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099325 | 9118 | None | 0 | Human | Functional | IC50 | = | 31.10 | 7.51 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 640.3 | 20 | 2 | 6 | 8.48 | COc1ccc(-c2cc(OCCCCCCc3cccc(OCCCC(=O)O)c3CCC(=O)O)cc(-c3ccc(OC)cc3)c2)cc1 | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099326 | 9119 | None | 0 | Human | Functional | IC50 | = | 71.00 | 7.15 | 64 | 2 | Antagonist activity at FLAG-tagged human BLT1 receptor expressed in HEK293 cells assessed as inhibition of LTB4-stimulated calcium mobilization preincubated for 10 mins before LTB4 challenge | ChEMBL | 582.3 | 18 | 2 | 6 | 7.25 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccncc3)cc(-c3ccncc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099326 | 9119 | None | 0 | Human | Functional | IC50 | = | 0.07 | 10.15 | 64 | 2 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 582.3 | 18 | 2 | 6 | 7.25 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccncc3)cc(-c3ccncc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099327 | 9120 | None | 0 | Human | Functional | IC50 | = | 5.35 | 8.27 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 582.3 | 18 | 2 | 6 | 7.25 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3cncnc3)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099328 | 9121 | None | 0 | Human | Functional | IC50 | = | 5.39 | 8.27 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 668.3 | 18 | 2 | 8 | 7.92 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc4c(c3)OCO4)cc(-c3ccc4c(c3)OCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099329 | 9122 | None | 0 | Human | Functional | IC50 | = | 139.70 | 6.86 | - | 1 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 696.3 | 18 | 2 | 8 | 8.01 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccc4c(c3)OCCO4)cc(-c3ccc4c(c3)OCCO4)c2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099330 | 9123 | None | 0 | Human | Functional | IC50 | = | 0.48 | 9.32 | 316 | 2 | Antagonist activity at BLT1 receptor expressed in human HL60 cells assessed as inhibition of LTB4-stimulated calcium flux after 30 mins | ChEMBL | 581.3 | 18 | 2 | 5 | 7.86 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
| CHEMBL1099330 | 9123 | None | 0 | Human | Functional | IC50 | = | 205.00 | 6.69 | 316 | 2 | Antagonist activity at FLAG-tagged human BLT1 receptor expressed in HEK293 cells assessed as inhibition of LTB4-stimulated calcium mobilization preincubated for 10 mins before LTB4 challenge | ChEMBL | 581.3 | 18 | 2 | 5 | 7.86 | O=C(O)CCCOc1cccc(CCCCCCOc2cc(-c3ccccc3)cc(-c3ccccc3)n2)c1CCC(=O)O | https://dx.doi.org/10.1021/jm1001919 | |
Showing 1 to 20 of 83 entries