Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1206088 | 14701 | None | 0 | Rat | Binding | EC50 | = | 692.00 | 6.16 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 472.2 | 17 | 2 | 4 | 6.05 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(O)(O)=S)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206091 | 14702 | None | 0 | Rat | Binding | Ki | = | 171.00 | 6.77 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 456.3 | 17 | 2 | 4 | 5.93 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(=O)(O)O)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206091 | 14702 | None | 0 | Rat | Binding | IC50 | = | 504.00 | 6.30 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 456.3 | 17 | 2 | 4 | 5.93 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(=O)(O)O)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206092 | 14703 | None | 0 | Rat | Binding | EC50 | = | 194.00 | 6.71 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206093 | 14704 | None | 0 | Rat | Binding | EC50 | = | 639.00 | 6.19 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCCC1OCC(COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206094 | 14705 | None | 0 | Rat | Binding | EC50 | = | 204.00 | 6.69 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207238 | 14821 | None | 0 | Rat | Binding | IC50 | = | 209.00 | 6.68 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207238 | 14821 | None | 0 | Rat | Binding | Ki | = | 77.00 | 7.11 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207267 | 14826 | None | 0 | Rat | Binding | IC50 | = | 484.00 | 6.32 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207267 | 14826 | None | 0 | Rat | Binding | Ki | = | 241.00 | 6.62 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207268 | 14827 | None | 0 | Rat | Binding | EC50 | = | 7590.00 | 5.12 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 416.2 | 16 | 2 | 4 | 5.43 | C/C=C/C/C=C/C/C=C/CCCCCCCCC1OCC(COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207662 | 14880 | None | 0 | Rat | Binding | EC50 | = | 265.00 | 6.58 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207670 | 14881 | None | 0 | Rat | Binding | EC50 | = | 127.00 | 6.90 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207755 | 14888 | None | 0 | Rat | Binding | IC50 | = | 136.00 | 6.87 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207755 | 14888 | None | 0 | Rat | Binding | Ki | = | 83.00 | 7.08 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL153043 | 45745 | None | 0 | Human | Binding | EC50 | = | 0.44 | 9.36 | - | 6 | Agonist activity at human LPA3 receptor transfected in HEK293 cells after 1 hr by TGFalpha shedding assay | ChEMBL | 468.3 | 22 | 2 | 5 | 6.03 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(O)=S)OC | https://dx.doi.org/10.1016/j.bmcl.2013.01.002 | |
CHEMBL153043 | 45745 | None | 0 | Human | Binding | EC50 | = | 0.45 | 9.35 | - | 6 | Agonist activity at human LPA3 receptor transfected in HEK293 cells after 1 hr by TGFalpha shedding assay | ChEMBL | 468.3 | 22 | 2 | 5 | 6.03 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(O)=S)OC | https://dx.doi.org/10.1016/j.bmcl.2013.01.002 | |
CHEMBL181612 | 64603 | None | 0 | Human | Binding | Ki | = | 232.00 | 6.63 | - | 2 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 615.4 | 24 | 4 | 4 | 8.22 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)CC(O)P(=O)(O)O | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 | |
CHEMBL181917 | 64787 | None | 0 | Human | Binding | Ki | = | 561.00 | 6.25 | - | 2 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 660.4 | 25 | 3 | 6 | 8.46 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](COP(=O)(O)O)Cc1ccc(OCc2ncc(C)c(OC)c2C)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 | |
CHEMBL182302 | 65014 | None | 0 | Human | Binding | Ki | = | 2600.00 | 5.58 | - | 1 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 682.4 | 25 | 3 | 6 | 9.00 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](COP(=O)(O)O)Cc1ccc(OCc2cc(OC)c3ccccc3n2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 |
Showing 1 to 20 of 123 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
α-fluoromethylenephosphonate | 359 | None | 0 | Human | Functional | pEC50 | None | - | 9.30 | - | 1 | Unclassified | Guide to Pharmacology | 466.3 | 21 | 2 | 4 | 6.45 | CCCCCCCC/C=C/CCCCCCCC(=O)OC[C@H](CC(F)P(=O)(O)O)OC | https://pubmed.ncbi.nlm.nih.gov/15857137 | |
2-oleoyl-LPA | 85 | None | 0 | Human | Functional | pEC50 | None | - | 8.00 | -1 | 4 | Unclassified | Guide to Pharmacology | 436.3 | 20 | 3 | 5 | 5.04 | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CO)COP(=O)(O)O | https://pubmed.ncbi.nlm.nih.gov/10922489 | |
alkyl OMPT | 347 | None | 0 | Human | Functional | pEC50 | = | - | 7.21 | 8 | 2 | Unclassified | Guide to Pharmacology | 452.3 | 22 | 2 | 4 | 6.28 | CCCCCCCC/C=C\CCCCCCCCOC[C@@H](COP(O)(O)=S)OC | https://pubmed.ncbi.nlm.nih.gov/16892372 | |
alkyl OMPT | 347 | None | 0 | Human | Functional | EC50 | = | 80.00 | 7.10 | 8 | 2 | Agonist activity at human LPA3 receptor transfected in RH7777 cells assessed as mobilization of Ca2+ by fluorometric analysis | ChEMBL | 452.3 | 22 | 2 | 4 | 6.28 | CCCCCCCC/C=C\CCCCCCCCOC[C@@H](COP(O)(O)=S)OC | https://dx.doi.org/10.1039/C4MD00333K | |
AM966 | 389 | None | 41 | Human | Functional | pIC50 | None | - | 5.70 | -89 | 7 | Unclassified | Guide to Pharmacology | 490.1 | 7 | 2 | 5 | 6.91 | Cc1noc(-c2ccc(-c3ccc(CC(=O)O)cc3)cc2)c1NC(=O)O[C@H](C)c1ccccc1Cl | https://pubmed.ncbi.nlm.nih.gov/20649573 | |
AM966 | 389 | None | 41 | Human | Functional | IC50 | = | 1600.00 | 5.80 | -89 | 7 | Antagonist activity at human LPA3 receptor expressed in CHO cells assessed as inhibition of LPA-induced calcium mobilization preincubated for 30 mins followed by LPA induction by FLIPR Calcium 4 dye-based fluorometric analysis | ChEMBL | 490.1 | 7 | 2 | 5 | 6.91 | Cc1noc(-c2ccc(-c3ccc(CC(=O)O)cc3)cc2)c1NC(=O)O[C@H](C)c1ccccc1Cl | https://dx.doi.org/10.1039/C4MD00333K | |
AM966 | 389 | None | 41 | Mouse | Functional | pIC50 | None | - | 6.80 | -7 | 7 | Unclassified | Guide to Pharmacology | 490.1 | 7 | 2 | 5 | 6.91 | Cc1noc(-c2ccc(-c3ccc(CC(=O)O)cc3)cc2)c1NC(=O)O[C@H](C)c1ccccc1Cl | https://pubmed.ncbi.nlm.nih.gov/20649573 | |
BrP-LPA | 731 | None | 2 | Human | Functional | Ki | = | 170.00 | 6.77 | - | 5 | Antagonist activity at human LPA3 receptor expressed in RG7777 cells assessed as inhibition of LPA-induced Ca2+ mobilization by FURA-2AM dye based fluorescence assay | ChEMBL | 486.2 | 19 | 3 | 4 | 5.66 | CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)CC(Br)P(=O)(O)O | https://dx.doi.org/10.1039/C4MD00255E | |
CHEMBL187402 | 67130 | None | 0 | Human | Functional | IC50 | = | 28.00 | 7.55 | 16 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 308.2 | 13 | 2 | 2 | 4.69 | CCCC/C=C/CCCCCCCCOP(O)(O)=S | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL187459 | 67142 | None | 0 | Human | Functional | EC50 | = | 546.00 | 6.26 | -2 | 3 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 364.2 | 17 | 2 | 2 | 6.25 | CCCCCCCC/C=C/CCCCCCCCOP(O)(O)=S | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL188081 | 67281 | None | 0 | Human | Functional | IC50 | = | 830.00 | 6.08 | - | 1 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 236.1 | 9 | 2 | 2 | 3.01 | CCCCC/C=C/CCCOP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL188083 | 67282 | None | 42 | Human | Functional | IC50 | = | 1200.00 | 5.92 | - | 1 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 222.1 | 9 | 2 | 1 | 3.31 | CCCCCCCCCCP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL188591 | 67378 | None | 0 | Human | Functional | IC50 | = | 103.00 | 6.99 | 21 | 3 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 292.2 | 13 | 2 | 2 | 4.57 | CC/C=C/CCCCCCCCCCOP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL188859 | 67436 | None | 0 | Human | Functional | IC50 | = | 1513.00 | 5.82 | 1 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 328.2 | 14 | 2 | 1 | 5.85 | CCCCCCCCCCCCCCC(F)(F)P(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL189515 | 67531 | None | 0 | Human | Functional | IC50 | = | 5570.00 | 5.25 | - | 1 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 499.3 | 20 | 4 | 4 | 5.75 | CCCCCCCCCCCCCCCC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL190328 | 67636 | None | 20 | Human | Functional | EC50 | = | 1600.00 | 5.80 | 1 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 423.2 | 19 | 4 | 4 | 4.15 | CCCCCCCCCCCCCCCC(=O)N[C@@H](COP(=O)(O)O)C(=O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL190349 | 67638 | None | 0 | Human | Functional | IC50 | = | 32.00 | 7.50 | 22 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 264.1 | 11 | 2 | 2 | 3.79 | CC/C=C/CCCCCCCCOP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL190430 | 67647 | None | 0 | Human | Functional | IC50 | = | 96.00 | 7.02 | 4 | 3 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 292.2 | 13 | 2 | 2 | 4.57 | CCCC/C=C/CCCCCCCCOP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL190484 | 67653 | None | 0 | Human | Functional | IC50 | = | 27.00 | 7.57 | 25 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 280.1 | 11 | 2 | 2 | 3.91 | CC/C=C/CCCCCCCCOP(O)(O)=S | https://dx.doi.org/10.1021/jm049609r | |
CHEMBL190999 | 67869 | None | 46 | Human | Functional | IC50 | = | 3100.00 | 5.51 | 1 | 2 | Inhibition of LPA-induced calcium transients in RH7777 rat hepatoma cells expressing LPA3 receptor | ChEMBL | 278.2 | 13 | 2 | 1 | 4.87 | CCCCCCCCCCCCCCP(=O)(O)O | https://dx.doi.org/10.1021/jm049609r |
Showing 1 to 20 of 122 entries