Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1206088 | 14701 | None | 0 | Rat | Binding | EC50 | = | 692.00 | 6.16 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 472.2 | 17 | 2 | 4 | 6.05 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(O)(O)=S)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206091 | 14702 | None | 0 | Rat | Binding | Ki | = | 171.00 | 6.77 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 456.3 | 17 | 2 | 4 | 5.93 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(=O)(O)O)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206091 | 14702 | None | 0 | Rat | Binding | IC50 | = | 504.00 | 6.30 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 456.3 | 17 | 2 | 4 | 5.93 | CCCCCCCCc1ccc(CCCCCCC2OCC(COP(=O)(O)O)O2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206092 | 14703 | None | 0 | Rat | Binding | EC50 | = | 194.00 | 6.71 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206093 | 14704 | None | 0 | Rat | Binding | EC50 | = | 639.00 | 6.19 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCCC1OCC(COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1206094 | 14705 | None | 0 | Rat | Binding | EC50 | = | 204.00 | 6.69 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207238 | 14821 | None | 0 | Rat | Binding | IC50 | = | 209.00 | 6.68 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207238 | 14821 | None | 0 | Rat | Binding | Ki | = | 77.00 | 7.11 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207267 | 14826 | None | 0 | Rat | Binding | IC50 | = | 484.00 | 6.32 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207267 | 14826 | None | 0 | Rat | Binding | Ki | = | 241.00 | 6.62 | - | 1 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207268 | 14827 | None | 0 | Rat | Binding | EC50 | = | 7590.00 | 5.12 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 416.2 | 16 | 2 | 4 | 5.43 | C/C=C/C/C=C/C/C=C/CCCCCCCCC1OCC(COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207662 | 14880 | None | 0 | Rat | Binding | EC50 | = | 265.00 | 6.58 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207670 | 14881 | None | 0 | Rat | Binding | EC50 | = | 127.00 | 6.90 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 436.2 | 18 | 2 | 4 | 5.99 | CCCCCCC/C=C/CCCCCCCC[C@H]1OC[C@H](COP(O)(O)=S)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207755 | 14888 | None | 0 | Rat | Binding | IC50 | = | 136.00 | 6.87 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL1207755 | 14888 | None | 0 | Rat | Binding | Ki | = | 83.00 | 7.08 | - | 2 | Activity at LPA3 receptor in RH7777 rat hepatoma cell line | ChEMBL | 420.3 | 18 | 2 | 4 | 5.88 | CCCCCCC/C=C/CCCCCCCC[C@@H]1OC[C@H](COP(=O)(O)O)O1 | https://dx.doi.org/10.1016/j.bmcl.2005.08.096 | |
CHEMBL153043 | 45745 | None | 0 | Human | Binding | EC50 | = | 0.44 | 9.36 | - | 6 | Agonist activity at human LPA3 receptor transfected in HEK293 cells after 1 hr by TGFalpha shedding assay | ChEMBL | 468.3 | 22 | 2 | 5 | 6.03 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(O)=S)OC | https://dx.doi.org/10.1016/j.bmcl.2013.01.002 | |
CHEMBL153043 | 45745 | None | 0 | Human | Binding | EC50 | = | 0.45 | 9.35 | - | 6 | Agonist activity at human LPA3 receptor transfected in HEK293 cells after 1 hr by TGFalpha shedding assay | ChEMBL | 468.3 | 22 | 2 | 5 | 6.03 | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(O)=S)OC | https://dx.doi.org/10.1016/j.bmcl.2013.01.002 | |
CHEMBL181612 | 64603 | None | 0 | Human | Binding | Ki | = | 232.00 | 6.63 | - | 2 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 615.4 | 24 | 4 | 4 | 8.22 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)CC(O)P(=O)(O)O | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 | |
CHEMBL181917 | 64787 | None | 0 | Human | Binding | Ki | = | 561.00 | 6.25 | - | 2 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 660.4 | 25 | 3 | 6 | 8.46 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](COP(=O)(O)O)Cc1ccc(OCc2ncc(C)c(OC)c2C)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 | |
CHEMBL182302 | 65014 | None | 0 | Human | Binding | Ki | = | 2600.00 | 5.58 | - | 1 | Binding affinity towards Lysophosphatidic acid 3 (LPA3) receptor | ChEMBL | 682.4 | 25 | 3 | 6 | 9.00 | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](COP(=O)(O)O)Cc1ccc(OCc2cc(OC)c3ccccc3n2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2004.05.023 |
Showing 1 to 20 of 123 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |