Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CHEMBL1206368 | 14752 | None | 0 | Human | Binding | Ki | = | 302.00 | 6.52 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=3 | ChEMBL | 1420.1 | 18 | 12 | 17 | 9.46 | O=C(Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2-c2ccccc2)c1)Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2-c2ccccc2)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1207434 | 14861 | None | 0 | Human | Binding | Ki | = | 446.68 | 6.35 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=3 | ChEMBL | 1352.1 | 18 | 12 | 17 | 8.37 | CC(C)c1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3C(C)C)c2)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1207473 | 14867 | None | 0 | Human | Binding | Ki | = | 2398.83 | 5.62 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=4 | ChEMBL | 1356.1 | 20 | 12 | 19 | 6.42 | COCc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3COC)c2)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1207502 | 14869 | None | 2 | Human | Binding | Ki | = | 7585.78 | 5.12 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=3 | ChEMBL | 1058.0 | 12 | 10 | 15 | 4.24 | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)Nc1cc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)ccc1C | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1207516 | 14870 | None | 0 | Human | Binding | Ki | = | 107.15 | 6.97 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=7 | ChEMBL | 1335.9 | 16 | 12 | 17 | 7.43 | O=C(Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2Cl)c1)Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2Cl)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1207525 | 14871 | None | 0 | Human | Binding | Ki | = | 75.86 | 7.12 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=7 | ChEMBL | 1328.0 | 18 | 12 | 19 | 6.14 | COc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3OC)c2)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL1208520 | 14968 | None | 1 | Human | Binding | Ki | = | 1000.00 | 6.00 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=3 | ChEMBL | 1324.1 | 18 | 12 | 17 | 7.25 | CCc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3CC)c2)c1 | https://dx.doi.org/10.1021/jm050301p | |
CHEMBL5316131 | 194776 | None | 0 | Human | Binding | Ki | = | 15.85 | 7.80 | - | 1 | Antagonist activity at P2Y11 (unknown origin) | ChEMBL | 906.1 | 10 | 16 | 7 | 6.04 | Cc1ccc(C(=O)Nc2cc([SH](=O)(O)O)cc3ccc([SH](=O)(O)O)cc23)cc1NC(=O)Nc1cc(C(=O)Nc2cc([SH](=O)(O)O)cc3ccc([SH](=O)(O)O)cc23)ccc1C | https://dx.doi.org/10.1021/acs.jmedchem.5b01972 | |
NF157 | 2810 | None | 4 | Human | Binding | Ki | = | 44.67 | 7.35 | - | 1 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=7 | ChEMBL | 1304.0 | 16 | 12 | 17 | 6.41 | O=C(Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1)Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1 | https://dx.doi.org/10.1021/jm050301p | |
NF157 | 2810 | None | 4 | Human | Binding | IC50 | = | 457.09 | 6.34 | - | 1 | Inhibitory concentration against P2Y11 receptor expressed in 1321N1 astrocytoma Cells; (n=7) | ChEMBL | 1304.0 | 16 | 12 | 17 | 6.41 | O=C(Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1)Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1 | https://dx.doi.org/10.1021/jm050301p | |
NF157 | 2810 | None | 4 | Human | Binding | pKi | = | - | 7.35 | - | 1 | Unclassified | Guide to Pharmacology | 1304.0 | 16 | 12 | 17 | 6.41 | O=C(Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1)Nc1cccc(C(=O)Nc2cc(C(=O)Nc3ccc(S(=O)(=O)O)c4cc(S(=O)(=O)O)cc(S(=O)(=O)O)c34)ccc2F)c1 | https://pubmed.ncbi.nlm.nih.gov/16250663 | |
suramin | 3710 | None | 26 | Human | Binding | Ki | = | 302.00 | 6.52 | -1 | 11 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=6 | ChEMBL | 1296.0 | 16 | 12 | 17 | 6.74 | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3C)c2)c1 | https://dx.doi.org/10.1021/jm050301p | |
suramin | 3710 | None | 26 | Human | Binding | Ki | = | 112.20 | 6.95 | -1 | 11 | Inhibitory concentration against P2Y purinoceptor 11 expressed in 1321N1 astrocytoma cells; n=3 | ChEMBL | 1296.0 | 16 | 12 | 17 | 6.74 | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)O)c3cc(S(=O)(=O)O)cc(S(=O)(=O)O)c23)cc1NC(=O)c1cccc(NC(=O)Nc2cccc(C(=O)Nc3cc(C(=O)Nc4ccc(S(=O)(=O)O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c45)ccc3C)c2)c1 | https://dx.doi.org/10.1021/jm050301p |
Showing 1 to 13 of 13 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |