Ligand source activities (1 row/activity)
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 2733504 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| 7802 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| CHEMBL397686 | 8216 | 0 | None | - | 1 | Human | 6.0 | pEC50 | = | 6 | Functional | Guide to Pharmacology | 314 | 0 | 0 | 0 | -3.2 | c1ccc2c(c1)[I+]c1c2cccc1.[Cl-] | 24633425 | ||
| 10883396 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| 5283560 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| 911 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| CHEMBL225155 | 10421 | 45 | None | -36 | 15 | Human | 7.4 | pEC50 | None | 7.4 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12220620 | ||
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |