Ligand source activities (1 row/activity)
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 3404 | 6801 | 29 | None | 107 | 3 | Mouse | 9.6 | pEC50 | = | 9.6 | Functional | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| 5283155 | 6801 | 29 | None | 107 | 3 | Mouse | 9.6 | pEC50 | = | 9.6 | Functional | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| 5508 | 6801 | 29 | None | 107 | 3 | Mouse | 9.6 | pEC50 | = | 9.6 | Functional | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| CHEMBL1526258 | 6801 | 29 | None | 107 | 3 | Mouse | 9.6 | pEC50 | = | 9.6 | Functional | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 3404 | 6801 | 29 | None | - | 1 | Mouse | 8.3 | pKd | = | 8.3 | Binding | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| 5283155 | 6801 | 29 | None | - | 1 | Mouse | 8.3 | pKd | = | 8.3 | Binding | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| 5508 | 6801 | 29 | None | - | 1 | Mouse | 8.3 | pKd | = | 8.3 | Binding | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||
| CHEMBL1526258 | 6801 | 29 | None | - | 1 | Mouse | 8.3 | pKd | = | 8.3 | Binding | Guide to Pharmacology | 320 | 14 | 2 | 2 | 5.2 | CCCCC/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)O)O | 21712392 | ||