Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
resolvin D1 | 3318 | None | 0 | Human | Binding | pKd | = | - | 9.70 | - | 2 | Unclassified | Guide to Pharmacology | 376.2 | 14 | 4 | 4 | 3.46 | CC/C=C\C[C@H](O)/C=C/C=C\C=C\C=C\[C@H](O)[C@@H](O)C/C=C\CCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/20080636 |
Showing 1 to 1 of 1 entry
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
LXA4 | 2392 | None | 22 | Human | Functional | pEC50 | = | - | 9.70 | 10 | 3 | Unclassified | Guide to Pharmacology | 352.2 | 14 | 4 | 4 | 3.13 | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/20080636 | |
resolvin D1 | 3318 | None | 0 | Human | Functional | pEC50 | = | - | 11.06 | -6 | 2 | Unclassified | Guide to Pharmacology | 376.2 | 14 | 4 | 4 | 3.46 | CC/C=C\C[C@H](O)/C=C/C=C\C=C\C=C\[C@H](O)[C@@H](O)C/C=C\CCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/20080636 | |
RvD1-ME | 3417 | None | 0 | Human | Functional | pEC50 | = | - | 11.34 | -1 | 2 | Unclassified | Guide to Pharmacology | 390.2 | 14 | 3 | 5 | 3.55 | CC/C=C\C[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)C/C=C\CCC(=O)OC | https://pubmed.ncbi.nlm.nih.gov/22449948 |
Showing 1 to 3 of 3 entries