Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL1742484 | 60306 | None | 2 | Human | Binding | EC50 | = | 250.00 | 6.60 | - | 6 | Agonist activity at human GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/chimeric Galphaq/i1 assessed as induction of AP-TGFalpha release after 1 hr | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00693 | |
| CHEMBL1742484 | 60306 | None | 2 | Human | Binding | EC50 | = | 549.54 | 6.26 | - | 6 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL1742484 | 60306 | None | 2 | Human | Binding | EC50 | = | 550.00 | 6.26 | - | 6 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL1742484 | 60306 | None | 2 | Human | Binding | EC50 | = | 245.47 | 6.61 | - | 6 | Agonist activity at human GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/chimeric Galphaq/i1 assessed as induction of AP-TGFalpha release after 1 hr | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00693 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 240.00 | 6.62 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293A cells cotransfected with chimeric Galphaq/il after 1.5 hrs by alkaline phosphatase tagged-TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.5b01925 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 239.88 | 6.62 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293A cells cotransfected with chimeric Galphaq/il after 1.5 hrs by alkaline phosphatase tagged-TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.5b01925 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 420.00 | 6.38 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/chimeric Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00693 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 416.87 | 6.38 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/chimeric Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.7b00693 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 230.00 | 6.64 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr by p-NPP substrate based microplate reader analysis | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.0c01126 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Binding | EC50 | = | 234.42 | 6.63 | - | 6 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr by p-NPP substrate based microplate reader analysis | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.0c01126 | |
| CHEMBL3577137 | 121214 | None | 0 | Mouse | Binding | EC50 | = | 540.00 | 6.27 | - | 3 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr by p-NPP substrate based microplate reader analysis | ChEMBL | 507.3 | 24 | 3 | 7 | 5.50 | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.0c01126 | |
| CHEMBL3577137 | 121214 | None | 0 | Mouse | Binding | EC50 | = | 537.03 | 6.27 | - | 3 | Agonist activity at mouse GPR34 expressed in HEK293 cells co-transfected with AP-TGFalpha/Galphaq/i1 assessed as induction of ectodomain shedding of membrane bound AP-TGFalpha after 1 hr by p-NPP substrate based microplate reader analysis | ChEMBL | 507.3 | 24 | 3 | 7 | 5.50 | CCCCCCCC/C=C\CCCCCCCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/acs.jmedchem.0c01126 | |
| CHEMBL3577138 | 121215 | None | 0 | Human | Binding | EC50 | = | 416.87 | 6.38 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577138 | 121215 | None | 0 | Human | Binding | EC50 | = | 410.00 | 6.39 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577140 | 121216 | None | 0 | Human | Binding | EC50 | = | 320.00 | 6.50 | - | 2 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 535.3 | 24 | 3 | 7 | 6.14 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)(C)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577140 | 121216 | None | 0 | Human | Binding | EC50 | = | 316.23 | 6.50 | - | 2 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 535.3 | 24 | 3 | 7 | 6.14 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)(C)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577144 | 121219 | None | 0 | Human | Binding | EC50 | = | 1348.96 | 5.87 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 495.3 | 22 | 4 | 8 | 3.69 | CCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577144 | 121219 | None | 0 | Human | Binding | EC50 | = | 1400.00 | 5.85 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 495.3 | 22 | 4 | 8 | 3.69 | CCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577145 | 121220 | None | 2 | Human | Binding | EC50 | = | 290.00 | 6.54 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 497.3 | 23 | 4 | 8 | 3.92 | CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
| CHEMBL3577145 | 121220 | None | 2 | Human | Binding | EC50 | = | 288.40 | 6.54 | - | 3 | Agonist activity at GPR34 (unknown origin) transfected in HEK293A cells after 1 hr by TGFalpha shedding assay | ChEMBL | 497.3 | 23 | 4 | 8 | 3.92 | CCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm5020082 | |
Showing 1 to 20 of 200 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Functional | EC50 | = | 290.00 | 6.54 | -17 | 6 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL1742484 | 60306 | None | 2 | Mouse | Functional | EC50 | = | 295.12 | 6.53 | -17 | 6 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 523.3 | 24 | 4 | 8 | 4.47 | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL4072692 | 157039 | None | 0 | Mouse | Functional | EC50 | = | 220.00 | 6.66 | -2 | 3 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 573.2 | 17 | 3 | 9 | 4.47 | N[C@@H](COP(=O)(O)OCCCOC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL4072692 | 157039 | None | 0 | Mouse | Functional | EC50 | = | 218.78 | 6.66 | -2 | 3 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 573.2 | 17 | 3 | 9 | 4.47 | N[C@@H](COP(=O)(O)OCCCOC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5393782 | 194941 | None | 0 | Mouse | Functional | EC50 | = | 1600.00 | 5.80 | -602 | 2 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 544.3 | 23 | 3 | 8 | 4.41 | CCCCCCCCCCCOc1ccccc1CCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5393782 | 194941 | None | 0 | Mouse | Functional | EC50 | = | 1621.81 | 5.79 | -602 | 2 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 544.3 | 23 | 3 | 8 | 4.41 | CCCCCCCCCCCOc1ccccc1CCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(N)=O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5398282 | 195181 | None | 0 | Mouse | Functional | EC50 | = | 950.00 | 6.02 | -27 | 2 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 613.2 | 16 | 3 | 8 | 5.64 | CC(C)(C)c1ccc(-c2cccc(COc3ccccc3CCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(=O)O)c2)cc1 | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5398282 | 195181 | None | 0 | Mouse | Functional | EC50 | = | 954.99 | 6.02 | -27 | 2 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 613.2 | 16 | 3 | 8 | 5.64 | CC(C)(C)c1ccc(-c2cccc(COc3ccccc3CCC(=O)OCCCOP(=O)(O)OC[C@H](N)C(=O)O)c2)cc1 | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5410755 | 195786 | None | 0 | Mouse | Functional | EC50 | = | 180.00 | 6.75 | - | 1 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 629.2 | 16 | 3 | 10 | 4.63 | N[C@@H](COP(=O)(O)OC1CCCO[C@@H]1COC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| CHEMBL5410755 | 195786 | None | 0 | Mouse | Functional | EC50 | = | 177.83 | 6.75 | - | 1 | Agonist activity at mouse LPS1/GPR34 transfected in HEK293-A cells co-transfected with AP-TGFalpha assessed as AP-TGFalpha release by TGFalpha shedding assay | ChEMBL | 629.2 | 16 | 3 | 10 | 4.63 | N[C@@H](COP(=O)(O)OC1CCCO[C@@H]1COC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2023.115271 | |
| lysophosphatidylserine | 2435 | None | 0 | Human | Functional | pEC50 | = | - | 6.73 | -3 | 3 | Unclassified | Guide to Pharmacology | 525.3 | 25 | 4 | 8 | 4.70 | CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/16460680 | |
| lysophosphatidylserine | 2435 | None | 0 | Human | Functional | pEC50 | = | - | 6.73 | -3 | 3 | Unclassified | Guide to Pharmacology | 525.3 | 25 | 4 | 8 | 4.70 | CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/22343749 | |
| lysophosphatidylserine | 2435 | None | 0 | Mouse | Functional | pEC50 | = | - | 7.31 | 1 | 3 | Unclassified | Guide to Pharmacology | 525.3 | 25 | 4 | 8 | 4.70 | CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@H](N)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/16460680 | |
| YL-365 | 4114 | None | 0 | Human | Functional | pIC50 | = | - | 7.77 | - | 1 | Unclassified | Guide to Pharmacology | 582.2 | 9 | 2 | 4 | 6.00 | O=C(Cc1ccc(OCc2ccccc2)cc1)NC1(C(=O)O)CCN(C(=O)c2ccc(-c3cccc(Cl)c3)cc2)CC1 | https://pubmed.ncbi.nlm.nih.gov/21193033 | |
Showing 1 to 14 of 14 entries