Ligand source activities (1 row/activity)
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 12948 | 7808 | 0 | None | - | 1 | Human | 8.0 | pIC50 | = | 8 | Functional | Guide to Pharmacology | 524 | 12 | 1 | 10 | 2.7 | CCOC1=CC(C)=NC(=N1)N(CCOC)S(=O)(=O)C2=CC=C(NCC3=C(F)C=NC=C3F)N=C2OC | 37741852 | ||
| 168510218 | 7808 | 0 | None | - | 1 | Human | 8.0 | pIC50 | = | 8 | Functional | Guide to Pharmacology | 524 | 12 | 1 | 10 | 2.7 | CCOC1=CC(C)=NC(=N1)N(CCOC)S(=O)(=O)C2=CC=C(NCC3=C(F)C=NC=C3F)N=C2OC | 37741852 | ||
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |