Ligand source activities (1 row/activity)
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
| 10883396 | 10421 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 5283560 | 10421 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 911 | 10421 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| CHEMBL225155 | 10421 | 45 | None | -660 | 15 | Human | 6.1 | pEC50 | = | 6.1 | Functional | Guide to Pharmacology | 379 | 17 | 4 | 4 | 4.0 | CCCCCCCCCCCCC/C=C/[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 2921 | 8204 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 44317142 | 8204 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 644260 | 8204 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| CHEMBL78494 | 8204 | 0 | None | -67 | 2 | Human | 6.2 | pEC50 | = | 6.2 | Functional | Guide to Pharmacology | 381 | 18 | 4 | 4 | 4.3 | CCCCCCCCCCCCCCC[C@H]([C@H](COP(=O)(O)O)N)O | 12618218 | ||
| 5512 | 8212 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Guide to Pharmacology | 701 | 36 | 2 | 6 | 11.6 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O | 12618218 | ||
| 9547172 | 8212 | 0 | None | - | 1 | Human | 6.3 | pEC50 | = | 6.3 | Functional | Guide to Pharmacology | 701 | 36 | 2 | 6 | 11.6 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)O | 12618218 | ||
| Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |