Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| No data available in table | |||||||||||||||||||||
Showing 0 to 0 of 0 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| A77636 | 208 | None | 8 | Human | Functional | IC50 | = | 1449.00 | 5.84 | -478 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 329.2 | 2 | 3 | 4 | 3.25 | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| aprepitant | 448 | None | 58 | Human | Functional | IC50 | = | 1873.60 | 5.73 | -7943 | 8 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 534.1 | 6 | 2 | 5 | 4.95 | C[C@@H](O[C@H]1OCCN(Cc2nc(=O)[nH][nH]2)[C@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| BX 471 | 758 | None | 42 | Human | Functional | IC50 | = | 2373.76 | 5.62 | -354 | 5 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 434.2 | 6 | 2 | 4 | 3.08 | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)COc1ccc(Cl)cc1NC(N)=O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CAY10441 | 811 | None | 43 | Human | Functional | IC50 | = | 4754.08 | 5.32 | -1905 | 3 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 309.2 | 5 | 2 | 4 | 3.44 | CC(C)Oc1ccc(Cc2ccc(NC3=NCCN3)cc2)cc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL103769 | 4750 | None | 24 | Human | Functional | IC50 | = | 2385.48 | 5.62 | -89 | 29 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 554.0 | 11 | 3 | 4 | 5.37 | S=C(NCCCc1c[nH]cn1)NCCCN(Cc1ccc(Cl)c(Cl)c1)c1ccc(Br)cn1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL103769 | 4750 | None | 24 | Human | Functional | IC50 | = | 2628.56 | 5.58 | -89 | 29 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 554.0 | 11 | 3 | 4 | 5.37 | S=C(NCCCc1c[nH]cn1)NCCCN(Cc1ccc(Cl)c(Cl)c1)c1ccc(Br)cn1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL1766103 | 61270 | None | 22 | Human | Functional | IC50 | = | 2905.32 | 5.54 | -602 | 22 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 432.2 | 6 | 2 | 4 | 6.27 | Cc1cc(C)cc(-c2cnc3cc(Cl)c(-c4cccc(O)c4)cc3c2OCCCN)c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL2030155 | 74688 | None | 32 | Human | Functional | IC50 | = | 5795.16 | 5.24 | -301 | 4 | GPCR PRESTO-Tango dose-response in antagonist mode with target: GPR65 | ChEMBL | 509.2 | 6 | 2 | 4 | 4.28 | CN(C)S(=O)(=O)c1ccc(NC(=S)N2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
| CHEMBL5398106 | 195175 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 367.1 | 1 | 1 | 4 | 3.32 | O=C(Nc1ncc(C(F)(F)F)cn1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5400100 | 195284 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 391.1 | 1 | 1 | 4 | 3.80 | N#Cc1ccc(NC(=O)N2[C@H]3CC[C@@H]2c2ccnc(F)c2C3)nc1C(F)(F)F | - | |
| CHEMBL5400228 | 195291 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 383.1 | 1 | 1 | 4 | 3.84 | O=C(Nc1cc(Cl)c(C(F)(F)F)cn1)N1C2CCC1c1cncnc1C2 | - | |
| CHEMBL5402018 | 195363 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 364.1 | 3 | 1 | 4 | 3.51 | O=C(Nc1ccc(OC(F)F)cn1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5403385 | 195421 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 365.1 | 2 | 1 | 5 | 3.56 | O=C(Nc1nc(-c2ccccc2)no1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5404390 | 195473 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 382.1 | 1 | 2 | 3 | 3.22 | O=C(Nc1cc(C(F)(F)F)ncc1F)N1[C@H]2CC[C@@H]1c1c[nH]c(=O)cc1C2 | - | |
| CHEMBL5406035 | 195557 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 333.1 | 2 | 1 | 5 | 2.93 | CCc1nnc(NC(=O)N2[C@H]3CC[C@@H]2c2ccnc(F)c2C3)s1 | - | |
| CHEMBL5406392 | 195577 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 382.1 | 2 | 1 | 6 | 3.43 | O=C(Nc1nnc(-c2ccncc2)s1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5407784 | 195635 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 365.1 | 2 | 1 | 5 | 3.56 | O=C(Nc1nnc(-c2ccccc2)o1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5413335 | 195917 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 323.1 | 1 | 1 | 4 | 2.78 | N#Cc1ccc(NC(=O)N2[C@H]3CC[C@@H]2c2ccnc(F)c2C3)nc1 | - | |
| CHEMBL5417806 | 196157 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 366.0 | 1 | 1 | 3 | 4.22 | O=C(Nc1ccc(Cl)c(Cl)n1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 | - | |
| CHEMBL5420624 | 196293 | None | 0 | Human | Functional | IC50 | = | 500.00 | 6.30 | - | 1 | Antagonist activity at recombinant human GPR65 expressed in human 1321N1 cells assessed as reduction in cAMP level incubated for 30 mins by HTRF assay | ChEMBL | 390.1 | 3 | 1 | 4 | 4.70 | O=C(Nc1ccc(Oc2ccccc2)nc1)N1C2CCC1c1ccnc(F)c1C2 | - | |
Showing 1 to 20 of 56 entries