Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 56707820 | 2910 | None | 38 | Human | Functional | pEC50 | = | 6.8 | 6.8 | - | 1 | Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68 |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
| 9155 | 2910 | None | 38 | Human | Functional | pEC50 | = | 6.8 | 6.8 | - | 1 | Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68 |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
| CHEMBL4548689 | 2910 | None | 38 | Human | Functional | pEC50 | = | 6.8 | 6.8 | - | 1 | Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68 |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL5209897 | ||
| 10572 | 3148 | None | 0 | Human | Functional | pEC50 | = | 5.9 | 5.9 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 145996515 | 3148 | None | 0 | Human | Functional | pEC50 | = | 5.9 | 5.9 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 10571 | 802 | None | 0 | Human | Functional | pEC50 | = | 6.0 | 6.0 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 145996514 | 802 | None | 0 | Human | Functional | pEC50 | = | 6.0 | 6.0 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 10570 | 2971 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 145996513 | 2971 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | None | None | None | None | 31675498 | ||||
| 56707820 | 2910 | None | 38 | Human | Functional | pKB | = | 5.0 | 5.0 | - | 1 | Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor.Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor. |
Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
| 9155 | 2910 | None | 38 | Human | Functional | pKB | = | 5.0 | 5.0 | - | 1 | Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor.Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor. |
Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
| CHEMBL4548689 | 2910 | None | 38 | Human | Functional | pKB | = | 5.0 | 5.0 | - | 1 | Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor.Allosteric ligand biochemical binding affinity in the presence of protons (H<sup>+</sup>. Affinity cannot be measured in the absence of endogenous ligand for this receptor. |
Guide to Pharmacology | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 26550826 | ||
| 10440 | 2680 | None | 22 | Human | Functional | pKB | = | 5.9 | 5.9 | -4 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 | ||
| 139030523 | 2680 | None | 22 | Human | Functional | pKB | = | 5.9 | 5.9 | -4 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 | ||
| CHEMBL4449712 | 2680 | None | 22 | Human | Functional | pKB | = | 5.9 | 5.9 | -4 | 3 | UnclassifiedUnclassified |
Guide to Pharmacology | 417 | 7 | 3 | 7 | 4.2 | OCc1cccc(c1c1nc(NCc2ccc(cc2)Oc2ccccc2)nc(n1)N)F | 31298539 | ||
Showing 1 to 15 of 15 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 56707820 | 2910 | None | 38 | Human | Binding | pEC50 | = | 6.8 | 6.8 | - | 1 | FLIPR-TETRA assayFLIPR-TETRA assay |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL4507323 | ||
| 9155 | 2910 | None | 38 | Human | Binding | pEC50 | = | 6.8 | 6.8 | - | 1 | FLIPR-TETRA assayFLIPR-TETRA assay |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL4507323 | ||
| CHEMBL4548689 | 2910 | None | 38 | Human | Binding | pEC50 | = | 6.8 | 6.8 | - | 1 | FLIPR-TETRA assayFLIPR-TETRA assay |
ChEMBL | 307 | 5 | 3 | 6 | 2.2 | OCc1ccccc1c1nc(NCc2ccccc2)nc(n1)N | 10.6019/CHEMBL4507323 | ||
Showing 1 to 3 of 3 entries