Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
ogerin | 2910 | None | 38 | Human | Binding | EC50 | = | 147.91 | 6.83 | - | 2 | FLIPR-TETRA assay | ChEMBL | 307.1 | 5 | 3 | 6 | 2.23 | Nc1nc(NCc2ccccc2)nc(-c2ccccc2CO)n1 | https://dx.doi.org/10.6019/CHEMBL4507323 |
Showing 1 to 1 of 1 entry
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CARTPT (76-96) | 802 | None | 0 | Human | Functional | pEC50 | = | - | 5.98 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/31675498 | |
MS48107 | 2680 | None | 22 | Human | Functional | pKB | = | - | 5.85 | -4 | 4 | Unclassified | Guide to Pharmacology | 417.2 | 7 | 3 | 7 | 4.16 | Nc1nc(NCc2ccc(Oc3ccccc3)cc2)nc(-c2c(F)cccc2CO)n1 | https://pubmed.ncbi.nlm.nih.gov/31298539 | |
ogerin | 2910 | None | 38 | Human | Functional | EC50 | = | 148.00 | 6.83 | - | 2 | Affinity Phenotypic Cellular interaction (FLIPR-TETRA assay (proton-mediated calcium mobilization in HEK293T cells)) EUB0000354a GPR68 | ChEMBL | 307.1 | 5 | 3 | 6 | 2.23 | Nc1nc(NCc2ccccc2)nc(-c2ccccc2CO)n1 | https://dx.doi.org/10.6019/CHEMBL5209897 | |
ogerin | 2910 | None | 38 | Human | Functional | pKB | = | - | 4.97 | - | 2 | Allosteric ligand biochemical binding affinity in the presence of protons (H+. Affinity cannot be measured in the absence of endogenous ligand for this receptor. | Guide to Pharmacology | 307.1 | 5 | 3 | 6 | 2.23 | Nc1nc(NCc2ccccc2)nc(-c2ccccc2CO)n1 | https://pubmed.ncbi.nlm.nih.gov/26550826 | |
OSTN (115-133) | 2971 | None | 0 | Human | Functional | pEC50 | = | - | 6.42 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/31675498 | |
Pomc (141-162) | 3148 | None | 0 | Human | Functional | pEC50 | = | - | 5.89 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/31675498 |
Showing 1 to 6 of 6 entries