Ligand source activities (1 row/activity)
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Potency) |
# tested GPCRs (Potency) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |
2906 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 17905198 | ||
2906 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 18466763 | ||
5395 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 17905198 | ||
5395 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 18466763 | ||
5497152 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 17905198 | ||
5497152 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 18466763 | ||
CHEMBL1222042 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 17905198 | ||
CHEMBL1222042 | 9134 | 18 | None | -4 | 12 | Human | 7.4 | pEC50 | = | 7.4 | Functional | Guide to Pharmacology | 436 | 20 | 3 | 5 | 5.0 | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)O)O | 18466763 |
Ligands | Receptor | Assay information | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name |
GPCRdb ID | #Vendors | Reference ligand |
Fold selectivity (Affinity) |
# tested GPCRs (Affinity) |
Species | p-value (-log) |
Type | Activity Relation |
Activity Value |
Assay Type | Assay Description | Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI |