Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 11337 | 2928 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Measuring β-arrestin recruitment using the PathHunter assay system.Measuring β-arrestin recruitment using the PathHunter assay system. |
Guide to Pharmacology | 440 | 4 | 0 | 4 | 3.9 | O=c1c2CN(CCc2n2c(=NCC2)n1Cc1ccc(cc1)C(F)(F)F)Cc1ccccc1 | 31127149 | ||
| 124085867 | 2928 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Measuring β-arrestin recruitment using the PathHunter assay system.Measuring β-arrestin recruitment using the PathHunter assay system. |
Guide to Pharmacology | 440 | 4 | 0 | 4 | 3.9 | O=c1c2CN(CCc2n2c(=NCC2)n1Cc1ccc(cc1)C(F)(F)F)Cc1ccccc1 | 31127149 | ||
| 5312830 | 188 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
| 5567 | 188 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
| CHEMBL1230670 | 188 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
| DB07302 | 188 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 296 | 14 | 2 | 2 | 4.9 | CCCCC/C=C\C=C\[C@H](CCCCCCCC(=O)O)O | 16236715 | ||
| 12945 | 2869 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 351 | 6 | 2 | 4 | 4.0 | CC1=C(OC2=C1C=C(NC(=O)CCC(=O)C3=CC=CC=C3)C=C2)C(O)=O | 37770763 | ||
| 168654812 | 2869 | None | 0 | Human | Functional | pEC50 | = | 7.3 | 7.3 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 351 | 6 | 2 | 4 | 4.0 | CC1=C(OC2=C1C=C(NC(=O)CCC(=O)C3=CC=CC=C3)C=C2)C(O)=O | 37770763 | ||
| 12944 | 2868 | None | 0 | Human | Functional | pIC50 | = | 7.8 | 7.8 | - | 1 | Efficacy 90%Efficacy 90% |
Guide to Pharmacology | 359 | 6 | 2 | 4 | 3.0 | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(O)=O | 37770763 | ||
| 4319354 | 2868 | None | 0 | Human | Functional | pIC50 | = | 7.8 | 7.8 | - | 1 | Efficacy 90%Efficacy 90% |
Guide to Pharmacology | 359 | 6 | 2 | 4 | 3.0 | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)NCCC3=CC=CC=C3)C(O)=O | 37770763 | ||
Showing 1 to 10 of 10 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| No data available in table | ||||||||||||||||||||||
Showing 0 to 0 of 0 entries