Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| No data available in table | |||||||||||||||||||||
Showing 0 to 0 of 0 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| 9-hydroxyoctadecadienoic acid | 188 | None | 0 | Human | Functional | pEC50 | = | - | 5.70 | - | 1 | Unclassified | Guide to Pharmacology | 296.2 | 14 | 2 | 2 | 4.86 | CCCCC/C=C\C=C\[C@@H](O)CCCCCCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/16236715 | |
| NOX-6-18 | 2868 | None | 0 | Human | Functional | pIC50 | = | - | 7.77 | - | 1 | Efficacy 90% | Guide to Pharmacology | 359.1 | 6 | 2 | 4 | 2.96 | Cc1c(C(=O)O)oc2ccc(S(=O)(=O)NCCc3ccccc3)cc12 | https://pubmed.ncbi.nlm.nih.gov/37770763 | |
| NOX-6-7 | 2869 | None | 0 | Human | Functional | pEC50 | = | - | 7.30 | - | 1 | Unclassified | Guide to Pharmacology | 351.1 | 6 | 2 | 4 | 4.04 | Cc1c(C(=O)O)oc2ccc(NC(=O)CCC(=O)c3ccccc3)cc12 | https://pubmed.ncbi.nlm.nih.gov/37770763 | |
| ONC212 | 2928 | None | 0 | Human | Functional | pEC50 | = | - | 6.39 | - | 1 | Measuring β-arrestin recruitment using the PathHunter assay system. | Guide to Pharmacology | 440.2 | 4 | 0 | 4 | 3.88 | O=C1C2=C(CCN(Cc3ccccc3)C2)N2CCN=C2N1Cc1ccc(C(F)(F)F)cc1 | https://pubmed.ncbi.nlm.nih.gov/31127149 | |
Showing 1 to 4 of 4 entries