Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| CHEMBL2017410 | 73565 | None | 0 | Human | Binding | EC50 | = | 252.00 | 6.60 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 438.2 | 6 | 1 | 7 | 4.24 | COc1cc(-c2cn(CC(=O)Nc3cccc4ccccc34)nn2)ccc1-n1cnc(C)c1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL2017410 | 73565 | None | 0 | Human | Binding | EC50 | = | 115.00 | 6.94 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 438.2 | 6 | 1 | 7 | 4.24 | COc1cc(-c2cn(CC(=O)Nc3cccc4ccccc34)nn2)ccc1-n1cnc(C)c1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL2017410 | 73565 | None | 0 | Mouse | Binding | EC50 | = | 23.00 | 7.64 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 438.2 | 6 | 1 | 7 | 4.24 | COc1cc(-c2cn(CC(=O)Nc3cccc4ccccc34)nn2)ccc1-n1cnc(C)c1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL2017410 | 73565 | None | 0 | Mouse | Binding | EC50 | = | 37.00 | 7.43 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 438.2 | 6 | 1 | 7 | 4.24 | COc1cc(-c2cn(CC(=O)Nc3cccc4ccccc34)nn2)ccc1-n1cnc(C)c1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL2430983 | 92425 | None | 0 | Mouse | Binding | EC50 | = | 31.00 | 7.51 | - | 2 | Agonist activity at mouse GPR142 | ChEMBL | 379.2 | 8 | 3 | 6 | 1.71 | Cn1nc(-c2ccncc2)cc1NC(=O)[C@H](Cc1ccccc1)NCC(=O)O | https://dx.doi.org/10.1021/ml4000854 | |
| CHEMBL3895853 | 143235 | None | 0 | Human | Binding | EC50 | = | 4995.00 | 5.30 | - | 1 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 440.1 | 5 | 0 | 6 | 4.41 | Cc1nccn1-c1ccc(-c2cn(CC(=O)N(C)c3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896713 | 143348 | None | 0 | Human | Binding | EC50 | = | 77.00 | 7.11 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)c(F)c2)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896713 | 143348 | None | 0 | Human | Binding | EC50 | = | 79.00 | 7.10 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)c(F)c2)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896713 | 143348 | None | 0 | Mouse | Binding | EC50 | = | 19.00 | 7.72 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)c(F)c2)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896713 | 143348 | None | 0 | Mouse | Binding | EC50 | = | 687.00 | 6.16 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)c(F)c2)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896896 | 143365 | None | 0 | Human | Binding | EC50 | = | 716.00 | 6.14 | - | 1 | Agonist activity at human GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 440.1 | 6 | 1 | 6 | 4.44 | Cc1nccn1Cc1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3896896 | 143365 | None | 0 | Human | Binding | EC50 | = | 589.00 | 6.23 | - | 1 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 440.1 | 6 | 1 | 6 | 4.44 | Cc1nccn1Cc1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3903475 | 144180 | None | 0 | Human | Binding | EC50 | = | 32.00 | 7.50 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)cc2F)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3903475 | 144180 | None | 0 | Human | Binding | EC50 | = | 38.00 | 7.42 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)cc2F)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3903475 | 144180 | None | 0 | Mouse | Binding | EC50 | = | 9.00 | 8.05 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)cc2F)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3903475 | 144180 | None | 0 | Mouse | Binding | EC50 | = | 78.00 | 7.11 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 444.1 | 5 | 1 | 6 | 4.52 | Cc1cn(-c2ccc(-c3cn(CC(=O)Nc4cccc(Cl)c4Cl)nn3)cc2F)cn1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3905835 | 144465 | None | 0 | Human | Binding | EC50 | = | 12.00 | 7.92 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 426.1 | 5 | 1 | 6 | 4.38 | Cc1nccn1-c1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3905835 | 144465 | None | 0 | Human | Binding | EC50 | = | 25.00 | 7.60 | - | 2 | Agonist activity at human GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 426.1 | 5 | 1 | 6 | 4.38 | Cc1nccn1-c1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3905835 | 144465 | None | 0 | Mouse | Binding | EC50 | = | 27.00 | 7.57 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured for 3 to 5 mins by Fluo-4AM dye-based FLIPR assay | ChEMBL | 426.1 | 5 | 1 | 6 | 4.38 | Cc1nccn1-c1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
| CHEMBL3905835 | 144465 | None | 0 | Mouse | Binding | EC50 | = | 3.00 | 8.52 | - | 2 | Agonist activity at mouse GPR142 expressed in CHO cells measured after 30 to 60 mins by IP-One assay | ChEMBL | 426.1 | 5 | 1 | 6 | 4.38 | Cc1nccn1-c1ccc(-c2cn(CC(=O)Nc3cccc(Cl)c3Cl)nn2)cc1 | https://dx.doi.org/10.1021/acsmedchemlett.6b00314 | |
Showing 1 to 20 of 109 entries
| Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |