Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
adomeglivant | 287 | None | 32 | Human | Binding | pKi | = | - | 8.18 | - | 1 | Unclassified | Guide to Pharmacology | 555.3 | 10 | 2 | 3 | 7.93 | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)NCCC(=O)O)cc2)cc(C)c1-c1ccc(C(C)(C)C)cc1 | https://pubmed.ncbi.nlm.nih.gov/26681715 | |
adomeglivant | 287 | None | 32 | Human | Binding | pKi | = | - | 8.18 | - | 1 | Unclassified | Guide to Pharmacology | 555.3 | 10 | 2 | 3 | 7.93 | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)NCCC(=O)O)cc2)cc(C)c1-c1ccc(C(C)(C)C)cc1 | https://pubmed.ncbi.nlm.nih.gov/25656305 | |
adomeglivant | 287 | None | 32 | Human | Binding | Ki | = | 6.60 | 8.18 | - | 1 | Inhibition of human GCGR receptor | ChEMBL | 555.3 | 10 | 2 | 3 | 7.93 | Cc1cc(O[C@@H](CCC(F)(F)F)c2ccc(C(=O)NCCC(=O)O)cc2)cc(C)c1-c1ccc(C(C)(C)C)cc1 | https://dx.doi.org/10.1016/j.ejmech.2018.04.061 | |
BAY27-9955 | 580 | None | 14 | Human | Binding | Ki | = | 356.00 | 6.45 | - | 1 | Displacement of [125I]Glucagon-Cex from human GCGR | ChEMBL | 342.2 | 6 | 1 | 1 | 6.75 | CCCc1c(C(C)C)cc(C(C)C)c(C(C)O)c1-c1ccc(F)cc1 | https://dx.doi.org/10.1016/j.bmcl.2011.10.113 | |
CHEMBL104137 | 4806 | None | 0 | Human | Binding | IC50 | = | 10000.00 | 5.00 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 321.1 | 4 | 2 | 5 | 2.71 | COc1cc(C(=O)N/N=C/c2ccnc3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL104338 | 4864 | None | 0 | Human | Binding | IC50 | = | 2900.00 | 5.54 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 350.1 | 5 | 2 | 5 | 3.33 | COc1cc(C(=O)N/N=C/c2ccc(OC)c3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL104735 | 4945 | None | 0 | Human | Binding | IC50 | = | 720.00 | 6.14 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 336.1 | 4 | 3 | 5 | 3.02 | COc1cc(C(=O)N/N=C/c2ccc(O)c3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL104761 | 4951 | None | 0 | Human | Binding | IC50 | = | 4800.00 | 5.32 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 320.1 | 4 | 2 | 4 | 3.32 | COc1cc(C(=O)N/N=C/c2cccc3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL105565 | 5098 | None | 0 | Human | Binding | IC50 | = | 12000.00 | 4.92 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 384.1 | 5 | 2 | 5 | 4.39 | COc1cc(C(=O)N/N=C/c2ccc(-c3ccc(C)c(Cl)c3)o2)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106058 | 5191 | None | 0 | Human | Binding | IC50 | = | 60000.00 | 4.22 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 370.1 | 4 | 3 | 5 | 3.68 | COc1cc(C(=O)N/N=C/c2ccc(O)c3ccccc23)cc(Cl)c1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106134 | 5209 | None | 7 | Human | Binding | IC50 | = | 4900.00 | 5.31 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 320.1 | 4 | 2 | 4 | 3.32 | COc1ccc(/C=N/NC(=O)c2ccc(O)cc2)c2ccccc12 | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106294 | 5239 | None | 0 | Human | Binding | IC50 | = | 8100.00 | 5.09 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 363.2 | 5 | 2 | 5 | 3.38 | COc1cc(C(=O)N/N=C/c2ccc(N(C)C)c3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106320 | 5243 | None | 0 | Human | Binding | IC50 | = | 43000.00 | 4.37 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 312.1 | 5 | 2 | 4 | 3.29 | COc1cc(C(=O)N/N=C/c2ccc(C(C)C)cc2)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106577 | 5294 | None | 0 | Human | Binding | IC50 | = | 6300.00 | 5.20 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 387.2 | 5 | 2 | 5 | 4.29 | CCn1c2ccccc2c2cc(/C=N/NC(=O)c3ccc(O)c(OC)c3)ccc21 | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL106795 | 5330 | None | 0 | Human | Binding | IC50 | = | 43000.00 | 4.37 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 354.1 | 5 | 2 | 5 | 3.06 | COc1cc(C(=O)N/N=C/c2ccc(OC(F)(F)F)cc2)ccc1O | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL107069 | 5386 | None | 0 | Human | Binding | IC50 | = | 390.00 | 6.41 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 324.1 | 3 | 3 | 4 | 3.15 | O=C(N/N=C/c1ccc(O)c2ccccc12)c1ccc(O)c(F)c1 | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL107070 | 5387 | None | 0 | Human | Binding | IC50 | = | 200.00 | 6.70 | - | 1 | Binding affinity towards human Glucagon Receptor by the displacement of [125I]-glucagon | ChEMBL | 340.1 | 3 | 3 | 4 | 3.67 | O=C(N/N=C/c1ccc(O)c2ccccc12)c1ccc(O)c(Cl)c1 | https://dx.doi.org/10.1021/jm000547o | |
CHEMBL107070 | 5387 | None | 0 | Human | Binding | IC50 | = | 203.00 | 6.69 | - | 1 | In vitro binding affinity for recombinant human glucagon receptor (hGGR) in BHK cells | ChEMBL | 340.1 | 3 | 3 | 4 | 3.67 | O=C(N/N=C/c1ccc(O)c2ccccc12)c1ccc(O)c(Cl)c1 | https://dx.doi.org/10.1021/jm0208572 | |
CHEMBL107070 | 5387 | None | 0 | Human | Binding | IC50 | = | 200.00 | 6.70 | - | 1 | In vitro inhibitory activity against human glucagon receptor using [127I]-labeled glucagon | ChEMBL | 340.1 | 3 | 3 | 4 | 3.67 | O=C(N/N=C/c1ccc(O)c2ccccc12)c1ccc(O)c(Cl)c1 | https://dx.doi.org/10.1016/s0960-894x(01)00819-8 | |
CHEMBL107258 | 5422 | None | 2 | Human | Binding | IC50 | = | 23000.00 | 4.64 | - | 1 | Binding affinity for human Glucagon Receptor | ChEMBL | 309.1 | 4 | 3 | 4 | 2.65 | COc1cc(C(=O)N/N=C/c2c[nH]c3ccccc23)ccc1O | https://dx.doi.org/10.1021/jm000547o |
Showing 1 to 20 of 1,251 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
CEPHALOCHROMIN | 177129 | None | 20 | Human | Functional | IC50 | = | 20000.00 | 4.70 | -1 | 2 | Antagonist activity at human glucagon receptor expressed in BHK21 cells assessed as inhibition of glucagon-induced cAMP elevation by RIA | ChEMBL | 518.1 | 1 | 6 | 10 | 4.60 | CC1CC(=O)c2c(cc3c(-c4c(O)cc(O)c5c(O)c6c(cc45)OC(C)CC6=O)c(O)cc(O)c3c2O)O1 | https://dx.doi.org/10.1021/np040093o | |
CHEMBL114761 | 9971 | None | 0 | Human | Functional | IC50 | = | 2000.00 | 5.70 | - | 1 | Inhibitory concentration against cAMP production in hGR-CHO cells | ChEMBL | 341.2 | 5 | 1 | 2 | 6.05 | CC(C)=Cc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(F)cc1 | https://dx.doi.org/10.1016/s0960-894x(01)00766-1 | |
CHEMBL1222075 | 211079 | None | 0 | Human | Functional | EC50 | = | 0.15 | 9.82 | 3 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222076 | 211080 | None | 0 | Human | Functional | EC50 | = | 0.05 | 10.31 | 3 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222077 | 211081 | None | 0 | Human | Functional | EC50 | = | 0.05 | 10.28 | 20 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222078 | 211082 | None | 0 | Human | Functional | EC50 | = | 0.10 | 10.00 | 2 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222079 | 211083 | None | 0 | Human | Functional | EC50 | = | 0.07 | 10.15 | 3 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222080 | 15664 | None | 0 | Human | Functional | EC50 | = | 0.05 | 10.27 | 2 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | 3536.6 | 117 | 55 | 51 | -16.68 | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)C[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222081 | 211084 | None | 0 | Human | Functional | EC50 | = | 0.10 | 10.00 | 1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCS(=O)(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222082 | 211085 | None | 0 | Human | Functional | EC50 | = | 0.07 | 10.17 | 8 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222083 | 211086 | None | 0 | Human | Functional | EC50 | = | 0.13 | 9.89 | 4 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)CNC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222084 | 211087 | None | 0 | Human | Functional | EC50 | = | 0.13 | 9.89 | 4 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222085 | 211088 | None | 0 | Human | Functional | EC50 | = | 0.08 | 10.11 | -1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222086 | 211089 | None | 0 | Human | Functional | EC50 | = | 0.47 | 9.33 | -30 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NCC(=O)O)C(C)C | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222087 | 211090 | None | 0 | Human | Functional | EC50 | = | 0.07 | 10.17 | -2 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222088 | 211091 | None | 0 | Human | Functional | EC50 | = | 0.05 | 10.32 | 1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222089 | 211092 | None | 0 | Human | Functional | EC50 | = | 0.09 | 10.06 | -3 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222090 | 211093 | None | 0 | Human | Functional | EC50 | = | 0.07 | 10.17 | 1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222091 | 211094 | None | 0 | Human | Functional | EC50 | = | 0.07 | 10.14 | -1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@H](C(N)=O)[C@@H](C)O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 | |
CHEMBL1222092 | 211095 | None | 0 | Human | Functional | EC50 | = | 0.08 | 10.10 | 1 | 2 | Agonist activity at GCGR expressed in HEK293 cells assessed as stimulation of cAMP production by luciferase reporter gene assay | ChEMBL | - | - | - | - | - | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)N[C@@H](Cc1cnc[nH]1)C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(N)=O)[C@@H](C)O | https://dx.doi.org/10.1038/nchembio.209 |
Showing 1 to 20 of 615 entries