Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
No data available in table |
Showing 0 to 0 of 0 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
A77636 | 208 | None | 8 | Human | Functional | IC50 | = | 2598.51 | 5.58 | -870 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 329.2 | 2 | 3 | 4 | 3.25 | NC[C@@H]1O[C@H](C23CC4CC(CC(C4)C2)C3)Cc2c1ccc(O)c2O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
JTC-801 | 2154 | None | 25 | Human | Functional | IC50 | = | 2839.13 | 5.55 | -93 | 30 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 411.2 | 6 | 2 | 4 | 5.52 | CCc1ccc(OCc2ccccc2C(=O)Nc2ccc3nc(C)cc(N)c3c2)cc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
loperamide | 2341 | None | 28 | Human | Functional | EC50 | = | 2040.77 | 5.69 | -1096 | 40 | GPCR PRESTO-Tango dose-response in agonist mode with target: ADGRF1 | ChEMBL | 476.2 | 7 | 1 | 3 | 5.09 | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
NCGC 84 | 2748 | None | 1 | Human | Functional | IC50 | = | 4996.80 | 5.30 | -588 | 24 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 465.2 | 6 | 0 | 2 | 5.00 | Cc1c(P(=S)(c2ccccc2)c2ccccc2)[n+]2ccccc2n1C/C=C/c1ccccc1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
PF-514273 | 3068 | None | 31 | Human | Functional | EC50 | = | 2041.85 | 5.69 | -3 | 10 | GPCR PRESTO-Tango dose-response in agonist mode with target: ADGRF1 | ChEMBL | 451.1 | 4 | 0 | 4 | 5.34 | CC(F)(F)CN1CCOc2c(nn(-c3ccccc3Cl)c2-c2ccc(Cl)cc2)C1=O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
PPTN | 3156 | None | 14 | Human | Functional | IC50 | = | 3204.21 | 5.49 | -831 | 33 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 475.2 | 4 | 2 | 2 | 7.36 | O=C(O)c1cc(-c2ccc(C3CCNCC3)cc2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
salmeterol | 3463 | None | 53 | Human | Functional | IC50 | = | 3409.69 | 5.47 | -6025 | 27 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 415.3 | 16 | 4 | 5 | 4.11 | OCc1cc(C(O)CNCCCCCCOCCCCc2ccccc2)ccc1O | https://dx.doi.org/10.6019/CHEMBL5442687 | |
SB 216641 | 3496 | None | 35 | Human | Functional | IC50 | = | 3893.51 | 5.41 | -1 | 30 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 486.2 | 9 | 1 | 7 | 5.22 | COc1ccc(NC(=O)c2ccc(-c3ccc(-c4noc(C)n4)cc3C)cc2)cc1OCCN(C)C | https://dx.doi.org/10.6019/CHEMBL5442687 | |
SSR240612 | 3680 | None | 7 | Human | Functional | IC50 | = | 5042.32 | 5.30 | -2 | 17 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 756.4 | 14 | 2 | 8 | 6.34 | COc1ccc2cc(S(=O)(=O)N[C@H](CC(=O)N[C@H](Cc3ccc(CN4[C@@H](C)CCC[C@H]4C)cc3)C(=O)N(C)C(C)C)c3ccc4c(c3)OCO4)ccc2c1 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
W54011 | 4068 | None | 4 | Human | Functional | IC50 | = | 2051.49 | 5.69 | -173 | 4 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 456.3 | 7 | 0 | 3 | 6.54 | COc1ccc2c(c1)C(C(=O)N(Cc1ccc(N(C)C)cc1)c1ccc(C(C)C)cc1)CCC2 | https://dx.doi.org/10.6019/CHEMBL5442687 | |
WAY-181187 | 4074 | None | 40 | Human | Functional | IC50 | = | 4063.51 | 5.39 | -630 | 25 | GPCR PRESTO-Tango dose-response in antagonist mode with target: ADGRF1 | ChEMBL | 380.0 | 4 | 1 | 7 | 2.74 | NCCc1cn(S(=O)(=O)c2c(Cl)nc3sccn23)c2ccccc12 | https://dx.doi.org/10.6019/CHEMBL5442687 |
Showing 1 to 11 of 11 entries