Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
(-)-2-aminoadipic acid | 218977 | Functional | 0 | Rat | Binding | pKi | = | 10000.00 | 5.00 | -1 | 2 | - | PDSP KiDatabase | 161.1 | 5 | 3 | 3 | -0.35 | NC(CCCC(=O)O)C(=O)O | - | |
(1R,2S)-PHENYLPROPANOLAMINE | 27120 | Functional | 13 | Rat | Binding | pKi | = | 10000.00 | 5.00 | -38 | 42 | - | PDSP KiDatabase | 151.1 | 2 | 2 | 2 | 1.07 | C[C@H](N)[C@H](O)c1ccccc1 | - | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Binding | EC50 | = | 82000.00 | 4.09 | -38 | 15 | Compound was tested for the inhibition of Metabotropic glutamate receptor 6 | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm970719q | |
1S, 3R-ACPD | 218660 | Functional | 0 | Human | Binding | pKi | = | 10000.00 | 5.00 | -2 | 7 | - | PDSP KiDatabase | 173.1 | 2 | 3 | 3 | -0.35 | NC1(C(=O)O)CCC(C(=O)O)C1 | - | |
AMAA | 218976 | Functional | 0 | Rat | Binding | pKi | = | 10000.00 | 5.00 | -1 | 2 | - | PDSP KiDatabase | 144.1 | 2 | 2 | 2 | -0.74 | CNC(=O)C(C)NC(C)=O | - | |
Cathinone, (-) | 218812 | Functional | 0 | Rat | Binding | pKi | = | 10000.00 | 5.00 | -13 | 40 | - | PDSP KiDatabase | 149.1 | 2 | 1 | 2 | 1.22 | CC(N)C(=O)c1ccccc1 | - | |
CHEMBL2381642 | 90086 | None | 1 | Human | Binding | EC50 | = | 4370.00 | 5.36 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 201.1 | 2 | 4 | 4 | -1.52 | N[C@@]1(C(=O)O)C[C@@H](O)[C@@H]2[C@H]1[C@H]2C(=O)O | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381644 | 90088 | None | 0 | Human | Binding | EC50 | = | 780.00 | 6.11 | - | 4 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 226.1 | 3 | 3 | 4 | -0.20 | [N-]=[N+]=N[C@@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381646 | 90090 | None | 0 | Human | Binding | EC50 | = | 11800.00 | 4.93 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 200.1 | 2 | 4 | 4 | -1.55 | N[C@@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381647 | 90091 | None | 1 | Human | Binding | EC50 | = | 9370.00 | 5.03 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 200.1 | 2 | 4 | 4 | -1.55 | N[C@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@H]12 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381648 | 90092 | None | 0 | Human | Binding | EC50 | = | 6690.00 | 5.17 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 242.1 | 3 | 4 | 4 | -1.38 | CC(=O)N[C@@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381649 | 90093 | None | 0 | Human | Binding | EC50 | = | 709.00 | 6.15 | - | 4 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 242.1 | 3 | 4 | 4 | -1.38 | CC(=O)N[C@H]1C[C@@](N)(C(=O)O)[C@@H]2[C@@H](C(=O)O)[C@H]12 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381650 | 90094 | None | 0 | Human | Binding | EC50 | = | 1270.00 | 5.90 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 293.1 | 4 | 3 | 4 | 1.28 | N[C@@]1(C(=O)O)C[C@@H](Sc2ccccc2)[C@H]2[C@H](C(=O)O)[C@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381651 | 90095 | None | 0 | Human | Binding | EC50 | = | 3250.00 | 5.49 | - | 3 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 293.1 | 4 | 3 | 4 | 1.28 | N[C@@]1(C(=O)O)C[C@H](Sc2ccccc2)[C@H]2[C@H](C(=O)O)[C@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL2381652 | 90096 | None | 0 | Human | Binding | EC50 | = | 1410.00 | 5.85 | - | 4 | Agonist activity at human mGlu6 receptor expressed in golden Syrian hamster AV12 cells coexpressing EAAT1 after 20 mins by FLIPR assay | ChEMBL | 203.1 | 2 | 3 | 3 | -0.54 | N[C@@]1(C(=O)O)C[C@@H](F)[C@H]2[C@H](C(=O)O)[C@H]21 | https://dx.doi.org/10.1021/jm4000165 | |
CHEMBL285843 | 99919 | None | 47 | Human | Binding | EC50 | = | 280.00 | 6.55 | -2 | 8 | Compound was tested for the inhibition of Metabotropic glutamate receptor 6 | ChEMBL | 183.0 | 4 | 4 | 3 | -1.03 | NC(CCP(=O)(O)O)C(=O)O | https://dx.doi.org/10.1021/jm970719q | |
CHEMBL285843 | 99919 | Functional | 47 | Human | Binding | pKi | = | 900.00 | 6.05 | -2 | 8 | - | PDSP KiDatabase | 183.0 | 4 | 4 | 3 | -1.03 | NC(CCP(=O)(O)O)C(=O)O | - | |
CHEMBL285843 | 99919 | Functional | 47 | Rat | Binding | pKi | = | 398.11 | 6.40 | -1 | 8 | - | PDSP KiDatabase | 183.0 | 4 | 4 | 3 | -1.03 | NC(CCP(=O)(O)O)C(=O)O | - | |
CHEMBL296054 | 101285 | None | 2 | Human | Binding | EC50 | = | 5300.00 | 5.28 | - | 5 | Compound was tested for the inhibition of Metabotropic glutamate receptor 6 | ChEMBL | 185.1 | 2 | 3 | 3 | -0.49 | N[C@@]1(C(=O)O)C[C@@H]2C[C@H]1[C@H]2C(=O)O | https://dx.doi.org/10.1021/jm970719q | |
CHEMBL315268 | 107054 | None | 0 | Rat | Binding | EC50 | = | 58000.00 | 4.24 | - | 2 | Effect on Metabotropic glutamate receptor 6 | ChEMBL | 200.1 | 4 | 3 | 5 | 0.03 | Cc1onc(O)c1CC[C@H](N)C(=O)O | https://dx.doi.org/10.1021/jm9703597 |
Showing 1 to 20 of 53 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
α-methylserine-O-phosphate | 365 | None | 0 | Rat | Functional | pEC50 | None | - | 4.10 | -15 | 4 | Unclassified | Guide to Pharmacology | 199.0 | 4 | 4 | 4 | -1.10 | CC(N)(COP(=O)(O)O)C(=O)O | https://pubmed.ncbi.nlm.nih.gov/12769621 | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Functional | pEC50 | None | - | 4.70 | -11 | 15 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://pubmed.ncbi.nlm.nih.gov/9144651 | |
(1S,3R)-ACPD | 33 | None | 30 | Human | Functional | Ki | = | 60000.00 | 4.22 | -11 | 15 | Agonist potency against cloned Metabotropic glutamate receptor 6 (mGluR-6). | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm000007r | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Functional | pEC50 | None | - | 4.20 | -17 | 15 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | - | |
(1S,3R)-ACPD | 33 | None | 30 | Rat | Functional | EC50 | = | 60000.00 | 4.22 | -17 | 15 | Tested for the agonistic activity against Metabotropic glutamate receptor 6 | ChEMBL | 173.1 | 2 | 3 | 3 | -0.35 | N[C@@]1(C(=O)O)CC[C@@H](C(=O)O)C1 | https://dx.doi.org/10.1016/S0960-894X(97)00068-1 | |
(R,S)-4-PPG | 2073 | None | 26 | Human | Functional | pEC50 | None | - | 5.30 | -25 | 7 | Unclassified | Guide to Pharmacology | 231.0 | 3 | 4 | 3 | -0.43 | NC(C(=O)O)c1ccc(P(=O)(O)O)cc1 | https://pubmed.ncbi.nlm.nih.gov/10336568 | |
(R,S)-4-PPG | 2073 | None | 26 | Human | Functional | pEC50 | None | - | 5.30 | -25 | 7 | Unclassified | Guide to Pharmacology | 231.0 | 3 | 4 | 3 | -0.43 | NC(C(=O)O)c1ccc(P(=O)(O)O)cc1 | https://pubmed.ncbi.nlm.nih.gov/11166323 | |
(R,S)-4-PPG | 2073 | None | 26 | Human | Functional | Ki | = | 4700.00 | 5.33 | -25 | 7 | Agonist potency against cloned Metabotropic glutamate receptor 6 (mGluR-6). | ChEMBL | 231.0 | 3 | 4 | 3 | -0.43 | NC(C(=O)O)c1ccc(P(=O)(O)O)cc1 | https://dx.doi.org/10.1021/jm000007r | |
(R,S)-4-PPG | 2073 | None | 26 | Rat | Functional | EC50 | = | 4700.00 | 5.33 | -23 | 7 | Metabotropic glutamate receptor 6 agonist activity to influence forskolin stimulated c-AMP formation in rat non neuronal cells | ChEMBL | 231.0 | 3 | 4 | 3 | -0.43 | NC(C(=O)O)c1ccc(P(=O)(O)O)cc1 | https://dx.doi.org/10.1021/jm030967o | |
(S)-3,4-DCPG | 2079 | None | 36 | Human | Functional | pEC50 | = | - | 5.40 | -114 | 8 | Unclassified | Guide to Pharmacology | 239.0 | 4 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(C(=O)O)c1 | https://pubmed.ncbi.nlm.nih.gov/11166323 | |
(S)-3,4-DCPG | 2079 | None | 36 | Human | Functional | EC50 | = | 3200.00 | 5.50 | -114 | 8 | Agonist activity at mGlu6 (unknown origin) expressed in HEK293 cells coexpressing chimeric Gq/i protein assessed as increase in intracellular calcium accumulation by Fluo-4 AM dye based fluorescence assay | ChEMBL | 239.0 | 4 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(C(=O)O)c1 | https://dx.doi.org/10.1021/acs.jmedchem.7b01438 | |
(S)-3,4-DCPG | 2079 | None | 36 | Rat | Functional | EC50 | = | 3600.00 | 5.44 | -117 | 8 | Metabotropic glutamate receptor 6 agonist activity to influence forskolin stimulated c-AMP formation in rat non neuronal cells | ChEMBL | 239.0 | 4 | 4 | 4 | 0.17 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(C(=O)O)c1 | https://dx.doi.org/10.1021/jm030967o | |
1-benzyl-APDC | 30 | None | 2 | Human | Functional | Ki | = | 20000.00 | 4.70 | - | 2 | Agonist potency against cloned Metabotropic glutamate receptor 6 (mGluR-6). | ChEMBL | 264.1 | 4 | 3 | 4 | 0.13 | N[C@]1(C(=O)O)C[C@H](C(=O)O)N(Cc2ccccc2)C1 | https://dx.doi.org/10.1021/jm000007r | |
1-benzyl-APDC | 30 | None | 2 | Rat | Functional | pEC50 | = | - | 4.70 | - | 2 | Unclassified | Guide to Pharmacology | 264.1 | 4 | 3 | 4 | 0.13 | N[C@]1(C(=O)O)C[C@H](C(=O)O)N(Cc2ccccc2)C1 | - | |
1-benzyl-APDC | 30 | None | 2 | Rat | Functional | EC50 | = | 20000.00 | 4.70 | - | 2 | Tested for the agonistic activity against Metabotropic glutamate receptor 6 | ChEMBL | 264.1 | 4 | 3 | 4 | 0.13 | N[C@]1(C(=O)O)C[C@H](C(=O)O)N(Cc2ccccc2)C1 | https://dx.doi.org/10.1016/S0960-894X(97)00068-1 | |
2S,4R-4-METHYLGLUTAMATE | 100241 | None | 37 | Human | Functional | IC50 | = | 4000.00 | 5.40 | - | 1 | Antagonist activity at human recombinant GluR6 expressed in HEK cells coexpressing aequorine assessed as inhibition of glutamate-induced Ca2+ influx at 10 uM by luminescence reporter assay | ChEMBL | 161.1 | 4 | 3 | 3 | -0.49 | C[C@H](C[C@H](N)C(=O)O)C(=O)O | https://dx.doi.org/10.1016/j.ejmech.2009.09.025 | |
ACPT-I | 265 | None | 24 | Human | Functional | EC50 | = | 11000.00 | 4.96 | -2 | 7 | Agonist activity at mGlu6 (unknown origin) expressed in HEK293 cells coexpressing chimeric Gq/i protein assessed as [3H]inositol phosphate accumulation after 30 mins by scintillation and luminescence counting method | ChEMBL | 217.1 | 3 | 4 | 4 | -1.04 | N[C@@]1(C(=O)O)C[C@H](C(=O)O)[C@H](C(=O)O)C1 | https://dx.doi.org/10.1021/acs.jmedchem.7b01438 | |
ACPT-I | 265 | None | 24 | Rat | Functional | pIC50 | None | - | 4.70 | -3 | 7 | Unclassified | Guide to Pharmacology | 217.1 | 3 | 4 | 4 | -1.04 | N[C@@]1(C(=O)O)C[C@H](C(=O)O)[C@H](C(=O)O)C1 | - | |
ACPT-I | 265 | None | 24 | Rat | Functional | EC50 | = | 10600.00 | 4.97 | -3 | 7 | Agonist activity at rat mGlu6 receptor expressed in HEK293 cells co-transfected with G-protein alpha and EAAC1 assessed as increase in intracellular inositol phosphate accumulation after 1 hr by scintillation counting | ChEMBL | 217.1 | 3 | 4 | 4 | -1.04 | N[C@@]1(C(=O)O)C[C@H](C(=O)O)[C@H](C(=O)O)C1 | https://dx.doi.org/10.1021/jm901523t | |
ACPT-I | 265 | None | 24 | Rat | Functional | EC50 | = | 18400.00 | 4.74 | -3 | 7 | Activity at rat mGluR6 receptor measured as intracellular calcium concentration in HEK293 cells | ChEMBL | 217.1 | 3 | 4 | 4 | -1.04 | N[C@@]1(C(=O)O)C[C@H](C(=O)O)[C@H](C(=O)O)C1 | https://dx.doi.org/10.1016/j.bmcl.2006.06.062 |
Showing 1 to 20 of 170 entries