Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
norrin | 2865 | None | 0 | Mouse | Binding | pKd | None | - | 8.40 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15035989 |
Showing 1 to 1 of 1 entry
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
FzM1 | 1704 | None | 0 | Human | Functional | pIC50 | = | - | 6.20 | - | 1 | In TCF/LEF reporter assays with WRE-GFP constructs. | Guide to Pharmacology | 360.1 | 3 | 3 | 3 | 5.92 | O=C(Nc1cc(O)cc(-c2cccs2)c1)Nc1ccc2ccccc2c1 | https://pubmed.ncbi.nlm.nih.gov/29293331 | |
FzM1 | 1704 | None | 0 | Human | Functional | pIC50 | = | - | 6.20 | - | 1 | In TCF/LEF reporter assays with WRE-GFP constructs. | Guide to Pharmacology | 360.1 | 3 | 3 | 3 | 5.92 | O=C(Nc1cc(O)cc(-c2cccs2)c1)Nc1ccc2ccccc2c1 | https://pubmed.ncbi.nlm.nih.gov/25751279 | |
FzM1.8 | 1705 | None | 0 | Human | Functional | pEC50 | = | - | 6.40 | - | 1 | In a TCF/LEF reporter assay with WRE-GFP constructs. | Guide to Pharmacology | 322.1 | 3 | 4 | 3 | 3.89 | O=C(Nc1cc(O)cc(C(=O)O)c1)Nc1ccc2ccccc2c1 | https://pubmed.ncbi.nlm.nih.gov/29293331 | |
FzM1.8 | 1705 | None | 0 | Human | Functional | pIC50 | = | - | 6.65 | - | 1 | In TCF/LEF reporter assays with WRE-GFP constructs | Guide to Pharmacology | 322.1 | 3 | 4 | 3 | 3.89 | O=C(Nc1cc(O)cc(C(=O)O)c1)Nc1ccc2ccccc2c1 | https://pubmed.ncbi.nlm.nih.gov/25751279 |
Showing 1 to 4 of 4 entries