Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
No data available in table |
Showing 0 to 0 of 0 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
4-Nitrophenyl-β-D-mannopyranoside | 123 | None | 0 | Human | Functional | pEC50 | = | - | 3.19 | - | 1 | Unclassified | Guide to Pharmacology | 301.1 | 4 | 4 | 8 | -1.23 | O=[N+]([O-])c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc1 | https://pubmed.ncbi.nlm.nih.gov/28798468 | |
beta-gentiobiose | 615 | None | 0 | Human | Functional | pEC50 | = | - | 2.42 | - | 1 | Unclassified | Guide to Pharmacology | 342.1 | 4 | 8 | 11 | -5.40 | OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O | https://pubmed.ncbi.nlm.nih.gov/20965151 | |
D-(-)-Amygdalin | 1314 | None | 0 | Human | Functional | pEC50 | = | - | 1.70 | - | 1 | Unclassified | Guide to Pharmacology | 457.2 | 7 | 7 | 12 | -3.11 | N#CC(OC1OC(COC2OC(CO)C(O)C(O)C2O)C(O)C(O)C1O)c1ccccc1 | https://pubmed.ncbi.nlm.nih.gov/12379855 | |
isoprenaline | 2091 | None | 34 | Human | Functional | pEC50 | = | 8.31 | 8.08 | -63 | 49 | Agonist activity at human TAS2R16 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay | Drug Central | 211.1 | 4 | 4 | 4 | 1.13 | CC(C)NCC(O)c1ccc(O)c(O)c1 | - | |
isoprenaline | 2091 | None | 34 | Human | Functional | EC50 | = | 4.90 | 8.31 | -63 | 49 | Agonist activity at human TAS2R16 expressed in HEK293T cells co-expressing Galpha15 assessed as increase in intracellular calcium level by Calcium-3 dye based fluorescence assay | ChEMBL | 211.1 | 4 | 4 | 4 | 1.13 | CC(C)NCC(O)c1ccc(O)c(O)c1 | - | |
Phenyl-β-D-glucopyranoside | 3099 | None | 45 | Human | Functional | pEC50 | = | - | 2.96 | - | 1 | Unclassified | Guide to Pharmacology | 256.1 | 3 | 4 | 6 | -1.14 | OC[C@H]1O[C@@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O | https://pubmed.ncbi.nlm.nih.gov/12379855 | |
Phenyl-β-D-glucopyranoside | 3099 | None | 45 | Human | Functional | EC50 | = | 210.00 | 6.68 | - | 1 | Activation of full-length human TAS2R16 expressed in HEK293T/Galpha16-gustducin 44 cells assessed as effect on calcium flux by measuring deltaF/F0 ratio by Fluo-4 dye based FLIPR assay | ChEMBL | 256.1 | 3 | 4 | 6 | -1.14 | OC[C@H]1O[C@@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O | - | |
Phenyl-β-D-glucopyranoside | 3099 | None | 45 | Human | Functional | EC50 | = | 250.00 | 6.60 | - | 1 | Activation of full-length human TAS2R16 expressed in HEK293T/Galpha16-gustducin 44 cells assessed as effect on calcium flux by measuring deltaF/F0 ratio in presence of (E)-4-(2,2,3-trimethylcyclopent-3-enyl)but-2-enoic acid by Fluo-4 dye based FLIPR assay | ChEMBL | 256.1 | 3 | 4 | 6 | -1.14 | OC[C@H]1O[C@@H](Oc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O | - | |
probenecid | 3170 | None | 0 | Human | Functional | pIC50 | = | - | 3.53 | -1 | 2 | Unclassified | Guide to Pharmacology | 285.1 | 7 | 1 | 3 | 2.20 | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)O)cc1 | https://pubmed.ncbi.nlm.nih.gov/21629661 | |
salicin | 3462 | None | 0 | Human | Functional | pEC50 | = | - | 2.85 | - | 1 | Unclassified | Guide to Pharmacology | 286.1 | 4 | 5 | 7 | -1.64 | OCc1ccccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | https://pubmed.ncbi.nlm.nih.gov/12379855 |
Showing 1 to 10 of 10 entries