Initializing potency table...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.95 | -15 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
α-methyl-5-HT | 364 | None | 24 | Human | Binding | pKi | None | - | 6.95 | -15 | 19 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | https://pubmed.ncbi.nlm.nih.gov/14744596 | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 120.22 | 6.92 | -15 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
α-methyl-5-HT | 364 | 3H-5HT | 24 | Human | Binding | pKi | = | 121.00 | 6.92 | -15 | 19 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.76 | CC(N)Cc1c[nH]c2ccc(O)cc12 | - | |
(-)-stepholidine | 3691 | 3H-5HT | 40 | Human | Binding | pKi | = | 10000.00 | 5.00 | -2290 | 35 | - | PDSP KiDatabase | 327.1 | 2 | 2 | 5 | 2.77 | COc1cc2c(cc1O)[C@@H]1Cc3ccc(O)c(OC)c3CN1CC2 | - | |
(1R,2S)-PHENYLPROPANOLAMINE | 27120 | 3H-5HT | 13 | Human | Binding | pKi | = | 10000.00 | 5.00 | -38 | 42 | - | PDSP KiDatabase | 151.1 | 2 | 2 | 2 | 1.07 | C[C@H](N)[C@H](O)c1ccccc1 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 208.92 | 6.68 | -72 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | 3H-5HT | 37 | Human | Binding | pKi | = | 207.00 | 6.68 | -72 | 21 | - | PDSP KiDatabase | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | - | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8863519 | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
1-naphthylpiperazine | 35 | None | 37 | Human | Binding | pKi | None | - | 6.85 | -72 | 21 | Unclassified | Guide to Pharmacology | 212.1 | 1 | 1 | 2 | 2.25 | c1ccc2c(N3CCNCC3)cccc2c1 | https://pubmed.ncbi.nlm.nih.gov/14744596 | |
2-(4'-Methylaminophenyl)Benzothiazole | 220178 | 3H-5HT | 0 | Human | Binding | pKi | = | 13.00 | 7.89 | -6 | 7 | - | PDSP KiDatabase | 268.1 | 3 | 1 | 5 | 4.75 | CNc1ccc(N=Nc2ccc3ncsc3c2)cc1 | - | |
2-methyl-5-HT | 81 | None | 43 | Human | Binding | pKi | None | - | 6.10 | -8 | 21 | Unclassified | Guide to Pharmacology | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 817.00 | 6.09 | -8 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
2-methyl-5-HT | 81 | 3H-5HT | 43 | Human | Binding | pKi | = | 812.83 | 6.09 | -8 | 21 | - | PDSP KiDatabase | 190.1 | 2 | 3 | 2 | 1.68 | Cc1[nH]c2ccc(O)cc2c1CCN | - | |
5-BODMT | 129 | None | 0 | Human | Binding | pKi | = | - | 6.62 | -66 | 2 | Unclassified | Guide to Pharmacology | 272.2 | 7 | 1 | 2 | 3.18 | CCCC(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 | https://pubmed.ncbi.nlm.nih.gov/21422162 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8863519 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/1608964 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/8380639 | |
5-CT | 134 | None | 25 | Human | Binding | pKi | None | - | 5.30 | -33884 | 39 | Unclassified | Guide to Pharmacology | 203.1 | 3 | 3 | 2 | 0.77 | NCCc1c[nH]c2ccc(C(N)=O)cc12 | https://pubmed.ncbi.nlm.nih.gov/14744596 |
Showing 1 to 20 of 379 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name |
GPCRdb ID |
Reference ligand |
Vendors | Species | Assay Type |
Activity Type |
Activity Relation |
Activity Value |
p-value (-log) |
Fold selectivity |
Tested GPCRs |
Assay Description |
Source | Mol weight |
Rot Bonds |
H don | H acc | LogP | Smiles | DOI | |