Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
[D-Arg1,D-Phe5,D-Trp7,9,Leu11]substance P | 1321 | None | 0 | Human | Binding | pKd | = | - | 7.35 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/12907757 | |
[des-octanoyl]ghrelin | 1391 | None | 0 | Rat | Binding | pKi | = | - | 7.90 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/11314756 | |
[des-octanoyl]ghrelin | 1391 | None | 0 | Rat | Binding | pKi | = | - | 7.90 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/14763915 | |
amiodarone | 398 | None | 47 | Human | Binding | AC50 | = | 7021.40 | 5.15 | - | 40 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 645.0 | 11 | 0 | 4 | 6.94 | CCCCc1oc2ccccc2c1C(=O)c1cc(I)c(OCCN(CC)CC)c(I)c1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
APRINDINE | 15289 | None | 20 | Human | Binding | AC50 | = | 15000.00 | 4.82 | - | 12 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 322.2 | 8 | 0 | 2 | 4.39 | CCN(CC)CCCN(c1ccccc1)C1Cc2ccccc2C1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
aripiprazole | 470 | None | 70 | Human | Binding | AC50 | = | 12041.60 | 4.92 | - | 60 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 447.1 | 7 | 1 | 4 | 4.86 | O=C1CCc2ccc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc2N1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
ASENAPINE | 107587 | None | 16 | Human | Binding | AC50 | = | 23999.90 | 4.62 | - | 54 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 285.1 | 0 | 0 | 2 | 4.26 | CN1CC2c3ccccc3Oc3ccc(Cl)cc3C2C1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
astemizole | 505 | None | 55 | Human | Binding | AC50 | = | 8199.90 | 5.09 | - | 48 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 458.2 | 8 | 1 | 5 | 5.35 | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
ATAZANAVIR | 10423 | None | 49 | Human | Binding | AC50 | = | 10600.10 | 4.97 | - | 4 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 704.4 | 14 | 5 | 9 | 4.21 | COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc1ccc(-c2ccccn2)cc1)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
ATRACURIUM | 26472 | None | 27 | Human | Binding | AC50 | = | 11200.10 | 4.95 | - | 6 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 928.5 | 24 | 0 | 12 | 8.07 | COc1ccc(CC2c3cc(OC)c(OC)cc3CC[N+]2(C)CCC(=O)OCCCCCOC(=O)CC[N+]2(C)CCc3cc(OC)c(OC)cc3C2Cc2ccc(OC)c(OC)c2)cc1OC | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
azelastine | 559 | None | 45 | Human | Binding | AC50 | = | 14000.10 | 4.85 | - | 25 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 381.2 | 3 | 0 | 4 | 4.30 | CN1CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BAZEDOXIFENE | 178724 | None | 43 | Human | Binding | AC50 | = | 1100.00 | 5.96 | - | 19 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 470.3 | 7 | 2 | 5 | 6.33 | Cc1c(-c2ccc(O)cc2)n(Cc2ccc(OCCN3CCCCCC3)cc2)c2ccc(O)cc12 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BENFLUOREX | 154946 | None | 18 | Human | Binding | AC50 | = | 28000.10 | 4.55 | - | 15 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 351.1 | 7 | 1 | 3 | 4.08 | CC(Cc1cccc(C(F)(F)F)c1)NCCOC(=O)c1ccccc1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BENIDIPINE | 77126 | None | 16 | Human | Binding | AC50 | = | 25999.80 | 4.58 | - | 11 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 505.2 | 7 | 1 | 8 | 4.21 | COC(=O)C1=C(C)NC(C)=C(C(=O)OC2CCCN(Cc3ccccc3)C2)C1c1cccc([N+](=O)[O-])c1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
benperidol | 596 | None | 33 | Human | Binding | AC50 | = | 17000.00 | 4.77 | - | 24 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 381.2 | 6 | 1 | 4 | 3.77 | O=C(CCCN1CCC(n2c(=O)[nH]c3ccccc32)CC1)c1ccc(F)cc1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BENZETHONIUM | 11852 | None | 18 | Human | Binding | AC50 | = | 6400.00 | 5.19 | - | 35 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 412.3 | 11 | 0 | 2 | 6.07 | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BEPRIDIL | 4301 | None | 35 | Human | Binding | AC50 | = | 22137.50 | 4.66 | - | 22 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 366.3 | 10 | 0 | 3 | 4.83 | CC(C)COCC(CN(Cc1ccccc1)c1ccccc1)N1CCCC1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BICALUTAMIDE | 158486 | None | 71 | Human | Binding | AC50 | = | 2200.00 | 5.66 | - | 2 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 430.1 | 5 | 2 | 5 | 2.88 | CC(O)(CS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
BIM 28163 | 657 | None | 0 | Human | Binding | pKi | = | - | 8.09 | - | 1 | Unclassified | Guide to Pharmacology | - | - | - | - | - | - | https://pubmed.ncbi.nlm.nih.gov/15339248 | |
BOPINDOLOL | 121354 | None | 36 | Human | Binding | AC50 | = | 16000.00 | 4.80 | - | 12 | Binding affinity towards human GHSR in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 380.2 | 7 | 2 | 4 | 4.47 | Cc1cc2c(OCC(CNC(C)(C)C)OC(=O)c3ccccc3)cccc2[nH]1 | https://dx.doi.org/10.1038/s41467-023-40064-9 |
Showing 1 to 20 of 1,648 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Abbott 14c | 220 | None | 0 | Human | Functional | pIC50 | = | - | 8.15 | - | 1 | Unclassified | Guide to Pharmacology | 420.2 | 6 | 4 | 6 | 3.94 | CC(C)(C)NC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1 | https://pubmed.ncbi.nlm.nih.gov/16854051 | |
Abbott 14c | 220 | None | 0 | Human | Functional | IC50 | = | 7.00 | 8.15 | - | 1 | Activity at GHS receptor by calcium flux assay in CHO-K cells | ChEMBL | 420.2 | 6 | 4 | 6 | 3.94 | CC(C)(C)NC(=O)Nc1ccc(-c2c(N)nc(N)nc2COCc2ccccc2)cc1 | https://dx.doi.org/10.1021/jm060461g | |
CAPROMORELIN | 9729 | None | 23 | Human | Functional | EC50 | = | 0.90 | 9.05 | -5 | 2 | Agonist activity at human GHS receptor assessed as intracellular myo-IP1 secretion after 90 mins by HTRF analysis | ChEMBL | 505.3 | 9 | 2 | 6 | 1.72 | CN1N=C2CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)C[C@@]2(Cc2ccccc2)C1=O | https://dx.doi.org/10.1021/acs.jmedchem.8b00322 | |
CAPROMORELIN | 9729 | None | 23 | Human | Functional | EC50 | = | 0.91 | 9.04 | -5 | 2 | Agonist activity at human GHS receptor assessed as intracellular myo-IP1 secretion after 90 mins by HTRF analysis | ChEMBL | 505.3 | 9 | 2 | 6 | 1.72 | CN1N=C2CCN(C(=O)[C@@H](COCc3ccccc3)NC(=O)C(C)(C)N)C[C@@]2(Cc2ccccc2)C1=O | https://dx.doi.org/10.1021/acs.jmedchem.8b00322 | |
CHEMBL105462 | 210927 | None | 22 | Rat | Functional | EC50 | = | 10.00 | 8.00 | 12 | 2 | In vitro growth hormone release was determined in rat pituitary cell assay | ChEMBL | - | - | - | - | - | C[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(N)=O | https://dx.doi.org/10.1016/s0960-894x(97)10199-8 | |
CHEMBL105462 | 210927 | None | 22 | Rat | Functional | EC50 | = | 1.70 | 8.77 | 12 | 2 | Tested for GH-releasing property using classical rat pituitary cell assay | ChEMBL | - | - | - | - | - | C[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(N)=O | https://dx.doi.org/10.1021/jm980197u | |
CHEMBL106841 | 5338 | None | 0 | Human | Functional | EC50 | = | 10.00 | 8.00 | - | 1 | Agonist activity at human GHS-R1 | ChEMBL | 498.3 | 9 | 5 | 4 | 3.07 | O=C(N[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](CO)Cc1c[nH]c2ccccc12)C1CCNCC1 | https://dx.doi.org/10.1016/j.bmc.2007.01.057 | |
CHEMBL106841 | 5338 | None | 0 | Human | Functional | EC50 | = | 10.00 | 8.00 | - | 1 | Agonist activity at human GHS-R1 | ChEMBL | 498.3 | 9 | 5 | 4 | 3.07 | O=C(N[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](CO)Cc1c[nH]c2ccccc12)C1CCNCC1 | https://dx.doi.org/10.1016/j.bmc.2007.01.057 | |
CHEMBL1076586 | 5536 | None | 0 | Human | Functional | IC50 | = | 100.00 | 7.00 | - | 1 | Antagonist activity at human GHSR expressed in CHOK1 cells assessed as inhibition of ghrelin-induced intracellular calcium flux by aequorin flash luminescence assay | ChEMBL | 409.2 | 3 | 1 | 2 | 4.43 | O=C(c1ccc(-c2ccccc2)cc1)N1CCN(C(=O)c2ccc3cc[nH]c3c2)CC1 | https://dx.doi.org/10.1016/j.bmcl.2010.01.043 | |
CHEMBL1077617 | 5630 | None | 0 | Human | Functional | IC50 | = | 40.00 | 7.40 | - | 1 | Antagonist activity at human GHS-R1a expressed in HEK293 cells assessed as inhibition of ghrelin-stimulated intracellular calcium mobilization | ChEMBL | 612.3 | 17 | 6 | 7 | 5.25 | CCCCCCNC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(CC(C)(C)NC[C@H](O)COc3ccc(O)cc3)cc2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.08.076 | |
CHEMBL1078207 | 5713 | None | 0 | Human | Functional | EC50 | = | 1584.89 | 5.80 | -158 | 5 | Agonist activity at human ghrelin receptor | ChEMBL | 458.2 | 6 | 2 | 4 | 4.48 | O=S(=O)(Nc1ccc2c(c1)CCN(Cc1cc[nH]n1)CC2)c1ccc(-c2ccccc2)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1078208 | 5714 | None | 0 | Human | Functional | EC50 | = | 158.49 | 6.80 | -39 | 5 | Agonist activity at human ghrelin receptor | ChEMBL | 440.2 | 7 | 2 | 5 | 3.60 | CC(C)Oc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2cc[nH]n2)CC3)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1078490 | 5757 | None | 0 | Human | Functional | EC50 | = | 630.96 | 6.20 | -125 | 2 | Agonist activity at human ghrelin receptor | ChEMBL | 466.2 | 5 | 2 | 5 | 3.92 | CC1(C)CCc2cc(S(=O)(=O)Nc3ccc4c(c3)CCN(Cc3cc[nH]n3)CC4)ccc2O1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1079185 | 5844 | None | 0 | Human | Functional | EC50 | = | 3.98 | 8.40 | 1 | 2 | Agonist activity at human ghrelin receptor | ChEMBL | 438.2 | 8 | 2 | 4 | 4.15 | CCCCc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2cnc[nH]2)CC3)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1079186 | 5845 | None | 0 | Human | Functional | EC50 | = | 3.98 | 8.40 | -1 | 2 | Agonist activity at human ghrelin receptor | ChEMBL | 452.2 | 8 | 2 | 4 | 4.46 | CCCCc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2[nH]cnc2C)CC3)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1079187 | 5846 | None | 0 | Human | Functional | EC50 | = | 19.95 | 7.70 | 3 | 2 | Agonist activity at human ghrelin receptor | ChEMBL | 452.2 | 8 | 2 | 4 | 4.46 | CCCCc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2cnc(C)[nH]2)CC3)cc1 | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1079311 | 5858 | None | 0 | Human | Functional | EC50 | = | 79.43 | 7.10 | -1 | 5 | Agonist activity at human ghrelin receptor | ChEMBL | 430.1 | 5 | 2 | 4 | 3.77 | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)CCN(Cc2cc[nH]n2)CC3)cc1Cl | https://dx.doi.org/10.1016/j.bmcl.2009.09.027 | |
CHEMBL1079622 | 5911 | None | 0 | Human | Functional | IC50 | = | 37.20 | 7.43 | - | 1 | Antagonist activity at human GHSR expressed in CHOK1 cells assessed as inhibition of ghrelin-induced intracellular calcium flux by aequorin flash luminescence assay | ChEMBL | 458.2 | 3 | 1 | 3 | 4.87 | C[C@H]1CN(C(=O)c2ccc(-c3ccccc3Cl)cn2)CCN1C(=O)c1ccc2cc[nH]c2c1 | https://dx.doi.org/10.1016/j.bmcl.2010.01.043 | |
CHEMBL1079623 | 5912 | None | 0 | Human | Functional | IC50 | = | 33.70 | 7.47 | - | 1 | Antagonist activity at human GHSR expressed in CHOK1 cells assessed as inhibition of ghrelin-induced intracellular calcium flux by aequorin flash luminescence assay | ChEMBL | 448.1 | 3 | 1 | 4 | 4.42 | C[C@H]1CN(C(=O)c2csc(-c3ccccc3F)n2)CCN1C(=O)c1ccc2cc[nH]c2c1 | https://dx.doi.org/10.1016/j.bmcl.2010.01.043 | |
CHEMBL1079624 | 5913 | None | 0 | Human | Functional | IC50 | = | 12.70 | 7.90 | - | 1 | Antagonist activity at human GHSR expressed in CHOK1 cells assessed as inhibition of ghrelin-induced intracellular calcium flux by aequorin flash luminescence assay | ChEMBL | 424.2 | 3 | 1 | 3 | 4.22 | C[C@H]1CN(C(=O)c2ccc(-c3ccncc3)cc2)CCN1C(=O)c1ccc2cc[nH]c2c1 | https://dx.doi.org/10.1016/j.bmcl.2010.01.043 |
Showing 1 to 20 of 1,539 entries