Ligand source activities (1 row/activity)
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 136036237 | 188746 | None | 0 | Human | Functional | pEC50 | = | 5.9 | 5.9 | -3 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 632 | 7 | 3 | 6 | 5.9 | CCC(C)[C@H]1C(=O)Nc2ccc(N3CCC(NC(C)=O)C3)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL503202 | 188746 | None | 0 | Human | Functional | pEC50 | = | 5.9 | 5.9 | -3 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 632 | 7 | 3 | 6 | 5.9 | CCC(C)[C@H]1C(=O)Nc2ccc(N3CCC(NC(C)=O)C3)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| 136036259 | 188770 | None | 0 | Human | Functional | pEC50 | = | 6.8 | 6.8 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 550 | 6 | 2 | 6 | 5.6 | CC(C)[C@H]1C(=O)Nc2ccc(NCc3ccccc3)cc2-c2nc3cc(C(=O)N(C)C4CCN(C)CC4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL503688 | 188770 | None | 0 | Human | Functional | pEC50 | = | 6.8 | 6.8 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 550 | 6 | 2 | 6 | 5.6 | CC(C)[C@H]1C(=O)Nc2ccc(NCc3ccccc3)cc2-c2nc3cc(C(=O)N(C)C4CCN(C)CC4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| 136036261 | 188860 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -10 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 632 | 9 | 3 | 6 | 7.1 | CCC(C)[C@H]1C(=O)Nc2ccc(NCCN3CCCCC3)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL505263 | 188860 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -10 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 632 | 9 | 3 | 6 | 7.1 | CCC(C)[C@H]1C(=O)Nc2ccc(NCCN3CCCCC3)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| 135407952 | 1060 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 542 | 4 | 2 | 6 | 5.8 | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 | 10.1016/j.bmcl.2009.01.085 | ||
| 5530 | 1060 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 542 | 4 | 2 | 6 | 5.8 | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL463274 | 1060 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 542 | 4 | 2 | 6 | 5.8 | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 | 10.1016/j.bmcl.2009.01.085 | ||
| 135869412 | 188550 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 619 | 6 | 1 | 7 | 5.3 | CC(C)[C@H]1C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2-c2nc3cc(C(=O)N(C)C4CCN(C)CC4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL502480 | 188550 | None | 0 | Human | Functional | pEC50 | = | 6.4 | 6.4 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 619 | 6 | 1 | 7 | 5.3 | CC(C)[C@H]1C(=O)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2-c2nc3cc(C(=O)N(C)C4CCN(C)CC4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL2448526 | 212959 | None | 0 | Human | Functional | pEC50 | = | 6.3 | 6.3 | - | 1 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | None | None | None | C[C@@H](O)[C@@H]1NC(=O)[C@@H](CCCCN)NC(=O)[C@H](Cc2c[nH]c3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@@H]2CCCN2)CSSC[C@@H](C(=O)N[C@@H](CCCCN)C(=O)O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](Cc2ccccc2)NC1=O | 10.1016/j.bmcl.2009.01.085 | ||||
| 135407930 | 188527 | None | 0 | Human | Functional | pEC50 | = | 6.2 | 6.2 | -10 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 606 | 10 | 3 | 6 | 6.6 | CCC(C)[C@H]1C(=O)Nc2ccc(NCCCN(C)C)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| CHEMBL502132 | 188527 | None | 0 | Human | Functional | pEC50 | = | 6.2 | 6.2 | -10 | 2 | Agonist activity at human MrgX2 receptorAgonist activity at human MrgX2 receptor |
ChEMBL | 606 | 10 | 3 | 6 | 6.6 | CCC(C)[C@H]1C(=O)Nc2ccc(NCCCN(C)C)cc2-c2nc3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccc3n21 | 10.1016/j.bmcl.2009.01.085 | ||
| 164734529 | 190948 | None | 3 | Human | Functional | pIC50 | = | 8.6 | 8.6 | - | 1 | Antagonist activity at human MRGPRX2 expressed in HEK293 cells co-expressing mouse Galpha15 assessed as inhibition of Cortistatin-14 induced Ca2+ mobilization preincubated for 30 mins followed by Cortistatin-14 addition by FLIPRtetra-calcium mobilization assayAntagonist activity at human MRGPRX2 expressed in HEK293 cells co-expressing mouse Galpha15 assessed as inhibition of Cortistatin-14 induced Ca2+ mobilization preincubated for 30 mins followed by Cortistatin-14 addition by FLIPRtetra-calcium mobilization assay |
ChEMBL | 491 | 6 | 1 | 6 | 3.6 | C[C@@H](C(=O)Nc1cnc(Oc2ccc(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2cc[n+]([O-])cc2)C1 | 10.1021/acsmedchemlett.2c00262 | ||
| CHEMBL5184300 | 190948 | None | 3 | Human | Functional | pIC50 | = | 8.6 | 8.6 | - | 1 | Antagonist activity at human MRGPRX2 expressed in HEK293 cells co-expressing mouse Galpha15 assessed as inhibition of Cortistatin-14 induced Ca2+ mobilization preincubated for 30 mins followed by Cortistatin-14 addition by FLIPRtetra-calcium mobilization assayAntagonist activity at human MRGPRX2 expressed in HEK293 cells co-expressing mouse Galpha15 assessed as inhibition of Cortistatin-14 induced Ca2+ mobilization preincubated for 30 mins followed by Cortistatin-14 addition by FLIPRtetra-calcium mobilization assay |
ChEMBL | 491 | 6 | 1 | 6 | 3.6 | C[C@@H](C(=O)Nc1cnc(Oc2ccc(F)cc2F)cn1)N1CCC(F)(F)[C@@H](c2cc[n+]([O-])cc2)C1 | 10.1021/acsmedchemlett.2c00262 | ||
| 9567 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 11765135 | ||
| 9567 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 23396314 | ||
| 9567 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 28288109 | ||
| 9950038 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 11765135 | ||
| 9950038 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 23396314 | ||
| 9950038 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 28288109 | ||
| CHEMBL327745 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 11765135 | ||
| CHEMBL327745 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 23396314 | ||
| CHEMBL327745 | 3750 | None | 6 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1819 | 3 | Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR).Assayed using racemic TAN-67, the more active stereoisomer is the (4aS,12aR). |
Guide to Pharmacology | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2([C@H](C1)Cc1c(C2)nc2c(c1)cccc2)c1cccc(c1)O | 28288109 | ||
| 10567 | 1837 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1 | 3 | Determined in a FLIPR calcium imaging assay using HEK cells heterologously expressing hMRGPRX2Determined in a FLIPR calcium imaging assay using HEK cells heterologously expressing hMRGPRX2 |
Guide to Pharmacology | None | None | None | None | 35704588 | ||||
| 145996510 | 1837 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | -1 | 3 | Determined in a FLIPR calcium imaging assay using HEK cells heterologously expressing hMRGPRX2Determined in a FLIPR calcium imaging assay using HEK cells heterologously expressing hMRGPRX2 |
Guide to Pharmacology | None | None | None | None | 35704588 | ||||
| 2098 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 25517090 | ||||
| 2098 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 28288109 | ||||
| 36511 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 25517090 | ||||
| 36511 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 28288109 | ||||
| 3805 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 25517090 | ||||
| 3805 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 28288109 | ||||
| 3835 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 25517090 | ||||
| 3835 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 28288109 | ||||
| CHEMBL235363 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 25517090 | ||||
| CHEMBL235363 | 3694 | None | 31 | Human | Functional | pEC50 | = | 6.0 | 6.0 | -2089 | 11 | In a calcium mobilisation asay.In a calcium mobilisation asay. |
Guide to Pharmacology | None | None | None | None | 28288109 | ||||
| 16133849 | 3676 | None | 11 | Human | Functional | pEC50 | = | 5.4 | 5.4 | -66069 | 4 | In a calcium mobilisation assay.In a calcium mobilisation assay. |
Guide to Pharmacology | None | None | None | None | 23396314 | ||||
| 2020 | 3676 | None | 11 | Human | Functional | pEC50 | = | 5.4 | 5.4 | -66069 | 4 | In a calcium mobilisation assay.In a calcium mobilisation assay. |
Guide to Pharmacology | None | None | None | None | 23396314 | ||||
| 91935900 | 3676 | None | 11 | Human | Functional | pEC50 | = | 5.4 | 5.4 | -66069 | 4 | In a calcium mobilisation assay.In a calcium mobilisation assay. |
Guide to Pharmacology | None | None | None | None | 23396314 | ||||
| CHEMBL501796 | 3676 | None | 11 | Human | Functional | pEC50 | = | 5.4 | 5.4 | -66069 | 4 | In a calcium mobilisation assay.In a calcium mobilisation assay. |
Guide to Pharmacology | None | None | None | None | 23396314 | ||||
| 12988 | 1580 | None | 0 | Human | Functional | pEC50 | = | 5.4 | 5.4 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 673 | 5 | 2 | 9 | 6.2 | NC1=C(C#N)C2=C(C=CC(F)=C2S1)C3=C(F)C4=NC(OC[C@@]56CCCN5C[C@H](F)C6)=NC(N7CC8CCC(C7)N8)=C4C=C3C(F)(F)F | 37321326 | ||
| 164904685 | 1580 | None | 0 | Human | Functional | pEC50 | = | 5.4 | 5.4 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 673 | 5 | 2 | 9 | 6.2 | NC1=C(C#N)C2=C(C=CC(F)=C2S1)C3=C(F)C4=NC(OC[C@@]56CCCN5C[C@H](F)C6)=NC(N7CC8CCC(C7)N8)=C4C=C3C(F)(F)F | 37321326 | ||
| 2855 | 1104 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 519 | 16 | 3 | 6 | 4.2 | CNCCc1cc(Cc2cc(CCNC)ccc2OC)c(c(c1)Cc1cc(CCNC)ccc1OC)OC | 28288109 | ||
| 5531 | 1104 | None | 0 | Human | Functional | pEC50 | = | 5.7 | 5.7 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 519 | 16 | 3 | 6 | 4.2 | CNCCc1cc(Cc2cc(CCNC)ccc2OC)c(c(c1)Cc1cc(CCNC)ccc1OC)OC | 28288109 | ||
| 9566 | 3426 | None | 17 | Human | Functional | pEC50 | = | 6.1 | 6.1 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 28288109 | ||
| 95882507 | 3426 | None | 17 | Human | Functional | pEC50 | = | 6.1 | 6.1 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 28288109 | ||
| CHEMBL4520293 | 3426 | None | 17 | Human | Functional | pEC50 | = | 6.1 | 6.1 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 28288109 | ||
| 135407952 | 1060 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 542 | 4 | 2 | 6 | 5.8 | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 | 19230660 | ||
| 5530 | 1060 | None | 0 | Human | Functional | pEC50 | = | 6.5 | 6.5 | - | 1 | UnclassifiedUnclassified |
Guide to Pharmacology | 542 | 4 | 2 | 6 | 5.8 | CN1CCCN(CC1)C(=O)c1ccc2c(c1)nc1n2[C@@H](C(C)C)C(=O)Nc2c1cc(cc2)NC1CCCCCC1 | 19230660 | ||
Showing 1 to 50 of 56 entries
| Ligands (move mouse cursor over ligand name to see structure) | Receptor | Activity | Chemical information | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
Ligands (move mouse cursor over ligand name to see structure)
| Receptor
| Activity
| Chemical information
| |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Sel. page | Common name
| GPCRdb ID
| Reference ligand
| Vendors | Species
| Assay Type
| Activity Type
| Activity Relation
| Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description
| Source
| Mol weight | Rot Bonds | H don | H acc | LogP | Smiles
| DOI
| |
| 9566 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | FLIPR assayFLIPR assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| 95882507 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | FLIPR assayFLIPR assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| CHEMBL4520293 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | FLIPR assayFLIPR assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| 9566 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5212743 | ||
| 95882507 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5212743 | ||
| CHEMBL4520293 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6 | 6.0 | - | 5 | Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2Selectivity interaction (FLIPR assay) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5212743 | ||
| 12074028 | 190995 | None | 0 | Human | Binding | pEC50 | = | 6.5 | 6.5 | - | 0 | Agonistic activity at MRGPRX2 (unknown origin)Agonistic activity at MRGPRX2 (unknown origin) |
ChEMBL | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2(c3cccc(O)c3)Cc3nc4ccccc4cc3C[C@@H]2C1 | 10.1016/j.bmcl.2021.128485 | ||
| CHEMBL5184932 | 190995 | None | 0 | Human | Binding | pEC50 | = | 6.5 | 6.5 | - | 0 | Agonistic activity at MRGPRX2 (unknown origin)Agonistic activity at MRGPRX2 (unknown origin) |
ChEMBL | 344 | 1 | 1 | 3 | 3.9 | CN1CC[C@]2(c3cccc(O)c3)Cc3nc4ccccc4cc3C[C@@H]2C1 | 10.1016/j.bmcl.2021.128485 | ||
| 9566 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5210121 | ||
| 95882507 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5210121 | ||
| CHEMBL4520293 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2Affinity On-target Cellular interaction (PRESTO-Tango concentration response assay (by the NIMH-PDSP)) EUB0000353a MRGPRX2 |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL5210121 | ||
| 9566 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | PRESTO-Tango concentration response assayPRESTO-Tango concentration response assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| 95882507 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | PRESTO-Tango concentration response assayPRESTO-Tango concentration response assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| CHEMBL4520293 | 3426 | None | 17 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 5 | PRESTO-Tango concentration response assayPRESTO-Tango concentration response assay |
ChEMBL | 307 | 3 | 0 | 5 | 2.5 | CN([C@@H]1CCN(C1)c1cc(nc2n1ncc2)c1ccccc1)C | 10.6019/CHEMBL4507322 | ||
| 129072557 | 177311 | None | 6 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 0 | Agonist activity at MRGPX2 (unknown origin)Agonist activity at MRGPX2 (unknown origin) |
ChEMBL | 763 | 9 | 5 | 10 | 3.1 | Cc1cc(C[C@@H](NC(=O)N2CCC3(CC2)OC(=O)Nc2ncccc23)C(=O)N[C@@H](CC2CCNCC2)C(=O)N2CCN(c3ccncc3)CC2)cc2cn[nH]c12 | 10.1021/acs.jmedchem.0c01003 | ||
| CHEMBL4635331 | 177311 | None | 6 | Human | Binding | pEC50 | = | 6.1 | 6.1 | - | 0 | Agonist activity at MRGPX2 (unknown origin)Agonist activity at MRGPX2 (unknown origin) |
ChEMBL | 763 | 9 | 5 | 10 | 3.1 | Cc1cc(C[C@@H](NC(=O)N2CCC3(CC2)OC(=O)Nc2ncccc23)C(=O)N[C@@H](CC2CCNCC2)C(=O)N2CCN(c3ccncc3)CC2)cc2cn[nH]c12 | 10.1021/acs.jmedchem.0c01003 | ||
Showing 1 to 16 of 16 entries