Finalizing display...
Ligand source activities (1 row/activity)
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| BACLOFEN | 206531 | None | 76 | Human | Binding | AC50 | = | 2384.20 | 5.62 | - | 3 | Binding affinity towards human GABBR1 in an in vitro assay with cellular components measured by scintillation proximity assay | ChEMBL | 213.1 | 4 | 2 | 2 | 1.86 | NCC(CC(=O)O)c1ccc(Cl)cc1 | https://dx.doi.org/10.1038/s41467-023-40064-9 | |
| CGP 35348 | 892 | None | 39 | Rat | Binding | IC50 | = | 27000.00 | 4.57 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 225.1 | 8 | 2 | 4 | 0.96 | CCOC(OCC)P(=O)(O)CCCN | https://dx.doi.org/10.1021/jm00017a016 | |
| CGP 54626A | 895 | None | 12 | Human | Binding | IC50 | = | 6.40 | 8.19 | 380 | 4 | Displacement of [3H]CGP54626 from human recombinant GABAB1A receptor expressed in CHO cells after 3 hrs | ChEMBL | 407.1 | 8 | 3 | 3 | 4.86 | C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1 | https://dx.doi.org/10.1016/j.bmcl.2013.01.025 | |
| CGP 54626A | 895 | None | 12 | Human | Binding | Ki | = | 2.90 | 8.54 | 380 | 4 | Displacement of [3H]CGP54626 from human recombinant GABAB1A receptor expressed in CHO cells after 3 hrs | ChEMBL | 407.1 | 8 | 3 | 3 | 4.86 | C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1 | https://dx.doi.org/10.1016/j.bmcl.2013.01.025 | |
| CHEMBL111817 | 9456 | None | 0 | Rat | Binding | IC50 | = | 29000.00 | 4.54 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 195.1 | 6 | 3 | 3 | 0.38 | CCCCP(=O)(O)CC(O)CN | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL111890 | 9465 | None | 1 | Rat | Binding | IC50 | = | 16000.00 | 4.80 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 165.1 | 5 | 2 | 2 | 1.02 | CCCP(=O)(O)CCCN | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112019 | 9490 | None | 0 | Rat | Binding | IC50 | = | 5000.00 | 5.30 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 235.1 | 5 | 3 | 3 | 1.16 | NCC(O)CP(=O)(O)CC1CCCCC1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112203 | 9529 | None | 0 | Rat | Binding | IC50 | = | 5.00 | 8.30 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 123.0 | 3 | 2 | 2 | -0.20 | NCCC[PH](=O)O | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112213 | 9531 | None | 0 | Rat | Binding | IC50 | = | 39000.00 | 4.41 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 207.1 | 4 | 2 | 3 | 1.13 | NCCCP(=O)(O)C1CCCCO1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112248 | 9537 | None | 1 | Rat | Binding | IC50 | = | 50000.00 | 4.30 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 152.1 | 4 | 3 | 3 | -0.48 | NCCCP(=O)(O)CN | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112291 | 9546 | None | 0 | Rat | Binding | IC50 | = | 29000.00 | 4.54 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 180.1 | 6 | 3 | 3 | -0.05 | NCCCP(=O)(O)CCCN | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112362 | 9563 | None | 27 | Rat | Binding | IC50 | = | 4000.00 | 5.40 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 219.1 | 5 | 2 | 2 | 2.19 | NCCCP(=O)(O)CC1CCCCC1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112376 | 9565 | None | 0 | Rat | Binding | IC50 | = | 50000.00 | 4.30 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 233.1 | 5 | 2 | 3 | 1.36 | NCC(=O)CP(=O)(O)CC1CCCCC1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112408 | 9574 | None | 0 | Rat | Binding | IC50 | = | 18000.00 | 4.75 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 195.1 | 6 | 3 | 3 | 0.72 | CCCC(O)P(=O)(O)CCCN | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112451 | 9577 | None | 0 | Rat | Binding | IC50 | = | 32000.00 | 4.50 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 221.1 | 5 | 2 | 3 | 1.18 | NCCCP(=O)(O)CC1CCCCO1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112460 | 9579 | None | 0 | Rat | Binding | IC50 | = | 2000.00 | 5.70 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 233.2 | 6 | 2 | 2 | 2.58 | NCCCP(=O)(O)CCC1CCCCC1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112638 | 9622 | None | 0 | Rat | Binding | IC50 | = | 6000.00 | 5.22 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 214.1 | 5 | 2 | 3 | 1.20 | NCCCP(=O)(O)Cc1ccccn1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112639 | 9623 | None | 0 | Rat | Binding | IC50 | = | 2000.00 | 5.70 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 235.1 | 6 | 2 | 3 | 1.56 | NCCCP(=O)(O)CCC1CCCCO1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112658 | 9629 | None | 0 | Rat | Binding | IC50 | = | 37000.00 | 4.43 | - | 1 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 177.1 | 5 | 2 | 2 | 1.02 | NCCCP(=O)(O)CC1CC1 | https://dx.doi.org/10.1021/jm00017a016 | |
| CHEMBL112710 | 9641 | None | 35 | Rat | Binding | IC50 | = | 16.00 | 7.80 | - | 3 | Inhibition of binding of [3H]CGP-27492 to gamma-aminobutyric acid type B receptor of rat cortex. | ChEMBL | 137.1 | 3 | 2 | 2 | 0.23 | CP(=O)(O)CCCN | https://dx.doi.org/10.1021/jm00017a016 | |
Showing 1 to 20 of 56 entries
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
Ligands | Receptor | Activity | Chemical information | ||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Common name | GPCRdb ID | Reference ligand | Vendors | Species | Assay Type | Activity Type | Activity Relation | Activity Value | p-value (-log) | Fold selectivity | Tested GPCRs | Assay Description | Source | Mol weight | Rot Bonds | H don | H acc | LogP | Smiles | DOI | |
| (-)-baclofen | 568 | None | 0 | Rat | Functional | pIC50 | = | - | 4.50 | - | 1 | Unclassified | Guide to Pharmacology | 213.1 | 4 | 2 | 2 | 1.86 | NC[C@H](CC(=O)O)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| 2-hydroxy-saclofen | 68 | None | 0 | Rat | Functional | pIC50 | None | - | 4.10 | - | 1 | Unclassified | Guide to Pharmacology | 265.0 | 4 | 3 | 4 | 0.37 | NCC(O)(CS(=O)(=O)O)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| 3-APPA | 96 | None | 0 | Rat | Functional | pIC50 | = | - | 5.60 | - | 1 | Unclassified | Guide to Pharmacology | 122.0 | 3 | 2 | 2 | 0.07 | NCCC[P+](=O)O | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 35348 | 892 | None | 39 | Rat | Functional | pIC50 | = | - | 4.70 | - | 1 | Unclassified | Guide to Pharmacology | 225.1 | 8 | 2 | 4 | 0.96 | CCOC(OCC)P(=O)(O)CCCN | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 35348 | 892 | None | 39 | Rat | Functional | pIC50 | = | - | 4.70 | - | 1 | Unclassified | Guide to Pharmacology | 225.1 | 8 | 2 | 4 | 0.96 | CCOC(OCC)P(=O)(O)CCCN | https://pubmed.ncbi.nlm.nih.gov/7650685 | |
| CGP 47656 | 894 | None | 0 | Human | Functional | pIC50 | None | - | 4.90 | - | 1 | Unclassified | Guide to Pharmacology | 173.0 | 4 | 2 | 2 | 0.83 | NCCCP(=O)(O)C(F)F | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 54626A | 895 | None | 12 | Rat | Functional | pIC50 | None | - | 8.75 | 3 | 4 | Unclassified | Guide to Pharmacology | 407.1 | 8 | 3 | 3 | 4.86 | C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 56999A | 896 | None | 0 | Rat | Functional | pIC50 | None | - | 9.15 | - | 1 | Unclassified | Guide to Pharmacology | 383.2 | 9 | 4 | 4 | 3.25 | C[C@@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1cccc(C(=O)O)c1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 62349 | 897 | None | 0 | Rat | Functional | pIC50 | = | - | 8.90 | - | 1 | Unclassified | Guide to Pharmacology | 421.2 | 10 | 3 | 5 | 3.22 | COc1ccc(CP(=O)(O)C[C@@H](O)CN(C)[C@H](C)c2cccc(C(=O)O)c2)cc1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 64213 | 898 | None | 0 | Rat | Functional | pIC50 | None | - | 8.55 | - | 1 | Unclassified | Guide to Pharmacology | 646.1 | 16 | 6 | 6 | 3.90 | C[C@@H](NC[C@H](O)CP(=O)(O)CCCCCNC(=O)CCc1ccc(O)c(I)c1)c1cccc(C(=O)O)c1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CGP 71872 | 900 | None | 0 | Rat | Functional | pIC50 | None | - | 8.35 | - | 1 | Unclassified | Guide to Pharmacology | 659.1 | 15 | 6 | 7 | 4.52 | C[C@@H](NC[C@H](O)CP(=O)(O)CCCCCNC(=O)c1cc(I)c(N=[N+]=[N-])cc1O)c1cccc(C(=O)O)c1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| CHEMBL445449 | 170995 | None | 1 | Human | Functional | EC50 | = | 71900.00 | 4.14 | - | 1 | Agonist activity at human GABAb 1A/2 receptor expressed in Xenopus oocytes assessed as whole cell current production by two electrode voltage clamp method | ChEMBL | 161.1 | 1 | 2 | 2 | 0.89 | CP(=O)(O)C1=CC[C@@H](N)C1 | https://dx.doi.org/10.1021/jm7015842 | |
| CHEMBL447171 | 172142 | None | 0 | Human | Functional | EC50 | = | 52200.00 | 4.28 | - | 1 | Agonist activity at human GABAb 1A/2 receptor expressed in Xenopus oocytes assessed as whole cell current production by two electrode voltage clamp method | ChEMBL | 161.1 | 1 | 2 | 2 | 0.89 | CP(=O)(O)C1=CC[C@H](N)C1 | https://dx.doi.org/10.1021/jm7015842 | |
| CHEMBL504482 | 188814 | None | 0 | Human | Functional | EC50 | = | 51000.00 | 4.29 | - | 1 | Agonist activity at human GABAb 1A/2 receptor expressed in Xenopus oocytes assessed as whole cell current production by two electrode voltage clamp method | ChEMBL | 161.1 | 1 | 2 | 2 | 0.89 | CP(=O)(O)C1=CCC(N)C1 | https://dx.doi.org/10.1021/jm7015842 | |
| GABA | 1709 | None | 74 | Human | Functional | EC50 | = | 1700.00 | 5.77 | -4 | 7 | Agonist activity at human GABAb 1A/2 receptor expressed in Xenopus oocytes assessed as whole cell current production by two electrode voltage clamp method | ChEMBL | 103.1 | 3 | 2 | 2 | -0.19 | NCCCC(=O)O | https://dx.doi.org/10.1021/jm7015842 | |
| GABA | 1709 | None | 74 | Rat | Functional | pIC50 | None | - | 4.55 | 4 | 7 | Unclassified | Guide to Pharmacology | 103.1 | 3 | 2 | 2 | -0.19 | NCCCC(=O)O | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| GABA | 1709 | None | 74 | Rat | Functional | pIC50 | = | 4.60 | 8.34 | 4 | 7 | None | Drug Central | 103.1 | 3 | 2 | 2 | -0.19 | NCCCC(=O)O | - | |
| lesogaberan | 2296 | None | 0 | Human | Functional | pEC50 | = | - | 8.10 | - | 1 | Unclassified | Guide to Pharmacology | 141.0 | 3 | 2 | 2 | -0.25 | NC[C@@H](F)C[PH](=O)O | - | |
| saclofen | 3458 | None | 0 | Rat | Functional | pIC50 | None | - | 3.45 | - | 1 | Unclassified | Guide to Pharmacology | 249.0 | 4 | 2 | 3 | 1.27 | NCC(CS(=O)(=O)O)c1ccc(Cl)cc1 | https://pubmed.ncbi.nlm.nih.gov/9069281 | |
| SCH 50911 | 3555 | None | 0 | Rat | Functional | pIC50 | = | - | 6.40 | - | 1 | Unclassified | Guide to Pharmacology | 173.1 | 2 | 2 | 3 | 0.23 | CC1(C)CO[C@@H](CC(=O)O)CN1 | https://pubmed.ncbi.nlm.nih.gov/7562513 | |
Showing 1 to 20 of 20 entries